Boronic Acids


Catalog # Compound Name Structure
BB-2759 3-Chloro-4-(N-ethylcarbamoyl)phenylboronic acid
Purity: 97%
[850589-40-1],  MFCD07363767
BB-2813 4-Chloro-3-(ethylcarbamoyl)phenylboronic acid
Purity: 98%
[871332-69-3],  MFCD07783861
SH-6674 4-(1-Chloroethyl)phenylboronic acid
Purity: 96%
[2377587-47-6],  MFCD31653877
FA-1759 4-Chloro-3-ethylphenylboronic acid
Purity: 95%
[918810-94-3],  MFCD10566599
BB-0570 [2-Chloro-4-(4-ethylpiperazin-1-yl)phenyl]boronic acid
Purity: 96%
MFCD27935745
PC-1664 3-chloro-2-ethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
Purity: 95%
MFCD32638961
FF-5480 1-(2-Chloroethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
Purity: 98%
[877149-79-6],  MFCD18383286
QG-7126 2-Chloro-5-(3-fluorobenzylcarbamoyl)benzeneboronic acid
Purity: 95%
[1449133-71-4],  MFCD20040333
BB-8175 3-Chloro-4-(2'-fluorobenzyloxy)phenylboronic acid
Purity: 98%
[870777-28-9],  MFCD06798082
BB-8029 3-Chloro-4-(4'-fluorobenzyloxy)phenylboronic acid
Purity: 98%
[849062-39-1],  MFCD06411358
QD-9592 1-(3-Chloro-2-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
Purity: 95%
[2484920-11-6],  MFCD29767500
QD-2722 1-(3-Chloro-4-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole
Purity: 95%
[1604036-60-3],  MFCD28718210
QD-9071 1-(5-Chloro-2-fluoro-benzyl)-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1h-pyrazole
Purity: 95%
[2246709-61-3],  MFCD30830161
HG-3753 (4-Chloro-2-fluoro-5-formylphenyl)boronic acid
Purity: 95%
[325786-27-4],  MFCD22572295
JN-9186 (5-Chloro-2-fluoro-3-formylphenyl)boronic acid
Purity: 95%
MFCD32632122
JN-0238 2-Chloro-3-fluoro-4-formylphenylboronic acid
Purity: 98%
[2121514-97-2],  MFCD30344681
FA-2152 2-Chloro-6-fluoro-3-formylphenylboronic acid
Purity: 95%
[1451392-95-2],  MFCD11856014
JN-1628 2-Chloro-6-fluoro-4-formylphenylboronic acid
Purity: 95%
MFCD31805742
FA-2087 4-Chloro-2-fluoro-3-formylphenylboronic acid
Purity: 97%
[1451393-44-4],  MFCD11617261
FA-4323 4-Chloro-3-fluoro-2-formylphenylboronic acid
Purity: 95%
[1451392-90-7],  MFCD13181657
JN-0779 5-Chloro-3-fluoro-2-formylphenylboronic acid
Purity: 95%
MFCD28976798
FB-0035 6-Chloro-2-fluoro-3-formylphenylboronic acid
Purity: 95%
[1451393-10-4],  MFCD16295238
JN-6445 2-Chloro-3-fluoro-4-formylphenylboronic acid pinacol ester
Purity: 95%
[2121514-29-0],  MFCD30344683
BB-5044 2-Chloro-6-fluoro-3-hydroxyphenylboronic acid
Purity: 98%
[957121-07-2],  MFCD09800886
BC-1436 3-Chloro-4-fluoro-5-hydroxyphenylboronic acid
Purity: 95%
[1379466-81-5],  MFCD23380983
QW-3194 3-Chloro-5-fluoro-4-hydroxyphenylboronic acid
Purity: 95%
[1003298-72-3],  MFCD18447589
BB-6408 4-Chloro-2-fluoro-3-hydroxyphenylboronic acid
Purity: 97%
[1451393-13-7],  MFCD19981522
PN-6399 4-Chloro-2-fluoro-5-hydroxyphenylboronic acid pinacol ester
Purity: 95%
[1256360-20-9],  MFCD16295125
BB-6952 3-Chloro-4-fluoro-5-isopropoxyphenylboronic acid
Purity: 98%
[2096331-77-8],  MFCD20441835
BB-4192 3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid
Purity: 98%
[2096335-18-9],  MFCD20441800
BB-6404 4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid
Purity: 98%
[1256346-21-0],  MFCD17015738
BB-4344 5-Chloro-2-fluoro-3-isopropoxyphenylboronic acid
Purity: 98%
[2096339-37-4],  MFCD20529454
PN-6395 4-Chloro-2-fluoro-5-isopropoxyphenylboronic acid, pinacol ester
Purity: 98%
[1256360-16-3],  MFCD16295121
BC-1602 [3-Chloro-5-fluoro-4-(methoxycarbonyl)phenyl]boronic acid
Purity: 95%
MFCD32065674
BB-6606 [4-chloro-2-fluoro-3-(methoxycarbonyl)phenyl]boronic acid
Purity: 95%
[1254701-01-3],  MFCD18383458
BB-5106 2-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid
Purity: 97%
[957066-03-4],  MFCD09878351
BC-1509 3-Chloro-2-fluoro-4-(methoxycarbonyl)phenylboronic acid
Purity: 95%
MFCD31653713
BC-1528 4-chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid
Purity: 96%
[325786-24-1],  MFCD23380252
PN-4517 3-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[2096332-12-4],  MFCD22375097
PN-5527 3-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[2096329-94-9],  MFCD18837625
PN-5667 4-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[1073339-13-5],  MFCD12026085
BB-4319 3-Chloro-4-fluoro-5-(2-methoxyethoxy)phenylboronic acid
Purity: 96%
[2096338-69-9],  MFCD20529448
BB-6409 4-Chloro-2-fluoro-3-(2-methoxyethoxy)phenylboronic acid
Purity: 98%
[1256346-26-5],  MFCD17015741
PN-6400 4-Chloro-2-fluoro-5-(2-methoxyethoxy)phenylboronic acid, pinacol ester
Purity: 98%
[1256360-21-0],  MFCD16295126
FA-2088 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid
Purity: 98%
[1451392-26-9],  MFCD11617262
FB-0028 3-Chloro-5-fluoro-4-(methoxymethoxy)phenylboronic acid
Purity: 95%
[1451392-28-1],  MFCD13181605
BC-1398 6-Chloro-4-fluoro-3-methoxy-2-nitrophenylboronic acid
Purity: 96%
[2377609-08-8],  MFCD30527627
QC-4454 (2-Chloro-4-fluoro-3-methoxyphenyl)boronic acid
Purity: 96%
[943831-11-6],  MFCD23379545
SH-7063 (3-Chloro-2-fluoro-4-methoxyphenyl)boronic acid
Purity: 98%
[2096454-16-7],  MFCD30737491
SH-6928 (4-Chloro-2-fluoro-6-methoxyphenyl)boronic acid
Purity: 97%
[1628684-10-5],  MFCD30329340
BB-4928 (5-chloro-3-fluoro-2-methoxyphenyl)boronic acid
Purity: 95%
MFCD22414946
BB-0347 (5-Chloro-4-fluoro-2-methoxyphenyl)boronic acid
Purity: 97%
[949892-09-5],  MFCD23379570
FA-1723 2-Chloro-4-fluoro-5-methoxyphenylboronic acid
Purity: 98%
[1256355-46-0],  MFCD09998845
BB-5017 2-Chloro-6-fluoro-3-methoxyphenylboronic acid
Purity: 98%
[1072945-77-7],  MFCD09972096
BB-6906 3-Chloro-4-fluoro-5-methoxyphenylboronic acid
Purity: 95%
[1379466-82-6],  MFCD20441833
BB-2248 3-Chloro-5-fluoro-2-methoxyphenylboronic acid
Purity: 98%
[2121513-76-4],  MFCD22414927
FA-4312 3-Chloro-5-fluoro-4-methoxyphenylboronic acid
Purity: 98%
[1451392-04-3],  MFCD13181625
BB-6410 4-Chloro-2-fluoro-3-methoxyphenylboronic acid
Purity: 96%
[944129-07-1],  MFCD17015742
BB-5699 4-Chloro-2-fluoro-5-methoxyphenylboronic acid
Purity: 96%
[153122-60-2],  MFCD12912365
BC-1020 5-Chloro-2-fluoro-3-methoxyphenylboronic acid
Purity: 96%
[2377610-22-3],  MFCD28369564
BB-8465 5-Chloro-2-fluoro-4-methoxyphenylboronic acid
Purity: 98%
[1072952-18-1],  MFCD04112552
BB-3965 6-Chloro-2-fluoro-3-methoxyphenylboronic acid
Purity: 97%
[867333-04-8],  MFCD11617260
PN-2248 2-(3-chloro-5-fluoro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2121514-87-0],  MFCD22414988
FM-4312 2-(3-Chloro-5-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1422022-15-8],  MFCD16996255
PN-6410 2-(4-chloro-2-fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1126321-06-9],  MFCD22493590
PN-8465 2-(5-chloro-2-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2121513-64-0],  MFCD22414638
BC-1448 (5-Chloro-3-fluoro-2-methoxypyridin-4-yl)boronic acid
Purity: 95%
MFCD34761948
BB-0072 2-Chloro-4-fluoro-3-methylpheny)boronic acid
Purity: 98%
[2304633-76-7],  MFCD23712936
BC-1506 (3-Chloro-2-fluoro-4-methylphenyl)boronic acid
Purity: 98%
[2377608-77-8],  MFCD23712893
BB-4677 (3-Chloro-2-fluoro-5-methylphenyl)boronic acid
Purity: 98%
[352535-88-7],  MFCD22571810
BB-4848 (4-Chloro-2-fluoro-3-methylphenyl)boronic acid
Purity: 97%
[944128-92-1],  MFCD18447609
OT-5424 (4-Chloro-2-fluoro-5-methylphenyl)boronic acid
Purity: 98%
[325786-09-2],  MFCD23379589
FB-2522 2-Chloro-4-fluoro-5-methylphenylboronic acid
Purity: 98%
[1207428-93-0],  MFCD18383900
BB-4217 2-Chloro-5-fluoro-4-methylphenylboronic acid
Purity: 98%
[1612184-35-6],  MFCD20441814
BB-5023 2-Chloro-6-fluoro-3-methylphenylboronic acid
Purity: 98%
[352535-85-4],  MFCD03701534
BB-8431 2-Chloro-6-fluoro-5-methylphenylboronic acid
Purity: 95%
[352535-86-5],  MFCD03701535
HC-4454 4-Chloro-3-fluoro-2-methylphenylboronic acid
Purity: 97%
[2377606-88-5],  MFCD23712910
BC-1251 4-Chloro-5-fluoro-2-methylphenylboronic acid
Purity: 96%
[2055778-22-6],  MFCD23712926
BB-8482 5-Chloro-2-fluoro-3-methylphenylboronic acid
Purity: 98%
[352535-87-6],  MFCD05664227
BB-8514 5-Chloro-2-fluoro-4-methylphenylboronic acid
Purity: 95%
[1072952-42-1],  MFCD07368241
PN-4104 3-Chloro-4-fluoro-5-methylphenylboronic acid, pinacol ester
Purity: 98%
[1402238-26-9],  MFCD20231468
PN-5634 4-Chloro-2-fluoro-5-methylphenylboronic acid, pinacol ester
Purity: 98%
[1126320-27-1],  MFCD11855985
PC-1251 4-Chloro-5-fluoro-2-methylphenylboronic acid pinacol ester
Purity: 97%
[1885096-92-3],  MFCD24039589
PN-8514 5-Chloro-2-fluoro-4-methylphenylboronic acid pinacol ester
Purity: 95%
[1638847-76-3],  MFCD31653846
BB-4320 3-Chloro-4-fluoro-5-(2-methylpropoxy)phenylboronic acid
Purity: 98%
[1793003-51-6],  MFCD20529449
BC-1464 (4-Chloro-2-fluoro-3-nitrophenyl)boronic acid
Purity: 98%
[2377608-37-0],  MFCD31543956
BC-1446 3-Chloro-2-fluoro-5-nitrophenylboronic acid
Purity: 95%
[2377608-35-8],  MFCD30834341
BB-2399 3-Chloro-4-fluoro-5-nitrophenylboronic acid
Purity: 95%
[850568-73-9],  MFCD06659837
BB-4741 5-Chloro-4-fluoro-2-nitrophenylboronic acid
Purity: 98%
[2377605-87-1],  MFCD25953900
PN-4625 2-Chloro-5-fluoro-4-nitrophenylboronic acid pinacol ester
Purity: 98%
[2380323-13-5],  MFCD34817719
PN-4629 2-Chloro-6-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
MFCD34564930
PN-4626 3-Chloro-2-fluoro-5-nitrophenylboronic acid pinacol ester
Purity: 95%
[2377611-03-3],  MFCD30726981
PC-1464 4-Chloro-2-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
MFCD31543987
PC-1460 2-(2-Chloro-4-fluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2377610-30-3],  MFCD30834424
PN-2399 2-(3-Chloro-4-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2092557-58-7],  MFCD32266729
PN-0852 2-(4-Chloro-2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
[2377606-97-6],  MFCD27935980
QL-4363 2-(5-chloro-2-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD30834431
FA-4472 4-(4-Chloro-2-fluorophenoxy)phenylboronic acid
Purity: 95%
[1256358-57-2],  MFCD14581927
BB-2254 2-Chloro-3-fluorophenylboronic acid
Purity: 95%
[871329-52-1],  MFCD07363741
BB-2193 2-Chloro-4-fluorophenylboronic acid
Purity: 98%
[313545-72-1],  MFCD02684295
BB-2251 2-Chloro-5-fluorophenylboronic acid
Purity: 98%
[444666-39-1],  MFCD06656272
BB-2387 2-Chloro-6-fluorophenylboronic acid
Purity: 98%
[313545-32-3],  MFCD04039892
BB-2386 3-Chloro-2-fluorophenylboronic acid
Purity: 98%
[352535-82-1],  MFCD05664224
BB-2656 3-Chloro-4-fluorophenylboronic acid
Purity: 97%
[144432-85-9],  MFCD00051800
BB-2390 3-Chloro-5-fluorophenylboronic acid
Purity: 98%
[328956-61-2],  MFCD06801741
BB-2190 4-Chloro-2-fluorophenylboronic acid
Purity: 98%
[160591-91-3],  MFCD02684293
BB-2256 4-Chloro-3-fluorophenylboronic acid
Purity: 98%
[137504-86-0],  MFCD01319010
BB-2388 5-Chloro-2-fluorophenylboronic acid
Purity: 96%
[352535-83-2],  MFCD05664225
PN-2387 2-Chloro-6-fluorophenylboronic acid pinacol ester
Purity: 98%
[1599432-38-8],  MFCD18729911
PN-2656 3-Chloro-4-fluorophenylboronic acid pinacol ester
Purity: 98%
[635305-46-3],  MFCD11111387
PN-2388 5-Chloro-2-fluorophenylboronic acid, pinacol ester
Purity: 96%
[1190129-77-1],  MFCD16036133
PN-2190 4-chloro-2-fluorophenylboronic aicd, pinacol ester
Purity: 98%
[765917-27-9],  MFCD18729919
BB-5141 N-(3-Chloro-4-fluorophenyl) 3-boronobenzamide
Purity: 98%
[1072946-04-3],  MFCD09972110
FA-2135 3-(3-Chloro-4-fluorophenylcarbamoyl)-4-fluorophenylboronic acid
Purity: 97%
[1451393-29-5],  MFCD11856005
PN-2254 2-(2-Chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1688698-58-9],  MFCD16996256
PN-2193 2-(2-chloro-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
[892845-64-6],  MFCD18729910
PN-2251 2-(2-Chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[870486-41-2],  MFCD16996257
PN-2386 2-(3-Chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
[1192025-01-6],  MFCD12405368
PN-2256 2-(4-Chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[627525-83-1],  MFCD16996258
BB-6953 3-Chloro-4-fluoro-5-propoxyphenylboronic acid
Purity: 98%
[2096331-01-8],  MFCD20441836
BB-4193 3-Chloro-5-fluoro-4-propoxyphenylboronic acid
Purity: 98%
[2096341-48-7],  MFCD20441801
BB-6406 4-Chloro-2-fluoro-3-propoxyphenylboronic acid
Purity: 98%
[1256346-23-2],  MFCD17015739
BB-8244 2-Chloro-3-fluoropyridine-4-boronic acid
Purity: 96%
[937595-71-6],  MFCD04972403
BB-5290 2-Chloro-3-fluoropyridine-5-boronic acid
Purity: 96%
[1072946-66-7],  MFCD04112500
FA-4396 2-Chloro-4-fluoro-pyridine-3-boronic acid
Purity: 95%
[1383970-43-1],  MFCD13189269
FA-4395 2-Chloro-4-fluoro-pyridine-5-boronic acid
Purity: 96%
[2096341-49-8],  MFCD13189268
BB-8376 2-Chloro-5-fluoropyridine-3-boronic acid
Purity: 96%
[913373-43-0],  MFCD03094988
BB-8474 2-Chloro-5-fluoropyridine-4-boronic acid
Purity: 98%
[951677-47-7],  MFCD04972404
BB-3591 3-Chloro-2-fluoropyridine-4-boronic acid
Purity: 96%
[1217500-55-4],  MFCD09037477
FB-0764 3-Chloro-5-fluoropyridine-4-boronic acid
Purity: 95%
[1444025-19-7],  MFCD16610400
BB-3818 5-Chloro-2-fluoropyridine-3-boronic acid
Purity: 95%
[937595-70-5],  MFCD04972408
BB-5458 6-Chloro-2-fluoropyridine-3-boronic acid
Purity: 98%
[1256345-66-0],  MFCD11504861
QD-2396 5-Chloro-2-fluoropyridine-3-boronic acid hydrate
Purity: 95%
[937595-70-5],  MFCD21396211
PN-5290 2-Chloro-3-fluoropyridine-5-boronic acid pinacol ester
Purity: 98%
[1073312-28-3],  MFCD08063077
FM-4395 2-Chloro-4-fluoropyridine-5-boronic acid, pinacol ester
Purity: 96%
[1256359-04-2],  MFCD17926497
PN-8376 2-Chloro-5-fluoropyridine-3-boronic acid pinacol ester
Purity: 96%
[1492890-58-0],  MFCD08063075
PN-8474 2-Chloro-5-fluoropyridine-4-boronic acid pinacol ester
Purity: 98%
[1256360-62-9],  MFCD08063107
PN-5459 2-Chloro-6-fluoropyridine-4-boronic acid, pinacol ester
Purity: 98%
[1146615-89-5],  MFCD11504972
PN-3591 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester
Purity: 96%
[1073353-71-5],  MFCD09037476
PN-6600 3-Chloro-2-fluoropyridine-5-boronic acid, pinacol ester
Purity: 96%
[1220219-73-7],  MFCD16995268
PN-3818 5-Chloro-2-fluoropyridine-3-boronic acid pinacol ester
Purity: 98%
[937595-72-7],  MFCD08063076
PN-8479 5-Chloro-2-fluoropyridine-4-boronic acid pinacol ester
Purity: 95%
[1310383-58-4],  MFCD08063108
PN-4770 2-Chloro-6-fluoropyridine-3,5-diboronic acid, pinacol ester
Purity: 98%
[2377607-78-6],  MFCD26383420
BB-5459 (2-Chloro-6-fluoropyridin-4-yl)boronic acid
Purity: 95%
[2225176-58-7],  MFCD18257932
BB-8479 (5-Chloro-2-fluoropyridin-4-yl)boronic acid
Purity: 96%
[1034659-38-5],  MFCD05662405
BB-6600 (5-chloro-6-fluoropyridin-3-yl)boronic acid
Purity: 96%
[1366482-32-7],  MFCD18257900
PN-5458 6-Chloro-2-fluoropyridin-3-ylboronic acid pinacol ester
Purity: 95%
[1628524-89-9],  MFCD13182150
PN-5706 4-Chloro-2-fluoro-5-(TBDMSO)phenylboronic acid, pinacol ester
Purity: 95%
[1150561-59-3],  MFCD12026093
PN-1537 2-Chloro-4-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[2304634-74-8],  MFCD24039766
FF-5885 3-Chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[1154740-65-4],  MFCD16996254
PN-4085 3-Chloro-2-fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[3018063-24-3],  MFCD34619796
FM-4323 3-chloro-2-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%
[1246632-88-1],  MFCD22493628
FM-2087 6-Chloro-2-fluoro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%
MFCD32902658
JN-6929 6-Chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%
MFCD32902658
PN-2390 3-Chloro-5-fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene
Purity: 97%
[1245524-02-0],  MFCD11867862
FF-5911 2-Chloro-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Purity: 95%
[1356953-67-7],  MFCD16996260
PN-8244 2-Chloro-3-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 98%
[1029654-43-0],  MFCD07787387
QP-4891 3-Chloro-2-fluoro-5-(trifluoromethyl) phenylboronic acid
Purity: 97%
[2096342-38-8],  MFCD25459282
FA-2137 2-Chloro-4-formyl-3-methylphenylboronic acid
Purity: 95%
[1451391-36-8],  MFCD11856008
FA-4295 3-Chloro-2-formyl-4-methylphenylboronic acid
Purity: 95%
[1451391-37-9],  MFCD13181610
JN-1930 3-Chloro-2-formyl-6-methylphenylboronic acid
Purity: 95%
[2377714-00-4],  MFCD31696092
JN-8579 3-Chloro-2-formyl-4-methylphenylboronic acid pinacol ester
Purity: 95%
[2121513-75-3],  MFCD30529823
JN-0687 3-Chloro-2-formyl-6-methylphenylboronic acid pinacol ester
Purity: 95%
MFCD31696094
BB-6414 2-Chloro-4-formylphenylboronic acid
Purity: 98%
[1063712-34-4],  MFCD18311828
BB-9018 2-Chloro-5-formylphenylboronic acid
Purity: 98%
[1150114-78-5],  MFCD06656269
BB-6031 3-Chloro-2-formylphenylboronic acid
Purity: 95%
[928048-11-7],  MFCD13181639
BB-8545 3-Chloro-4-formylphenylboronic acid
Purity: 96%
[1072952-53-4],  MFCD08274473
FA-1635 3-Chloro-5-formylphenylboronic acid
Purity: 98%
[1451393-35-3],  MFCD09038799
BB-3489 4-Chloro-2-formylphenylboronic acid
Purity: 98%
[913835-76-4],  MFCD08689492
BB-4895 4-Chloro-3-formylphenylboronic acid
Purity: 95%
[2354338-14-8],  MFCD28101633
BB-9014 5-Chloro-2-formylphenylboronic acid
Purity: 96%
[870238-36-1],  MFCD03425955
PN-3489 4-Chloro-2-formylphenylboronic acid, pinacol ester
Purity: 98%
[1132669-91-0],  MFCD18731001
PN-1917 2-Chloro-4-formylpyridine-5-boronic acid pinacol ester
Purity: 96%
[1416721-79-3],  MFCD18718156
BC-1890 (6-Chloro-5-formylpyridin-3-yl)boronic acid
Purity: 95%
MFCD34598068
BB-2756 3-Chloro-4-hydrazinecarbonylphenylboronic acid
Purity: 98%
[850589-37-6],  MFCD07363764
BB-8637 3-Chloro-4-hydroxy-5-methoxyphenylboronic acid
Purity: 96%
[919496-57-4],  MFCD15143481
PN-8637 3-Chloro-4-hydroxy-5-methoxyphenylboronic acid, pinacol ester
Purity: 96%
[1003298-84-7],  MFCD05663844
BB-9040 2-Chloro-5-hydroxymethylphenylboronic acid
Purity: 98%
[1003042-59-8],  MFCD06656270
FB-0038 3-Chloro-2-hydroxymethylphenylboronic acid
Purity: 95%
[1451393-57-9],  MFCD16295244
FB-2579 3-Chloro-4-(hydroxymethyl)phenylboronic acid
Purity: 95%
[1190875-60-5],  MFCD18384123
FB-5804 3-Chloro-5-(hydroxymethyl)phenylboronic acid
Purity: 97%
[2121512-87-4],  MFCD22397986
FB-2521 4-Chloro-2-hydroxy-6-methylphenylboronic acid
Purity: 95%
[1207961-50-9],  MFCD18383891
BB-1573 4-Chloro-3-(hydroxymethyl)phenylboronic acid
Purity: 98%
[1430237-54-9],  MFCD28122667
QE-5583 2-Chloro-3-(hydroxymethyl)phenylboronic acid pinacol ester
Purity: 95%
[1400755-07-8],  MFCD18729957
PN-6808 2-Chloro-4-hydroxymethylphenylboronic acid, pinacol ester
Purity: 95%
[1485110-17-5],  MFCD18434467
PN-9040 2-Chloro-5-hydroxymethylphenylboronic acid, pinacol ester
Purity: 96%
[1544673-40-6],  MFCD18729959
FF-5804 3-Chloro-5-hydroxymethylphenylboronic acid, pinacol ester
Purity: 98%
[1112210-59-9],  MFCD18374004
BB-1800 (5-Chloro-2-hydroxy-6-methylpyridin-3-yl)boronic acid
Purity: 96%
[2377609-90-8],  MFCD31543951
FB-0995 (2-Chloro-3-hydroxyphenyl)-boronic acid
Purity: 98%
[854778-29-3],  MFCD16878035
FA-2315 2-Chloro-4-hydroxyphenylboronic acid
Purity: 98%
[766549-26-2],  MFCD02684320
BB-3478 2-Chloro-5-hydroxyphenylboronic acid
Purity: 98%
[913835-71-9],  MFCD08689478
FB-2647 2-Chloro-6-hydroxyphenylboronic acid
Purity: 98%
[958646-70-3],  MFCD18393225
BB-8562 3-Chloro-2-hydroxyphenylboronic acid
Purity: 98%
[951655-50-8],  MFCD08689551
BB-3482 3-Chloro-4-hydroxyphenylboronic acid
Purity: 98%
[182344-13-4],  MFCD09258739
BB-5959 3-Chloro-5-hydroxyphenylboronic acid
Purity: 98%
[1214900-52-3],  MFCD15143456
BB-6520 4-Chloro-2-hydroxyphenylboronic acid
Purity: 97%
[1238196-66-1],  MFCD18383546
BB-5718 4-Chloro-3-hydroxyphenylboronic acid
Purity: 98%
[915201-06-8],  MFCD10697413
BB-2604 5-Chloro-2-hydroxyphenylboronic acid
Purity: 96%
[89488-25-5],  MFCD06659863
FF-2647 2-Chloro-6-hydroxyphenylboronic acid, pinacol ester
Purity: 95%
[1451391-17-5],  MFCD16994238
PN-8794 3-Chloro-4-hydroxyphenylboronic acid, pinacol ester
Purity: 98%
[629658-06-6],  MFCD09260490