Boronic Acids


Catalog # Compound Name Structure
BC-1326 (2-chloro-4,5-dimethylphenyl)boronic acid
Purity: 95%
[2246683-46-3],  MFCD24217817
QV-9918 2-Chloro-3,5-dimethylphenylboronic acid
Purity: 95%
[1451391-50-6],  MFCD22543707
PN-5541 4-Chloro-3,5-dimethylphenylboronic acid, pinacol ester
Purity: 98%
[1111096-20-8],  MFCD12405360
FF-5777 2-(2-Chloro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1256781-74-4],  MFCD17215821
FM-1763 2-(4-chloro-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1374578-82-1],  MFCD23380471
FA-1031 (5-Chloro-2-[(2,2-dimethylpropoxy)carbonyl]phenyl)boronic acid
Purity: 95%
[1315476-05-1],  MFCD01631848
FA-1480 [4-Chloro-2-(3,5-dimethyl-1h-pyrazol-1-yl)phenyl]boronic acid
Purity: 95%
[1287753-38-1],  MFCD08059990
BB-0571 (7-Chloro-2,8-dimethylquinolin-4-yl)boronic acid
Purity: 95%
MFCD27935746
QV-8517 2-Chloro-4,6-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
Purity: 95%
[2304635-65-0],  MFCD22581661
BB-2183 4-Chloro-2-ethoxycarbonylphenylboronic acid
Purity: 96%
[850568-61-5],  MFCD06659823
BB-2852 4-Chloro-3-(ethoxycarbonyl)phenylboronic acid
Purity: 96%
[874219-46-2],  MFCD08235062
BB-2270 5-Chloro-2-(ethoxycarbonyl)phenylboronic acid
Purity: 98%
[871329-55-4],  MFCD07363744
PN-2183 4-Chloro-2-ethoxycarbonylphenylboronic acid pinacol ester
Purity: 96%
[2032371-79-0],  MFCD29764418
PN-5854 2-Chloro-6-(ethoxycarbonyl)pyridine-4-boronic acid, pinacol ester
Purity: 96%
[741709-70-6],  MFCD11617858
PN-5962 3-Chloro-5-(ethoxycarbonymethoxy)phenylboronic acid, pinacol ester
Purity: 98%
[1218789-47-9],  MFCD12546584
FA-4794 (3-Chloro-4-ethoxy-2-fluorophenyl)boronic acid
Purity: 98%
[909122-50-5],  MFCD15144702
BB-5022 2-Chloro-3-ethoxy-6-fluorophenylboronic acid
Purity: 98%
[957120-93-3],  MFCD09800880
BB-7065 3-Chloro-4-ethoxy-5-fluorophenylboronic acid
Purity: 98%
[2096334-30-2],  MFCD20441841
BB-6951 3-Chloro-5-ethoxy-4-fluorophenylboronic acid
Purity: 98%
[2096339-86-3],  MFCD20441834
BB-6403 4-Chloro-3-ethoxy-2-fluorophenylboronic acid
Purity: 98%
[1256346-20-9],  MFCD17015737
PN-6394 4-Chloro-5-ethoxy-2-fluorophenylboronic acid, pinacol ester
Purity: 97%
[1256360-15-2],  MFCD16295120
BB-4200 3-Chloro-4-ethoxy-5-isopropoxyphenylboronic acid
Purity: 98%
[2096336-82-0],  MFCD21332923
BB-4312 3-Chloro-5-ethoxy-4-isopropoxyphenylboronic acid
Purity: 98%
[1701449-15-1],  MFCD20529442
BB-4194 3-Chloro-4-ethoxy-5-methoxyphenylboronic acid
Purity: 97%
[1701449-09-3],  MFCD20441802
BB-4313 3-Chloro-5-ethoxy-4-methoxyphenylboronic acid
Purity: 97%
[2096338-67-7],  MFCD20529443
PN-4709 2-[3-Chloro-5-(ethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
MFCD24448815
PN-1608 2-(2-Chloro-5-ethoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD27936412
PN-1259 2-(3-Chloro-4-ethoxy-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD27936181
FA-2803 2-(2-Chloroethoxy)phenylboronic acid
Purity: 96%
[2096336-35-3],  MFCD19237188
BB-2578 2-Chloro-3-ethoxyphenylboronic acid
Purity: 98%
[1256345-57-9],  MFCD17015726
BB-2711 2-Chloro-4-ethoxyphenylboronic acid
Purity: 98%
[313545-44-7],  MFCD02684318
BB-2710 2-Chloro-5-ethoxyphenylboronic acid
Purity: 98%
[913835-30-0],  MFCD08235081
BB-2725 3-Chloro-4-ethoxyphenylboronic acid
Purity: 98%
[279261-81-3],  MFCD03701556
BB-5954 3-Chloro-5-ethoxyphenylboronic acid
Purity: 96%
[1256345-73-9],  MFCD16660280
BB-2477 4-Chloro-2-ethoxyphenylboronic acid
Purity: 98%
[850568-80-8],  MFCD03094940
FA-1557 4-Chloro-3-ethoxyphenylboronic acid
Purity: 98%
[900174-62-1],  MFCD08701724
BB-2712 5-Chloro-2-ethoxyphenylboronic acid
Purity: 98%
[352534-86-2],  MFCD03427055
FM-2803 2-(2-Chloroethoxy)phenylboronic acid, pinacol ester
Purity: 98%
[1256359-02-0],  MFCD09746200
FM-2801 3-(2-Chloroethoxy)phenylboronic acid, pinacol ester
Purity: 96%
[1256359-00-8],  MFCD09746198
PN-5954 3-Chloro-5-ethoxyphenylboronic acid, pinacol ester
Purity: 98%
[1218789-40-2],  MFCD12546577
FM-2802 4-(2-Chloroethoxy)phenylboronic acid, pinacol ester
Purity: 95%
[1256359-01-9],  MFCD09746199
FM-1557 2-(4-chloro-3-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1310956-28-5],  MFCD19440336
BB-4202 3-Chloro-4-ethoxy-5-propoxyphenylboronic acid
Purity: 98%
[2096335-27-0],  MFCD21332924
BB-4376 3-Chloro-5-ethoxy-4-propoxyphenylboronic acid
Purity: 98%
[2096338-74-6],  MFCD21609527
BB-7013 3-Chloro-2-ethoxypyridine-4-boronic acid
Purity: 96%
[2096333-52-5],  MFCD18914508
BB-2884 5-Chloro-2-ethoxypyridine-3-boronic acid
Purity: 96%
[1217500-52-1],  MFCD13195643
BB-5788 5-Chloro-6-ethoxypyridine-3-boronic acid
Purity: 97%
[1150114-68-3],  MFCD12025982
PN-1578 3-Chloro-4-ethoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
MFCD24039658
PN-2517 5-Chloro-2-ethoxy-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
MFCD27936752
PN-0909 5-Chloro-2-ethoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
MFCD27936025
PC-1112 2-Chloro-3-ethoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 96%
[2223029-21-6],  MFCD22564309
PN-4243 3-Chloro-2-(N-ethylaminomethyl)phenylboronic acid, pinacol ester
Purity: 97%
[2096333-72-9],  MFCD20441919
BB-3154 N-(2-Chloroethyl) 3-boronobenzamide
Purity: 96%
[874288-12-7],  MFCD08436013
BB-3104 N-(2-Chloroethyl) 4-boronobenzamide
Purity: 98%
[874460-05-6],  MFCD08436019
BB-2759 3-Chloro-4-(N-ethylcarbamoyl)phenylboronic acid
Purity: 97%
[850589-40-1],  MFCD07363767
BB-2813 4-Chloro-3-(ethylcarbamoyl)phenylboronic acid
Purity: 98%
[871332-69-3],  MFCD07783861
SH-6674 4-(1-Chloroethyl)phenylboronic acid
Purity: 96%
[2377587-47-6],  MFCD31653877
FA-1759 4-Chloro-3-ethylphenylboronic acid
Purity: 95%
[918810-94-3],  MFCD10566599
BB-0570 [2-Chloro-4-(4-ethylpiperazin-1-yl)phenyl]boronic acid
Purity: 96%
MFCD27935745
PN-1530 N-(2-Chloroethyl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide
Purity: 95%
MFCD27936373
PC-1664 3-chloro-2-ethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
Purity: 95%
MFCD32638961
FF-5480 1-(2-Chloroethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
Purity: 98%
[877149-79-6],  MFCD18383286
BB-8175 3-Chloro-4-(2'-fluorobenzyloxy)phenylboronic acid
Purity: 98%
[870777-28-9],  MFCD06798082
BB-8029 3-Chloro-4-(4'-fluorobenzyloxy)phenylboronic acid
Purity: 98%
[849062-39-1],  MFCD06411358
QD-9592 1-(3-Chloro-2-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
Purity: 95%
[2484920-11-6],  MFCD29767500
QD-2722 1-(3-Chloro-4-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
Purity: 95%
[1604036-60-3],  MFCD28718210
QD-9071 1-(5-Chloro-2-fluoro-benzyl)-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1h-pyrazole
Purity: 95%
[2246709-61-3],  MFCD30830161
FA-2152 2-Chloro-6-fluoro-3-formylphenylboronic acid
Purity: 95%
[1451392-95-2],  MFCD11856014
FA-2087 4-Chloro-2-fluoro-3-formylphenylboronic acid
Purity: 97%
[1451393-44-4],  MFCD11617261
FA-4323 4-Chloro-3-fluoro-2-formylphenylboronic acid
Purity: 95%
[1451392-90-7],  MFCD13181657
FB-0035 6-Chloro-2-fluoro-3-formylphenylboronic acid
Purity: 95%
[1451393-10-4],  MFCD16295238
BB-5044 2-Chloro-6-fluoro-3-hydroxyphenylboronic acid
Purity: 98%
[957121-07-2],  MFCD09800886
BC-1436 3-Chloro-4-fluoro-5-hydroxyphenylboronic acid
Purity: 95%
[1379466-81-5],  MFCD23380983
QW-3194 3-Chloro-5-fluoro-4-hydroxyphenylboronic acid
Purity: 95%
[1003298-72-3],  MFCD18447589
BB-6408 4-Chloro-2-fluoro-3-hydroxyphenylboronic acid
Purity: 97%
[1451393-13-7],  MFCD19981522
PN-6399 4-Chloro-2-fluoro-5-hydroxyphenylboronic acid pinacol ester
Purity: 95%
[1256360-20-9],  MFCD16295125
BB-6952 3-Chloro-4-fluoro-5-isopropoxyphenylboronic acid
Purity: 98%
[2096331-77-8],  MFCD20441835
BB-4192 3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid
Purity: 98%
[2096335-18-9],  MFCD20441800
BB-6404 4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid
Purity: 98%
[1256346-21-0],  MFCD17015738
BB-4344 5-Chloro-2-fluoro-3-isopropoxyphenylboronic acid
Purity: 98%
[2096339-37-4],  MFCD20529454
PN-6395 4-Chloro-2-fluoro-5-isopropoxyphenylboronic acid, pinacol ester
Purity: 98%
[1256360-16-3],  MFCD16295121
BC-1602 [3-Chloro-5-fluoro-4-(methoxycarbonyl)phenyl]boronic acid
Purity: 95%
MFCD32065674
BB-6606 [4-chloro-2-fluoro-3-(methoxycarbonyl)phenyl]boronic acid
Purity: 95%
[1254701-01-3],  MFCD18383458
BB-5106 2-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid
Purity: 97%
[957066-03-4],  MFCD09878351
BC-1509 3-Chloro-2-fluoro-4-(methoxycarbonyl)phenylboronic acid
Purity: 95%
MFCD31653713
BC-1528 4-chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid
Purity: 98%
[325786-24-1],  MFCD23380252
PN-4517 3-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[2096332-12-4],  MFCD22375097
PN-5527 3-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[2096329-94-9],  MFCD18837625
PN-5667 4-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[1073339-13-5],  MFCD12026085
BB-4319 3-Chloro-4-fluoro-5-(2-methoxyethoxy)phenylboronic acid
Purity: 96%
[2096338-69-9],  MFCD20529448
BB-6409 4-Chloro-2-fluoro-3-(2-methoxyethoxy)phenylboronic acid
Purity: 98%
[1256346-26-5],  MFCD17015741
PN-6400 4-Chloro-2-fluoro-5-(2-methoxyethoxy)phenylboronic acid, pinacol ester
Purity: 98%
[1256360-21-0],  MFCD16295126
FA-2088 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid
Purity: 98%
[1451392-26-9],  MFCD11617262
FB-0028 3-Chloro-5-fluoro-4-(methoxymethoxy)phenylboronic acid
Purity: 95%
[1451392-28-1],  MFCD13181605
BC-1398 6-Chloro-4-fluoro-3-methoxy-2-nitrophenylboronic acid
Purity: 96%
[2377609-08-8],  MFCD30527627
QC-4454 (2-Chloro-4-fluoro-3-methoxyphenyl)boronic acid
Purity: 96%
[943831-11-6],  MFCD23379545
SH-7063 (3-Chloro-2-fluoro-4-methoxyphenyl)boronic acid
Purity: 98%
[2096454-16-7],  MFCD30737491
SH-6928 (4-Chloro-2-fluoro-6-methoxyphenyl)boronic acid
Purity: 97%
[1628684-10-5],  MFCD30329340
BB-0347 (5-Chloro-4-fluoro-2-methoxyphenyl)boronic acid
Purity: 97%
[949892-09-5],  MFCD23379570
FA-1723 2-Chloro-4-fluoro-5-methoxyphenylboronic acid
Purity: 98%
[1256355-46-0],  MFCD09998845
BB-5017 2-Chloro-6-fluoro-3-methoxyphenylboronic acid
Purity: 98%
[1072945-77-7],  MFCD09972096
BB-6906 3-Chloro-4-fluoro-5-methoxyphenylboronic acid
Purity: 95%
[1379466-82-6],  MFCD20441833
BB-2248 3-Chloro-5-fluoro-2-methoxyphenylboronic acid
Purity: 98%
[2121513-76-4],  MFCD22414927
FA-4312 3-Chloro-5-fluoro-4-methoxyphenylboronic acid
Purity: 98%
[1451392-04-3],  MFCD13181625
BB-6410 4-Chloro-2-fluoro-3-methoxyphenylboronic acid
Purity: 96%
[944129-07-1],  MFCD17015742
BB-5699 4-Chloro-2-fluoro-5-methoxyphenylboronic acid
Purity: 96%
[153122-60-2],  MFCD12912365
BC-1020 5-Chloro-2-fluoro-3-methoxyphenylboronic acid
Purity: 96%
[2377610-22-3],  MFCD28369564
BB-8465 5-Chloro-2-fluoro-4-methoxyphenylboronic acid
Purity: 98%
[1072952-18-1],  MFCD04112552
BB-3965 6-Chloro-2-fluoro-3-methoxyphenylboronic acid
Purity: 97%
[867333-04-8],  MFCD11617260
FM-4312 2-(3-Chloro-5-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1422022-15-8],  MFCD16996255
BB-0072 2-Chloro-4-fluoro-3-methylpheny)boronic acid
Purity: 98%
[2304633-76-7],  MFCD23712936
BC-1506 (3-Chloro-2-fluoro-4-methylphenyl)boronic acid
Purity: 98%
[2377608-77-8],  MFCD23712893
BB-4677 (3-Chloro-2-fluoro-5-methylphenyl)boronic acid
Purity: 98%
[352535-88-7],  MFCD22571810
BB-4848 (4-Chloro-2-fluoro-3-methylphenyl)boronic acid
Purity: 97%
[944128-92-1],  MFCD18447609
OT-5424 (4-Chloro-2-fluoro-5-methylphenyl)boronic acid
Purity: 98%
[325786-09-2],  MFCD23379589
FB-2522 2-Chloro-4-fluoro-5-methylphenylboronic acid
Purity: 98%
[1207428-93-0],  MFCD18383900
BB-4217 2-Chloro-5-fluoro-4-methylphenylboronic acid
Purity: 98%
[1612184-35-6],  MFCD20441814
BB-5023 2-Chloro-6-fluoro-3-methylphenylboronic acid
Purity: 98%
[352535-85-4],  MFCD03701534
BB-8431 2-Chloro-6-fluoro-5-methylphenylboronic acid
Purity: 95%
[352535-86-5],  MFCD03701535
HC-4454 4-Chloro-3-fluoro-2-methylphenylboronic acid
Purity: 97%
[2377606-88-5],  MFCD23712910
BC-1251 4-Chloro-5-fluoro-2-methylphenylboronic acid
Purity: 96%
[2055778-22-6],  MFCD23712926
BB-8482 5-Chloro-2-fluoro-3-methylphenylboronic acid
Purity: 98%
[352535-87-6],  MFCD05664227
BB-8514 5-Chloro-2-fluoro-4-methylphenylboronic acid
Purity: 95%
[1072952-42-1],  MFCD07368241
PN-4104 3-Chloro-4-fluoro-5-methylphenylboronic acid, pinacol ester
Purity: 98%
[1402238-26-9],  MFCD20231468
PN-5634 4-Chloro-2-fluoro-5-methylphenylboronic acid, pinacol ester
Purity: 98%
[1126320-27-1],  MFCD11855985
PC-1251 4-Chloro-5-fluoro-2-methylphenylboronic acid pinacol ester
Purity: 97%
[1885096-92-3],  MFCD24039589
PN-8514 5-Chloro-2-fluoro-4-methylphenylboronic acid pinacol ester
Purity: 95%
[1638847-76-3],  MFCD31653846
BB-4320 3-Chloro-4-fluoro-5-(2-methylpropoxy)phenylboronic acid
Purity: 98%
[1793003-51-6],  MFCD20529449
BC-1464 (4-Chloro-2-fluoro-3-nitrophenyl)boronic acid
Purity: 98%
[2377608-37-0],  MFCD31543956
BC-1446 3-Chloro-2-fluoro-5-nitrophenylboronic acid
Purity: 95%
[2377608-35-8],  MFCD30834341
BB-4741 5-Chloro-4-fluoro-2-nitrophenylboronic acid
Purity: 98%
[2377605-87-1],  MFCD25953900
PN-4629 2-Chloro-6-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
MFCD34564930
PN-4626 3-Chloro-2-fluoro-5-nitrophenylboronic acid pinacol ester
Purity: 95%
[2377611-03-3],  MFCD30726981
PC-1464 4-Chloro-2-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
MFCD31543987
PC-1460 2-(2-Chloro-4-fluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2377610-30-3],  MFCD30834424
PN-4625 2-(2-Chloro-5-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
PN-0852 2-(4-Chloro-2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
[2377606-97-6],  MFCD27935980
QL-4363 2-(5-chloro-2-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD30834431
FA-4472 4-(4-Chloro-2-fluorophenoxy)phenylboronic acid
Purity: 95%
[1256358-57-2],  MFCD14581927
BB-2254 2-Chloro-3-fluorophenylboronic acid
Purity: 95%
[871329-52-1],  MFCD07363741
BB-2193 2-Chloro-4-fluorophenylboronic acid
Purity: 98%
[313545-72-1],  MFCD02684295
BB-2251 2-Chloro-5-fluorophenylboronic acid
Purity: 98%
[444666-39-1],  MFCD06656272
BB-2387 2-Chloro-6-fluorophenylboronic acid
Purity: 98%
[313545-32-3],  MFCD04039892
BB-2386 3-Chloro-2-fluorophenylboronic acid
Purity: 98%
[352535-82-1],  MFCD05664224
BB-2656 3-Chloro-4-fluorophenylboronic acid
Purity: 97%
[144432-85-9],  MFCD00051800
BB-2390 3-Chloro-5-fluorophenylboronic acid
Purity: 98%
[328956-61-2],  MFCD06801741
BB-2190 4-Chloro-2-fluorophenylboronic acid
Purity: 98%
[160591-91-3],  MFCD02684293
BB-2256 4-Chloro-3-fluorophenylboronic acid
Purity: 98%
[137504-86-0],  MFCD01319010
BB-2388 5-Chloro-2-fluorophenylboronic acid
Purity: 98%
[352535-83-2],  MFCD05664225
PN-2387 2-Chloro-6-fluorophenylboronic acid pinacol ester
Purity: 98%
[1599432-38-8],  MFCD18729911
PN-2656 3-Chloro-4-fluorophenylboronic acid pinacol ester
Purity: 98%
[635305-46-3],  MFCD11111387
PN-2388 5-Chloro-2-fluorophenylboronic acid, pinacol ester
Purity: 96%
[1190129-77-1],  MFCD16036133
PN-2190 4-chloro-2-fluorophenylboronic aicd, pinacol ester
Purity: 98%
[765917-27-9],  MFCD18729919
BB-5141 N-(3-Chloro-4-fluorophenyl) 3-boronobenzamide
Purity: 98%
[1072946-04-3],  MFCD09972110
FA-2135 3-(3-Chloro-4-fluorophenylcarbamoyl)-4-fluorophenylboronic acid
Purity: 97%
[1451393-29-5],  MFCD11856005
FA-4052 3-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid
Purity: 95%
[1256358-45-8],  MFCD12634048
FA-4048 4-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid
Purity: 95%
[1256355-86-8],  MFCD12634044
BB-0312 [(2-Chloro-5-fluorophenyl)methyl]boronic acid
Purity: 95%
[2246614-18-4],  MFCD27935543
BB-0311 [(4-Chloro-2-fluorophenyl)methyl]boronic acid
Purity: 95%
[2246683-95-2],  MFCD27935542
PN-2254 2-(2-Chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1688698-58-9],  MFCD16996256
PN-2386 2-(3-Chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
[1192025-01-6],  MFCD12405368
PN-2256 2-(4-Chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[627525-83-1],  MFCD16996258
PN-1996 1-(2-Chloro-4-fluorophenyl)-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)ethanone
Purity: 95%
MFCD27936736
PN-1970 1-(3-Chloro-4-fluorophenyl)-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)ethanone
Purity: 95%
MFCD27936716
BB-6953 3-Chloro-4-fluoro-5-propoxyphenylboronic acid
Purity: 98%
[2096331-01-8],  MFCD20441836
BB-4193 3-Chloro-5-fluoro-4-propoxyphenylboronic acid
Purity: 98%
[2096341-48-7],  MFCD20441801
BB-6406 4-Chloro-2-fluoro-3-propoxyphenylboronic acid
Purity: 98%
[1256346-23-2],  MFCD17015739
PN-6397 4-Chloro-2-fluoro-5-propoxyphenylboronic acid, pinacol ester
Purity: 95%
[1256360-18-5],  MFCD16295123
BB-8244 2-Chloro-3-fluoropyridine-4-boronic acid
Purity: 96%
[937595-71-6],  MFCD04972403
BB-5290 2-Chloro-3-fluoropyridine-5-boronic acid
Purity: 96%
[1072946-66-7],  MFCD04112500
FA-4396 2-Chloro-4-fluoro-pyridine-3-boronic acid
Purity: 95%
[1383970-43-1],  MFCD13189269
FA-4395 2-Chloro-4-fluoro-pyridine-5-boronic acid
Purity: 96%
[2096341-49-8],  MFCD13189268
BB-8376 2-Chloro-5-fluoropyridine-3-boronic acid
Purity: 96%
[913373-43-0],  MFCD03094988
BB-8474 2-Chloro-5-fluoropyridine-4-boronic acid
Purity: 98%
[951677-47-7],  MFCD04972404
BB-3591 3-Chloro-2-fluoropyridine-4-boronic acid
Purity: 96%
[1217500-55-4],  MFCD09037477
FB-0764 3-Chloro-5-fluoropyridine-4-boronic acid
Purity: 95%
[1444025-19-7],  MFCD16610400
BB-3818 5-Chloro-2-fluoropyridine-3-boronic acid
Purity: 97%
[937595-70-5],  MFCD04972408
BB-5458 6-Chloro-2-fluoropyridine-3-boronic acid
Purity: 98%
[1256345-66-0],  MFCD11504861
QD-2396 5-Chloro-2-fluoropyridine-3-boronic acid hydrate
Purity: 98%
[937595-70-5],  MFCD21396211
PN-5290 2-Chloro-3-fluoropyridine-5-boronic acid pinacol ester
Purity: 98%
[1073312-28-3],  MFCD08063077
FM-4395 2-Chloro-4-fluoropyridine-5-boronic acid, pinacol ester
Purity: 96%
[1256359-04-2],  MFCD17926497
PN-8376 2-Chloro-5-fluoropyridine-3-boronic acid pinacol ester
Purity: 96%
[1492890-58-0],  MFCD08063075
PN-8474 2-Chloro-5-fluoropyridine-4-boronic acid pinacol ester
Purity: 98%
[1256360-62-9],  MFCD08063107
PN-5459 2-Chloro-6-fluoropyridine-4-boronic acid, pinacol ester
Purity: 98%
[1146615-89-5],  MFCD11504972
PN-3591 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester
Purity: 96%
[1073353-71-5],  MFCD09037476
PN-6600 3-Chloro-2-fluoropyridine-5-boronic acid, pinacol ester
Purity: 96%
[1220219-73-7],  MFCD16995268
PN-3818 5-Chloro-2-fluoropyridine-3-boronic acid pinacol ester
Purity: 97%
[937595-72-7],  MFCD08063076
PN-4770 2-Chloro-6-fluoropyridine-3,5-diboronic acid, pinacol ester
Purity: 98%
[2377607-78-6],  MFCD26383420
BB-5459 (2-Chloro-6-fluoropyridin-4-yl)boronic acid
Purity: 95%
[2225176-58-7],  MFCD18257932
BB-8479 (5-Chloro-2-fluoropyridin-4-yl)boronic acid
Purity: 96%
[1034659-38-5],  MFCD05662405
BB-6600 (5-chloro-6-fluoropyridin-3-yl)boronic acid
Purity: 96%
[1366482-32-7],  MFCD18257900
BB-0420 (7-Chloro-8-fluoroquinolin-6-yl)boronic acid
Purity: 95%
MFCD27935629
PN-5706 4-Chloro-2-fluoro-5-(TBDMSO)phenylboronic acid, pinacol ester
Purity: 95%
[1150561-59-3],  MFCD12026093
PN-1537 2-Chloro-4-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[2304634-74-8],  MFCD24039766
FF-5885 3-Chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[1154740-65-4],  MFCD16996254
PN-0805 4-Chloro-2-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
MFCD24039659
PN-2099 5-Chloro-4-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[1807972-53-7],  MFCD27936741
PN-1251 3-Chloro-2-fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%
MFCD27936176
FM-4323 3-chloro-2-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%
[1246632-88-1],  MFCD22493628
FM-2087 6-Chloro-2-fluoro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%