Boronic Acids


Catalog # Compound Name Structure
BB-5023 2-Chloro-6-fluoro-3-methylphenylboronic acid
Purity: 98%
[352535-85-4],  MFCD03701534
BB-8431 2-Chloro-6-fluoro-5-methylphenylboronic acid
Purity: 95%
[352535-86-5],  MFCD03701535
HC-4454 4-Chloro-3-fluoro-2-methylphenylboronic acid
Purity: 97%
[2377606-88-5],  MFCD23712910
BC-1251 4-Chloro-5-fluoro-2-methylphenylboronic acid
Purity: 96%
[2055778-22-6],  MFCD23712926
BB-8482 5-Chloro-2-fluoro-3-methylphenylboronic acid
Purity: 98%
[352535-87-6],  MFCD05664227
BB-8514 5-Chloro-2-fluoro-4-methylphenylboronic acid
Purity: 98%
[1072952-42-1],  MFCD07368241
PN-4104 3-Chloro-4-fluoro-5-methylphenylboronic acid, pinacol ester
Purity: 98%
[1402238-26-9],  MFCD20231468
PN-5634 4-Chloro-2-fluoro-5-methylphenylboronic acid, pinacol ester
Purity: 98%
[1126320-27-1],  MFCD11855985
PC-1251 4-Chloro-5-fluoro-2-methylphenylboronic acid pinacol ester
Purity: 97%
[1885096-92-3],  MFCD24039589
PN-8514 5-Chloro-2-fluoro-4-methylphenylboronic acid pinacol ester
Purity: 95%
[1638847-76-3],  MFCD31653846
BB-4320 3-Chloro-4-fluoro-5-(2-methylpropoxy)phenylboronic acid
Purity: 98%
[1793003-51-6],  MFCD20529449
BC-1464 (4-Chloro-2-fluoro-3-nitrophenyl)boronic acid
Purity: 98%
[2377608-37-0],  MFCD31543956
BC-1446 3-Chloro-2-fluoro-5-nitrophenylboronic acid
Purity: 95%
[2377608-35-8],  MFCD30834341
BB-4741 5-Chloro-4-fluoro-2-nitrophenylboronic acid
Purity: 98%
[2377605-87-1],  MFCD25953900
PN-4626 3-Chloro-2-fluoro-5-nitrophenylboronic acid pinacol ester
Purity: 95%
[2377611-03-3],  MFCD30726981
PC-1464 4-Chloro-2-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
MFCD31543987
PC-1460 2-(2-Chloro-4-fluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2377610-30-3],  MFCD30834424
PN-0852 2-(4-Chloro-2-fluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
[2377606-97-6],  MFCD27935980
QL-4363 2-(5-chloro-2-fluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD30834431
FA-4472 4-(4-Chloro-2-fluorophenoxy)phenylboronic acid
Purity: 95%
[1256358-57-2],  MFCD14581927
BB-2254 2-Chloro-3-fluorophenylboronic acid
Purity: 98%
[871329-52-1],  MFCD07363741
BB-2193 2-Chloro-4-fluorophenylboronic acid
Purity: 98%
[313545-72-1],  MFCD02684295
BB-2251 2-Chloro-5-fluorophenylboronic acid
Purity: 98%
[444666-39-1],  MFCD06656272
BB-2387 2-Chloro-6-fluorophenylboronic acid
Purity: 98%
[313545-32-3],  MFCD04039892
BB-2386 3-Chloro-2-fluorophenylboronic acid
Purity: 98%
[352535-82-1],  MFCD05664224
BB-2656 3-Chloro-4-fluorophenylboronic acid
Purity: 98%
[144432-85-9],  MFCD00051800
BB-2390 3-Chloro-5-fluorophenylboronic acid
Purity: 98%
[328956-61-2],  MFCD06801741
BB-2190 4-Chloro-2-fluorophenylboronic acid
Purity: 98%
[160591-91-3],  MFCD02684293
BB-2256 4-Chloro-3-fluorophenylboronic acid
Purity: 98%
[137504-86-0],  MFCD01319010
BB-2388 5-Chloro-2-fluorophenylboronic acid
Purity: 98%
[352535-83-2],  MFCD05664225
PN-2387 2-Chloro-6-fluorophenylboronic acid pinacol ester
Purity: 98%
[1599432-38-8],  MFCD18729911
PN-2656 3-Chloro-4-fluorophenylboronic acid pinacol ester
Purity: 98%
[635305-46-3],  MFCD11111387
PN-2388 5-Chloro-2-fluorophenylboronic acid, pinacol ester
Purity: 96%
[1190129-77-1],  MFCD16036133
PN-2190 4-chloro-2-fluorophenylboronic aicd, pinacol ester
Purity: 98%
[765917-27-9],  MFCD18729919
BB-5141 N-(3-Chloro-4-fluorophenyl) 3-boronobenzamide
Purity: 98%
[1072946-04-3],  MFCD09972110
FA-4052 3-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid
Purity: 95%
[1256358-45-8],  MFCD12634048
FA-4048 4-(2-Chloro-4-fluorophenylmethoxy)phenylboronic acid
Purity: 95%
[1256355-86-8],  MFCD12634044
BB-0312 [(2-Chloro-5-fluorophenyl)methyl]boronic acid
Purity: 95%
[2246614-18-4],  MFCD27935543
BB-0311 [(4-Chloro-2-fluorophenyl)methyl]boronic acid
Purity: 95%
[2246683-95-2],  MFCD27935542
PN-2386 2-(3-Chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[1192025-01-6],  MFCD12405368
PN-2256 2-(4-Chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[627525-83-1],  MFCD16996258
PN-1996 1-(2-Chloro-4-fluorophenyl)-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)ethanone
Purity: 95%
MFCD27936736
PN-1970 1-(3-Chloro-4-fluorophenyl)-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)ethanone
Purity: 95%
MFCD27936716
BB-6953 3-Chloro-4-fluoro-5-propoxyphenylboronic acid
Purity: 98%
[2096331-01-8],  MFCD20441836
BB-4193 3-Chloro-5-fluoro-4-propoxyphenylboronic acid
Purity: 98%
[2096341-48-7],  MFCD20441801
BB-6406 4-Chloro-2-fluoro-3-propoxyphenylboronic acid
Purity: 98%
[1256346-23-2],  MFCD17015739
PN-6397 4-Chloro-2-fluoro-5-propoxyphenylboronic acid, pinacol ester
Purity: 95%
[1256360-18-5],  MFCD16295123
BB-8244 2-Chloro-3-fluoropyridine-4-boronic acid
Purity: 96%
[937595-71-6],  MFCD04972403
BB-5290 2-Chloro-3-fluoropyridine-5-boronic acid
Purity: 96%
[1072946-66-7],  MFCD04112500
FA-4396 2-Chloro-4-fluoro-pyridine-3-boronic acid
Purity: 95%
[1383970-43-1],  MFCD13189269
FA-4395 2-Chloro-4-fluoro-pyridine-5-boronic acid
Purity: 98%
[2096341-49-8],  MFCD13189268
BB-8376 2-Chloro-5-fluoropyridine-3-boronic acid
Purity: 98%
[913373-43-0],  MFCD03094988
BB-8474 2-Chloro-5-fluoropyridine-4-boronic acid
Purity: 98%
[951677-47-7],  MFCD04972404
BB-3591 3-Chloro-2-fluoropyridine-4-boronic acid
Purity: 96%
[1217500-55-4],  MFCD09037477
FB-0764 3-Chloro-5-fluoropyridine-4-boronic acid
Purity: 95%
[1444025-19-7],  MFCD16610400
BB-3818 5-Chloro-2-fluoropyridine-3-boronic acid
Purity: 97%
[937595-70-5],  MFCD04972408
BB-5458 6-Chloro-2-fluoropyridine-3-boronic acid
Purity: 98%
[1256345-66-0],  MFCD11504861
QD-2396 5-Chloro-2-fluoropyridine-3-boronic acid hydrate
Purity: 98%
[937595-70-5],  MFCD21396211
PN-5290 2-Chloro-3-fluoropyridine-5-boronic acid pinacol ester
Purity: 98%
[1073312-28-3],  MFCD08063077
FM-4395 2-Chloro-4-fluoropyridine-5-boronic acid, pinacol ester
Purity: 98%
[1256359-04-2],  MFCD17926497
PN-8376 2-Chloro-5-fluoropyridine-3-boronic acid pinacol ester
Purity: 96%
[1492890-58-0],  MFCD08063075
PN-8474 2-Chloro-5-fluoropyridine-4-boronic acid pinacol ester
Purity: 98%
[1256360-62-9],  MFCD08063107
PN-5459 2-Chloro-6-fluoropyridine-4-boronic acid, pinacol ester
Purity: 98%
[1146615-89-5],  MFCD11504972
PN-3591 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester
Purity: 96%
[1073353-71-5],  MFCD09037476
PN-6600 3-Chloro-2-fluoropyridine-5-boronic acid, pinacol ester
Purity: 95%
[1220219-73-7],  MFCD16995268
PN-3818 5-Chloro-2-fluoropyridine-3-boronic acid pinacol ester
Purity: 97%
[937595-72-7],  MFCD08063076
PN-4770 2-Chloro-6-fluoropyridine-3,5-diboronic acid, pinacol ester
Purity: 97%
[2377607-78-6],  MFCD26383420
BB-5459 (2-Chloro-6-fluoropyridin-4-yl)boronic acid
Purity: 95%
[2225176-58-7],  MFCD18257932
BB-8479 (5-Chloro-2-fluoropyridin-4-yl)boronic acid
Purity: 95%
[1034659-38-5],  MFCD05662405
BB-6600 (5-chloro-6-fluoropyridin-3-yl)boronic acid
Purity: 96%
[1366482-32-7],  MFCD18257900
BB-0420 (7-Chloro-8-fluoroquinolin-6-yl)boronic acid
Purity: 95%
MFCD27935629
PN-5706 4-Chloro-2-fluoro-5-(TBDMSO)phenylboronic acid, pinacol ester
Purity: 95%
[1150561-59-3],  MFCD12026093
PN-1537 2-Chloro-4-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[2304634-74-8],  MFCD24039766
FF-5885 3-Chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[1154740-65-4],  MFCD16996254
PN-0805 4-Chloro-2-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
MFCD24039659
PN-2099 5-Chloro-4-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 95%
[1807972-53-7],  MFCD27936741
PN-1251 3-Chloro-2-fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde
Purity: 95%
MFCD27936176
PN-2390 3-Chloro-5-fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene
Purity: 95%
[1245524-02-0],  MFCD11867862
PN-1254 3-Chloro-2-fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Purity: 95%
MFCD24039770
PN-8244 2-Chloro-3-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 98%
[1029654-43-0],  MFCD07787387
QP-4891 3-Chloro-2-fluoro-5-(trifluoromethyl) phenylboronic acid
Purity: 95%
[2096342-38-8],  MFCD25459282
BB-6414 2-Chloro-4-formylphenylboronic acid
Purity: 98%
[1063712-34-4],  MFCD18311828
BB-9018 2-Chloro-5-formylphenylboronic acid
Purity: 96%
[1150114-78-5],  MFCD06656269
BB-6031 3-Chloro-2-formylphenylboronic acid
Purity: 95%
[928048-11-7],  MFCD13181639
BB-8545 3-Chloro-4-formylphenylboronic acid
Purity: 96%
[1072952-53-4],  MFCD08274473
FA-1635 3-Chloro-5-formylphenylboronic acid
Purity: 98%
[1451393-35-3],  MFCD09038799
BB-3489 4-Chloro-2-formylphenylboronic acid
Purity: 98%
[913835-76-4],  MFCD08689492
BB-4895 4-Chloro-3-formylphenylboronic acid
Purity: 98%
[2354338-14-8],  MFCD28101633
BB-9014 5-Chloro-2-formylphenylboronic acid
Purity: 96%
[870238-36-1],  MFCD03425955
PN-3489 4-Chloro-2-formylphenylboronic acid, pinacol ester
Purity: 98%
[1132669-91-0],  MFCD18731001
PN-1917 2-Chloro-4-formylpyridine-5-boronic acid pinacol ester
Purity: 96%
[1416721-79-3],  MFCD18718156
BB-2756 3-Chloro-4-hydrazinecarbonylphenylboronic acid
Purity: 98%
[850589-37-6],  MFCD07363764
BB-8637 3-Chloro-4-hydroxy-5-methoxyphenylboronic acid
Purity: 98%
[919496-57-4],  MFCD15143481
PN-8637 3-Chloro-4-hydroxy-5-methoxyphenylboronic acid, pinacol ester
Purity: 96%
[1003298-84-7],  MFCD05663844
BB-9040 2-Chloro-5-hydroxymethylphenylboronic acid
Purity: 98%
[1003042-59-8],  MFCD06656270
FB-5804 3-Chloro-5-(hydroxymethyl)phenylboronic acid
Purity: 96%
[2121512-87-4],  MFCD22397986
BB-1573 4-Chloro-3-(hydroxymethyl)phenylboronic acid
Purity: 98%
[1430237-54-9],  MFCD28122667
QE-5583 2-Chloro-3-(hydroxymethyl)phenylboronic acid pinacol ester
Purity: 95%
[1400755-07-8],  MFCD18729957
PN-6808 2-Chloro-4-hydroxymethylphenylboronic acid, pinacol ester
Purity: 95%
[1485110-17-5],  MFCD18434467
PN-9040 2-Chloro-5-hydroxymethylphenylboronic acid, pinacol ester
Purity: 96%
[1544673-40-6],  MFCD18729959
FF-5804 3-Chloro-5-hydroxymethylphenylboronic acid, pinacol ester
Purity: 98%
[1112210-59-9],  MFCD18374004
BB-1800 (5-Chloro-2-hydroxy-6-methylpyridin-3-yl)boronic acid
Purity: 96%
[2377609-90-8],  MFCD31543951
FB-0995 (2-Chloro-3-hydroxyphenyl)-boronic acid
Purity: 98%
[854778-29-3],  MFCD16878035
FA-2315 2-Chloro-4-hydroxyphenylboronic acid
Purity: 98%
[766549-26-2],  MFCD02684320
BB-3478 2-Chloro-5-hydroxyphenylboronic acid
Purity: 98%
[913835-71-9],  MFCD08689478
FB-2647 2-Chloro-6-hydroxyphenylboronic acid
Purity: 98%
[958646-70-3],  MFCD18393225
BB-8562 3-Chloro-2-hydroxyphenylboronic acid
Purity: 98%
[951655-50-8],  MFCD08689551
BB-3482 3-Chloro-4-hydroxyphenylboronic acid
Purity: 98%
[182344-13-4],  MFCD09258739
BB-5959 3-Chloro-5-hydroxyphenylboronic acid
Purity: 98%
[1214900-52-3],  MFCD15143456
BB-6520 4-Chloro-2-hydroxyphenylboronic acid
Purity: 97%
[1238196-66-1],  MFCD18383546
BB-5718 4-Chloro-3-hydroxyphenylboronic acid
Purity: 98%
[915201-06-8],  MFCD10697413
BB-2604 5-Chloro-2-hydroxyphenylboronic acid
Purity: 96%
[89488-25-5],  MFCD06659863
FF-2647 2-Chloro-6-hydroxyphenylboronic acid, pinacol ester
Purity: 95%
[1451391-17-5],  MFCD16994238
PN-8794 3-Chloro-4-hydroxyphenylboronic acid, pinacol ester
Purity: 98%
[629658-06-6],  MFCD09260490
PN-5959 3-Chloro-5-hydroxyphenylboronic acid, pinacol ester
Purity: 98%
[960388-56-1],  MFCD12546581
PN-6520 4-Chloro-2-hydroxyphenylboronic acid pinacol ester
Purity: 98%
[1377503-12-2],  MFCD16994254
FB-1767 3-Chloro-2-hydroxypyridine-5-boronic acid
Purity: 96%
[1141886-37-4],  MFCD18257742
PN-2899 (6-Chloro-5-hydroxypyridin-2-yl)boronic acid pinacol ester
Purity: 96%
[2377612-01-4],  MFCD18723298
PN-1115 4-Chloro-2-hydroxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Purity: 95%
MFCD24039407
BB-4562 [2-Chloro-5-hydroxy-4-(trifluoromethoxy)phenyl]boronic acid
Purity: 98%
[2377606-01-2],  MFCD22421492
WA-4382 5-Chloro-1h-imidazo[1,2-a]pyridine-8-boronic acid
Purity: 95%
MFCD22684713
BB-0401 {6-Chloroimidazo[1,2-a]pyridin-8-yl}boronic acid hydrochloride
Purity: 95%
MFCD27935615
WA-4550 3-Chloro-1h-indazole-5-boronic acid
Purity: 95%
MFCD22684710
WA-7983 3-Chloro-1h-indazole-6-boronic acid
Purity: 95%
[2364439-37-0],  MFCD22684712
QE-3915 7-Chloro-1h-indazole-4-boronic acid pinacol ester
Purity: 95%
[1186334-62-2],  MFCD22628189
FA-2500 4-Chloro-1h-indole-2-boronic acid
Purity: 97%
[1256355-59-5],  MFCD11506061
FM-2500 4-Chloroindole-2-boronic acid, pinacol ester
Purity: 95%
[1256358-95-8],  MFCD11858364
FM-2495 5-Chloroindole-2-boronic acid pinacol ester
Purity: 96%
[1256358-91-4],  MFCD11858358
PN-6267 6-Chloroindole-2-boronic acid, pinacol ester
Purity: 96%
[912331-84-1],  MFCD16295112
PN-6268 7-Chloroindole-2-boronic acid, pinacol ester
Purity: 98%
[936901-92-7],  MFCD16295113
FM-2493 2-Chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 95%
[1241950-75-3],  MFCD11857676
QB-1807 N-(2-Chloro-6-iodo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)pivalamide
Purity: 95%
[1357387-98-4],  MFCD20487044
QB-6563 5-Chloro-6-iodo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(triisopropylsilyl)-1h-pyrrolo[2,3-b]pyridine
Purity: 95%
[1357387-50-8],  MFCD20487009
BB-6387 2-Chloro-5-isobutoxyphenylboronic acid
Purity: 97%
[1256346-11-8],  MFCD16295072
BB-2379 3-Chloro-5-isobutoxyphenylboronic acid
Purity: 98%
[1256345-48-8],  MFCD16660268
BB-6562 4-Chloro-2-isobutoxyphenylboronic acid
Purity: 97%
[1256355-06-2],  MFCD17015772
BB-6451 4-Chloro-3-isobutoxyphenylboronic acid
Purity: 96%
[1256346-37-8],  MFCD16660285
PN-5957 3-Chloro-5-isobutoxyphenylboronic acid, pinacol ester
Purity: 98%
[1218789-43-5],  MFCD12546579
BB-7015 3-Chloro-2-isobutoxypyridine-4-boronic acid
Purity: 97%
[2096339-80-7],  MFCD18914510
BB-5878 3-Chloro-2-isobutoxypyridine-5-boronic acid
Purity: 98%
[1217500-89-4],  MFCD12546521
BB-6126 5-Chloro-2-isobutoxypyridine-3-boronic acid
Purity: 98%
[1217501-42-2],  MFCD13195663
BB-4330 3-Chloro-4-isopropoxy-5-isobutoxyphenylboronic acid
Purity: 97%
[2096339-27-2],  MFCD21609512
BB-4199 3-chloro-4-isopropoxy-5-methoxyphenylboronic acid
Purity: 98%
[2096341-61-4],  MFCD21332922
BB-4314 3-Chloro-5-isopropoxy-4-methoxyphenylboronic acid
Purity: 98%
[2096331-35-8],  MFCD20529444
BB-6388 2-Chloro-5-isopropoxyphenylboronic acid
Purity: 98%
[1256346-12-9],  MFCD16295073
BB-8192 3-Chloro-4-isopropoxyphenylboronic acid
Purity: 97%
[480438-56-0],  MFCD04974065
BB-6560 4-Chloro-2-isopropoxyphenylboronic acid
Purity: 98%
[1256355-04-0],  MFCD17015770
BB-6449 4-Chloro-3-isopropoxyphenylboronic acid
Purity: 98%
[1256346-35-6],  MFCD17015746
BB-8170 5-Chloro-2-isopropoxyphenylboronic acid
Purity: 95%
[352534-87-3],  MFCD06411283
PN-5956 3-Chloro-5-isopropoxyphenylboronic acid, pinacol ester
Purity: 98%
[1218789-42-4],  MFCD12546618
PN-6449 2-(4-chloro-3-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
[2096998-40-0],  MFCD19440113
BB-4331 3-Chloro-4-isopropoxy-5-propoxyphenylboronic acid
Purity: 98%
[2096339-54-5],  MFCD21332927
BB-4780 2-Chloro-6-isopropoxypyridine-4-boronic acid
Purity: 97%
[2377609-76-0],  MFCD26940376
BB-7014 3-Chloro-2-isopropoxypyridine-4-boronic acid
Purity: 97%
[2096341-71-6],  MFCD18914509
BB-6125 5-Chloro-2-isopropoxypyridine-3-boronic acid
Purity: 96%
[1217501-41-1],  MFCD13195662
BB-5790 5-Chloro-6-isopropoxypyridine-3-boronic acid
Purity: 98%
[1150114-69-4],  MFCD12025983
PC-1113 2-Chloro-3-isopropoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 96%
[2223046-44-2],  MFCD22564310
FA-1050 2-Chloro-4-isoproproxyphenylboronic acid
Purity: 95%
[313545-47-0],  MFCD02684319
PN-4228 3-Chloro-2-(N-isopropylaminomethyl)phenylboronic acid, pinacol ester
Purity: 96%
[2096340-07-5],  MFCD20441911
PN-4250 4-Chloro-2-(isopropylaminomethyl)phenylboronic acid, pinacol ester
Purity: 95%
[2096336-54-6],  MFCD20441923
BB-2760 3-Chloro-4-(N-isopropylcarbamoyl)phenylboronic acid
Purity: 98%
[850589-41-2],  MFCD07363768
BB-2818 4-Chloro-3-(isopropylcarbamoyl)phenylboronic acid
Purity: 98%
[871332-74-0],  MFCD07783866
FB-0045 (2-Chloro-5-isopropylphenyl)boronic acid
Purity: 95%
[875550-89-3],  MFCD16295259
BC-1591 3-Chloro-5-isopropylphenylboronic acid
Purity: 95%
MFCD31726378
BB-9049 2-Chloro-6-isopropylpyridine-3-boronic acid
Purity: 97%
[1003043-37-5],  MFCD08274472
QD-9892 3-Chloroisoquinolin-5-boronic acid
Purity: 95%
[1429665-44-0],  MFCD22199341
QD-6597 3-Chloroisoquinolin-6-boronic acid
Purity: 95%
[1800483-72-0],  MFCD22199342
QD-6083 3-Chloroisoquinolin-7-boronic acid
Purity: 95%
[2096331-38-1],  MFCD22199343
QD-5137 3-Chloroisoquinolin-8-boronic acid
Purity: 95%
[2096333-80-9],  MFCD22199344
FA-4425 1-Chloro-isoquinoline-6-boronic acid
Purity: 95%
[1800484-01-8],  MFCD13190242
FA-4415 1-Chloroisoquinoline-7-boronic acid
Purity: 96%
[370864-49-6],  MFCD13190241
FB-1742 (1-chloroisoquinolin-5-yl)boronic acid
Purity: 95%
[2096338-36-0],  MFCD18257026
FB-1740 (1-chloroisoquinolin-8-yl)boronic acid
Purity: 95%
[2096337-48-1],  MFCD18257024
FA-1710 1-Chloro-4-isoquinolinyl boronic acid
Purity: 95%
[848841-48-5],  MFCD09959721
YE-0053 2-[2-Chloro-5-(methanesulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD18758218
YE-0051 2-[3-Chloro-2-(methanesulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD18758191
YE-0049 2-[3-Chloro-4-(methanesulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
[2253750-91-1],  MFCD18760490
YE-0054 2-[4-Chloro-2-(methanesulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD18758192
BB-0532 (3-Chloro-4-methanesulfonylphenyl)boronic acid
Purity: 96%
[2239305-86-1],  MFCD27935715
BB-0533 (5-Chloro-2-methanesulfonylphenyl)boronic acid
Purity: 95%
[1313617-73-0],  MFCD23380994
BC-1376 4-Chloro-2-(4-methoxybenzyloxy)phenylboronic acid
Purity: 98%
[2377611-82-8],  MFCD30527624
PN-4159 2-Chloro-6-(4-methoxybenzyloxy)pyridine-4-boronic acid, pinacol ester
Purity: 98%
[2096331-22-3],  MFCD20441902
PC-1017 3-Chloro-5-(2-methoxycarbonylethyl)phenylboronic acid pinacol ester
Purity: 97%
[2377607-07-1],  MFCD18759076
FF-7765 5-Chloro-4-methoxycarbonyl-2-fluorophenylboronic acid pinacol ester
Purity: 98%
[890839-31-3],  MFCD16996259
PN-7027 4-Chloro-3-(methoxycarbonyl)-5-methylphenylboronic acid, pinacol ester
Purity: 97%
[2096330-10-6],  MFCD18914528
BC-1028 2-Chloro-5-(methoxycarbonyl)-3-nitrophenylboronic acid
Purity: 95%
[2377605-81-5],  MFCD31653709
PC-1028 2-Chloro-5-methoxycarbonyl-3-nitrophenylboronic acid pinacol ester
Purity: 98%
[2377611-92-0],  MFCD28252213
YC-1783 [2-chloro-3-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
MFCD27578493
BB-2752 3-Chloro-4-methoxycarbonylphenylboronic acid
Purity: 96%
[603122-82-3],  MFCD06659874
BB-3254 3-Chloro-5-(methoxycarbonyl)phenylboronic acid
Purity: 97%
[957120-26-2],  MFCD09475906
YC-1836 4-Chloro-2-(methoxycarbonyl)phenylboronic acid
Purity: 98%
[1612256-37-7],  MFCD25459257
BB-2851 4-Chloro-3-(methoxycarbonyl)phenylboronic acid
Purity: 98%
[874219-45-1],  MFCD06801690
BB-5074 5-Chloro-2-(methoxycarbonyl)phenylboronic acid
Purity: 98%
[957062-64-5],  MFCD09878336
PN-3528 2-Chloro-5-methoxycarbonylphenylboronic acid pinacol ester
Purity: 97%
[710350-72-4],  MFCD16996247
PN-2752 3-Chloro-4-methoxycarbonylphenylboronic acid, pinacol ester
Purity: 98%
[334018-52-9],  MFCD06659928
PN-2851 4-Chloro-(3-methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[625470-33-9],  MFCD14560557
FF-7067 4-Chloro-2-(methoxycarbonyl)phenylboronic acid pinacol ester
Purity: 97%
[866625-02-7],  MFCD16996244
BB-6880 2-Chloro-3-(methoxycarbonyl)pyridine-5-boronic acid
Purity: 97%
[2096332-17-9],  MFCD20441832
BB-5853 2-Chloro-6-(methoxycarbonyl)pyridine-4-boronic acid
Purity: 96%
[2225170-53-4],  MFCD22545868
BC-1430 6-Chloro-8-(methoxycarbonyl)quinoline-3-boronic acid
Purity: 95%
[2377609-72-6],  MFCD31621968