New & Rare (No CAS)


Catalog # Compound Name Structure
OT-6309 2-Acetyl-1,3-dihydroisoindole-4-carbonitrile
Purity: 97%
CA-6160 2-Amino-3-bromo-5,6-difluorobenzoic acid
Purity: 95%
QV-8057 (R)-2-Amino-2-(3-bromophenyl)ethanol hydrochloride
Purity: 98%
MFCD12758090
OT-6239 4-Amino-N-cyclopropyl-3-methoxybenzamide
Purity: 95%
OT-6240 4-Amino-N,N-diethyl-3-methoxybenzamide
Purity: 95%
OT-6237 4-Amino-N-ethyl-3-methoxybenzamide
Purity: 96%
PN-2891 2-(1-Aminoethyl)phenylboronic acid pinacol ester
Purity: 96%
MFCD18733496
OT-6333 6-Amino-5-fluoropyridine-3-carboxamide
Purity: 95%
OT-6244 4-Amino-N-isopropyl-3-methoxybenzamide
Purity: 95%
OT-6238 4-Amino-3-methoxy-N-propylbenzamide
Purity: 95%
OR-9325 (S)-2-(Aminomethyl)-1-ethylpyrrolidine hydrochloride
Purity: 95%
MFCD09991568
OT-6175 2-Amino-6-methyl-3-nitrobenzamide
Purity: 95%
AN-6480 2-Amino-6-methyl-3-nitrobenzonitrile
Purity: 95%
OT-6414 1-[(3R)-3-Aminopiperidin-1-yl]ethanone hydrochloride
Purity: 95%
HC-4568 [4-(3-Aminopropyl)phenyl]boronic acid hydrochloride
Purity: 98%
MFCD32639384
PN-1155 3-(3-Amino-1H-pyraol-5-yl)phenylboronic acid pinacol ester
Purity: 95%
MFCD27936123
QC-0158 4-Aminopyridine-2-carboxylic acid hydrochloride hydrate
Purity: 95%
MFCD26523293
PN-0921 2-Amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 95%
MFCD24040045
PN-1430 2-Amino-3-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid
Purity: 95%
MFCD27936323
PN-0929 4-Amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzonitrile
Purity: 95%
MFCD27936042
QN-5496 Aneurine hydrochloride hydrate
Purity: 95%
MFCD32644694
QB-5230 3-Azabicyclo[3.1.0]hexane-3-carboxylic acid, 6-(aminomethyl)-, 1,1-dimethylethyl ester, (1r,5s,6r)-rel-
Purity: 95%
MFCD16294637
QH-3272 Benzothiophene-2-boronic acid mida ester
Purity: 95%
MFCD20527199
OT-6197 Benzyl 3-amino-1-methylcyclobutane-1-carboxylate
Purity: 95%
SS-1876 1-Benzyl-4-(benzyloxy)pyrrolidine-2-carboxylic acid hydrochloride
Purity: 95%
MFCD09910440
OT-6234 Benzyl N,N-bis(carbamoylmethyl)carbamate
Purity: 95%
OT-6076 Benzyl 3-cyano-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Purity: 95%
OT-6303 benzyl 1,2-dihydrospiro[indole-3,4'-piperidine]-1'-carboxylate hydrochloride
Purity: 95%
OT-6196 Benzyl 1-methyl-3-oxocyclobutane-1-carboxylate
Purity: 95%
AM-2479 Benzyl N-(4-methylpiperidin-4-yl)carbamate
Purity: 95%
PC-1832 Benzyl N-[6-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl]carbamate
Purity: 96%
MFCD33552154
OT-5989 1-(Benzyloxy)-2-bromo-4-isopropylbenzene
Purity: 95%
JN-3139 2-(2-(Benzyloxy)-3-bromo-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD32707225
OT-6479 4-(Benzyloxy)butanenitrile
Purity: 95%
BC-1832 (5-{[(Benzyloxy)carbonyl]amino}-2-methylpyridin-3-yl)boronic acid
Purity: 96%
MFCD33552064
OT-6467 2-{[(Benzyloxy)carbonyl]amino}-6-{[(tert-butoxy)carbonyl]amino}hexanoic acid
Purity: 95%
OT-6120 {[(Benzyloxy)carbonyl](carboxymethyl)amino}acetic acid
Purity: 95%
BC-1906 [4-(Benzyloxy)-3-chloro-2-fluorophenyl]boronic acid
Purity: 95%
PN-4910 2-[3-(Benzyloxy)-2-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD34184907
BB-7061 [3-(Benzyloxy)-2,4-difluorophenyl]boronic acid
Purity: 98%
MFCD31805741
BB-0035 [2-(Benzyloxy)ethyl]boronic acid
Purity: 98%
MFCD27935497
BC-1838 [3-(Benzyloxy)-5-fluoro-4-methylphenyl]boronic acid
Purity: 95%
MFCD33552065
BC-1789 [3-(Benzyloxy)-5-formylphenyl]boronic acid
Purity: 95%
MFCD22399090
BC-1860 [2-(Benzyloxy)-5-isopropylphenyl]boronic acid
Purity: 95%
HE-9700 3-(Benzyloxy)-1-naphthaleneboronic acid
Purity: 96%
MFCD32068440
OT-4272 N-(Benzyloxy)-N-[(2-nitrobenzene)sulfonyl](2-nitrobenzene)sulfonamide
Purity: 98%
MFCD30527663
PC-1886 2-[2-(Benzyloxy)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
OT-6156 N-{2-[4-(Benzyloxy)phenyl]ethyl}methanesulfonamide
Purity: 96%
BC-1791 [4-(benzyloxy)-3-tert-butylphenyl]boronic acid
Purity: 98%
MFCD33552061
PN-1080 2-(Benzyloxy)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Purity: 95%
MFCD24039731
OT-6023 Benzyl N-{pyrazolo[1,5-a]pyrimidin-6-yl}carbamate
Purity: 98%
OT-6320 Benzyl N-{6-[(tert-butyldimethylsilyl)oxy]hexyl}carbamate
Purity: 95%
OT-6304 1-Benzyl 1'-tert-butyl 2H-spiro[indole-3,4'-piperidine]-1,1'-dicarboxylate
Purity: 98%
QF-4659 Beta-glycerophosphoric acid disodium salt pentahydrate
Purity: 95%
MFCD00149083
OT-4312 (3beta)-28-Iodoolean-12-en-3-ol
Purity: 95%
MFCD30834402
QN-8292 Beta-nicotinamide adenine dinucleotide hydrate
Purity: 95%
MFCD00150377
OT-4311 (3beta)-Olean-12-en-3,28-diol di-tosylate
Purity: 95%
MFCD30834401
QC-9812 Bilirubin conjugate
Purity: 95%
MFCD08669555
BC-1279 Bis(4-cyano-3,5-difluorophenyl)borinic acid
Purity: 95%
MFCD29764377
BC-1073 Bis(4-cyclopropylphenyl)borinic acid
Purity: 95%
MFCD28385200
BC-1603 Bis(3-cyclopropylphenyl)boronic acid
Purity: 95%
MFCD32065675
BB-5469 [2,6-Bis(methoxycarbonyl)pyridin-4-yl]boronic acid
Purity: 98%
MFCD22545909
BB-4906 Bis(4-methoxynaphthalen-1-yl)borinic acid
Purity: 97%
MFCD28101634
AN-3464 4-[N,N-Bis(4-nitrobenzenesulfonyl)amino]benzotrifluoride
Purity: 98%
MFCD26523320
PC-1777 3,5-Bis(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine
Purity: 95%
MFCD32900074
BC-1778 (4-Boc-amino-2-chloro-5-methoxy)phenylboronic acid
Purity: 95%
MFCD32899959
BB-4728 4-(1-Boc-aminoethyl)phenylboronic acid
Purity: 98%
MFCD31726370
PC-1336 2-[1-(N-Boc-Amino)ethyl]phenylboronic acid pinacol ester
Purity: 96%
MFCD30182414
OT-5512 Boc-amino-(4-methylsulfanylphenyl)acetic acid
Purity: 96%
PC-1356 1-BOC-2-Carbonylpyrrolidine-4-boronic acid pinacol ester
Purity: 95%
MFCD30489022
QD-8288 4-(4-Boc-homopiperazin-1-ylsulfonyl)phenylboronic acid pinacol ester
Purity: 95%
MFCD18915054
HA-2843 Boc-l-met(o)-o-ch2-f-ch2-cooh dcha
Purity: 95%
MFCD30749174
SS-3957 (S)-3-(1-Boc-pyrrolidin-2-yl)-propionic acid dcha
Purity: 95%
MFCD09952616
HA-4913 Boc-l-thr(bzl)-o-ch2-f-ch2-cooh dcha
Purity: 95%
MFCD30749176
QD-7322 1-Boc-2-trimethylsilylindole-4-boronic acid pinacol ester
Purity: 95%
MFCD19982313
JN-5395 2-(6-Bromo-2-chloro-3-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD32632185
QD-8045 2-Bromo-5-chloro-3-fluoro-4-pyridineboronic acid pinacol ester
Purity: 95%
MFCD18915053
BC-1765 (3-Bromo-4-chloro-5-methoxyphenyl)boronic acid
Purity: 98%
MFCD33552058
PC-1765 2-(3-Bromo-4-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
BC-1896 (3-Bromo-2-chloro-5-nitrophenyl)boronic acid
Purity: 95%
PC-1896 2-(3-Bromo-2-chloro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
BB-7000 (5-Bromo-4-cyano-2-fluorophenyl)boronic acid
Purity: 98%
MFCD20486730
BC-1151 (3-Bromo-2,5-difluorophenyl)boronic acid
Purity: 97%
MFCD31613609
OT-6305 1-(4-Bromo-1,3-dihydroisoindol-2-yl)ethanone
Purity: 95%
BB-3918 4-Bromo-3-(dihydroxyboranyl)-2-fluorobenzoic acid
Purity: 98%
MFCD32065666
AN-6484 4-Bromo-N,2-dimethyl-6-nitroaniline
Purity: 96%
BC-1631 (3-Bromo-5-ethylphenyl)boronic acid
Purity: 98%
MFCD32631791
JN-3563 2-(2-Bromo-6-fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD32632234
JN-9671 2-(5-Bromo-2-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD28141745
BC-1689 [3-Bromo-2-fluoro-6-(4-methylpiperazin-1-yl)pyridin-4-yl]boronic acid
Purity: 95%
MFCD32639410
BC-1685 (3-Bromo-2-fluoro-6-morpholinopyridin-4-yl)boronic acid
Purity: 95%
MFCD32639378
OT-6140 (7-Bromo-1H-indol-2-yl)methanol
Purity: 95%
PC-1817 2-(4-Bromo-3-methoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD33552152
PC-1666 5-Bromo-6-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Purity: 98%
MFCD32696895
HI-1931 N-(5-Bromo-2H-pyrazol-3-yl)acetamide
Purity: 96%
MFCD23699503
BC-1705 (6-Bromoquinolin-3-yl)boronic acid
Purity: 95%
MFCD32641095
OT-6117 4-Bromo-3-{[(tert-butyldimethylsilyl)oxy]methyl}pyridine
Purity: 96%
BC-1893 {3-Bromo-5-[(tert-butyldimethylsilyl)oxy]phenyl}boronic acid
Purity: 95%
PC-1743 6-Bromo-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-2-benzofuran-1-one
Purity: 98%
MFCD33552137
PC-1866 4-Bromo-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one
Purity: 96%
MFCD34184906
PC-1766 5-Bromo-N-[2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanamide
Purity: 96%
MFCD32900072
PC-1658 2-Bromo-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
MFCD32900070
FF-8110 5-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-pyrrolo[2,3-b]pyridine
Purity: 96%
MFCD16995998
OS-7991 4-Bromo-5-(tributylstannyl)-1,3-thiazole
Purity: 97%
MFCD28515395
BB-6774 4-Butoxy-3-(trifluoromethyl)phenylboronic acid
Purity: 98%
MFCD20441831
OT-6355 N-(But-3-yn-1-yl)-2,2,2-trifluoroacetamide
Purity: 96%
HA-3991 Calcium phosphate tribasic
Purity: 95%
MFCD00867081
HA-4598 (1R)-(-)-(10-Camphorsulfonyl)oxaziridine
Purity: 95%
MFCD30486441
JN-6176 4-Carboxy-2-fluorophenylboronic acid ethylene glycol ester
Purity: 95%
MFCD28976882
JN-2920 4-Carboxy-3-fluorophenylboronic acid ethylene glycol ester
Purity: 95%
MFCD32631762
PN-2962 6-Carboxyindole-3-boronic acid pinacol ester
Purity: 95%
MFCD27936776
QC-7663 5'-Cdp 3na salt hydrate
Purity: 95%
MFCD15042181
QW-3552 Ceric ammonium molybdate aqueous solution (contains H2SO4) for TCL stain
Purity: 95%
MFCD06797081
BB-0302 [2-Chloro-4-(cyanomethyl)phenyl]boronic acid
Purity: 98%
MFCD27935536
JN-1496 2-Chloro-5-(1,3-dioxolan-2yl)phenylboronic acid
Purity: 95%
MFCD31619407
BB-0570 [2-Chloro-4-(4-ethylpiperazin-1-yl)phenyl]boronic acid
Purity: 96%
MFCD27935745
BC-1905 (3-Chloro-2-fluoro-4-hydroxyphenyl)boronic acid
Purity: 95%
OT-6050 2-Chloro-5-fluoro-3-nitroaniline
Purity: 95%
PN-4629 2-Chloro-6-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
PC-1879 4-Chloro-3-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
Purity: 95%
PC-1847 2-[5-Chloro-2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD33552156
BC-1844 (5-Chloro-2-hydroxy-4-methylphenyl)boronic acid
Purity: 95%
MFCD31697530
YC-1783 [2-chloro-3-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
MFCD27578493
FB-6366 (4-Chloro-2-methoxy-6-methylphenyl)boronic acid
Purity: 98%
MFCD33552070
PC-1872 2-(2-Chloro-6-methoxy-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
BC-1716 {2-chloro-3-[(4-methoxyphenyl)methoxy]phenyl}boronic acid
Purity: 98%
MFCD32696798
PN-5190 2-Chloro-4-methoxypyridine-5-boronic acid pinacol ester
Purity: 95%
MFCD18779779
BC-1731 [4-Chloro-2-(methylsulfanyl)pyrimidin-5-yl]boronic acid
Purity: 96%
MFCD32696800
PC-1844 4-chloro-5-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Purity: 98%
QD-4682 (4-Chlorophenyl)hydrazine hydrochloride hydrate
Purity: 95%
MFCD26383925
OT-6370 4-(2-Chlorophenyl)oxane-4-carboxamide
Purity: 97%
BB-3398 4-(3-Chloropropyl)phenylboronic acid
Purity: 97%
MFCD28808818
OT-6245 1-(2-Chloropyridin-3-yl)cyclopentane-1-carboxamide
Purity: 95%
PN-1449 2-[5-Chloro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid
Purity: 98%
MFCD24039779
PC-1754 2-Chloro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
MFCD33552138
QF-9370 Citicoline sodium salt hydrate
Purity: 97%
MFCD10567436
HC-4559 [4-(1-Cyanocyclopropyl)-2-fluorophenyl]boronic acid
Purity: 96%
MFCD32639381
BB-0462 [4-(1-Cyanocyclopropyl)-2-methylphenyl]boronic acid
Purity: 96%
MFCD27935658
OT-4974 (3-Cyano-2,6-difluorophenyl)boronic acid
Purity: 96%
MFCD27965246
BB-0392 {2-[Cyano(dimethylamino)methyl]phenyl}boronic acid
Purity: 98%
MFCD27935610
BB-0316 (2-Cyano-3-ethoxyphenyl)boronic acid
Purity: 96%
MFCD27935545
BC-1874 (3-Cyano-2-fluoro-4-methylphenyl)boronic acid
Purity: 95%
FB-2663 4-Cyano-2-hydroxyphenylboronic acid
Purity: 96%
MFCD18394170
BB-0484 [2-Cyano-3-(piperidin-1-yl)phenyl]boronic acid
Purity: 95%
MFCD27935679
PN-1684 N-Cyclohexyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide
Purity: 95%
MFCD27936474
PN-0992 N-Cyclopentyl-5-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 96%
MFCD24039546
BC-1813 {4-[Cyclopropyl(methyl)sulfamoyl]-2-fluorophenyl}boronic acid
Purity: 96%
MFCD32899961
PC-1217 N-Cyclopropyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide
Purity: 97%
MFCD29043344
PN-5942 4-Cyclopropylthiophenylboronic acid pinacol ester
Purity: 95%
MFCD22383767
HA-7921 3,5-Diaminobenzoic acid dihydrochloride hemihydrate
Purity: 95%
MFCD00150109
QN-1703 L-2,4-Diaminobutyric acid 2hbr
Purity: 95%
MFCD27997531
SS-8178 2,2'-Dibromo-4,4'-di-tert-butyl-biphenyl
Purity: 95%
MFCD20921697
PC-1222 2-(4,7-Dibromo-3-methoxynaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
CS-9147 1,1'-(2,5-Dibromo-1,4-phenylene)bis(2,5,8,11,14-pentaoxapentadecane)
Purity: 95%
MFCD31653745
HI-1917 4,5-Dibromo-2H-pyrazol-3-amine
Purity: 95%
MFCD20528308
QV-4058 5,6-Dichlorobenzo[d]thiazol-2-amine compound with 6,7-dichlorobenzo[d]thiazol-2-amine (1:1)
Purity: 95%
MFCD28657152
BC-1889 [2,6-Dichloro-4-(dimethoxymethyl)pyridin-3-yl]boronic acid
Purity: 95%
BC-1647 [2,3-Dichloro-4-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
MFCD32899958
BB-0425 {2-[(Diethylamino)methyl]-3-fluorophenyl}boronic acid
Purity: 95%
MFCD27935632
HD-7800 N,N-Diethyl-2-methyl-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzenesulfonamide
Purity: 98%
MFCD31654539
BB-0581 (6,7-Difluoro-1,2-dimethyl-1,3-benzodiazol-5-yl)boronic acid
Purity: 95%
MFCD27935756
TB-9131 [Difluoro(2-methylindazol-6-yl)-$l^{5}-boranylidene]-$l^{2}-fluorane potassium
Purity: 96%
MFCD31726529
BC-1177 2,5-Difluoro-3-methylphenylboronic acid
Purity: 98%
MFCD23712891
FF-6428 2-(2,5-Difluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD16996283
QN-3085 3,5-Difluorophenylboronic acid mida ester
Purity: 95%
MFCD29059821
JN-0290 2-(2,4-Difluorophenyl)-1,3,2-dioxaborolane
Purity: 95%
MFCD32707168
BB-4723 2-(2,6-Difluoropyridin-4-yl)-1,3,6,2-dioxazaborocane
Purity: 98%
MFCD24448774
BC-1815 [3-(3,3-Difluoropyrrolidine-1-sulfonyl)phenyl]boronic acid
Purity: 95%
MFCD32899962
PN-1594 2,6-Difluoro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Purity: 96%
MFCD24039815
HE-6073 3,3-Difluoro-1-((3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)pyrrolidine
Purity: 98%
MFCD32198948
BC-1742 (1,3-dihydro-2-benzofuran-4-yl)boronic acid
Purity: 96%
MFCD22397735
HC-4561 (3,4-Dihydro-2H-1-benzopyran-5-yl)boronic acid
Purity: 97%
MFCD32639413
OT-6369 1-(6,8-Dihydro-5H-1,7-naphthyridin-7-yl)-2,2,2-trifluoroethanone
Purity: 95%
OT-5429 2-(Dihydroxyboranyl)-1H-indole-7-carboxylic acid
Purity: 96%
MFCD32900023
BB-2499 5-(Dihydroxyboranyl)-3-methoxypyridine-2-carboxylic acid
Purity: 95%
MFCD22491369
BC-1750 3-(Dihydroxyboranyl)-5-(trifluoromethoxy)benzoic acid
Purity: 96%
MFCD28976939
BB-4839 2-(dihydroxyboranyl)-5-(trifluoromethyl)benzoic acid
Purity: 96%
MFCD32197508
HA-0539 N-(1-(3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2-oxo-1,2-dihydropyrimidin-4-yl)benzamide
Purity: 95%
MFCD01457402
BC-1787 3-Diihydroxyboranyl)-5-hydroxybenzoic acid
Purity: 95%
BC-1857 [6-(Dimethoxymethyl)-5-methoxypyridin-3-yl]boronic acid
Purity: 95%
MFCD34184859
QP-3819 2-(Dimethylamino)acetaldehyde sodium hydrogensulfite
Purity: 97%
MFCD28986184
QN-9364 2-([(5-Dimethylamino)methylfuryl]thio)ethylamine dihydrochloride
Purity: 95%
MFCD28991706
HG-3496 2-((Dimethylamino)methyl)phenylboronic acid hydrochloride
Purity: 95%
MFCD27952814
OT-5263 1,4-dimethylpyrrolo[3,2-b]pyridin-4-ium iodide
Purity: 95%
MFCD32696889
BB-0599 [3-(Dimethylsulfamoyl)-5-methylphenyl]boronic acid
Purity: 97%
MFCD27935773
PN-1334 N,3-Dimethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide
Purity: 95%
MFCD27936250
BC-1693 3-(1,3,6,2-dioxazaborocan-2-yl)cyclohexan-1-one
Purity: 96%
MFCD32641093
BC-1696 3-(1,3,6,2-Dioxazaborocan-2-yl)cyclopentan-1-one
Purity: 97%
MFCD32641094
QZ-9253 2-(1,3-Dioxolan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole
Purity: 95%
MFCD29762568
OT-5447 1,1-Dioxo-1$l^{6}-thiane-4-carboxamide
Purity: 96%
CS-9166 2,5-Di(2,5,8,11,14-pentaoxapentadecyl)-1,4-phenylenediboronic acid
Purity: 97%
MFCD22383687
HB-0513 Dipotassium 2-naphthol-6,8-disulfonate hydrate
Purity: 95%
MFCD09750374
QV-2911 Disodium mono(1,3-dihydroxypropan-2-yl phosphate) mono(2,3-dihydroxypropyl phosphate) hydrate
Purity: 95%
MFCD30478747
OT-6231 1,3-di-tert-Butyl 5-nitrobenzene-1,3-dicarboxylate
Purity: 96%
OT-5508 Dodeca-11-en-1-ol
Purity: 96%
QC-5425 (-)-Epigallocatechin gallate hydrate
Purity: 97%
MFCD09037364
JN-1704 2-(3-Ethoxy-2,6-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD32707279
FA-4429 [4-(1-Ethoxyethyl)phenyl]boronic acid hydrate
Purity: 95%
MFCD13193942
BB-5857 [2-(2-Ethoxy-2-oxoethoxy)phenyl]boronic acid
Purity: 98%
MFCD32899956
PN-1056 2-Ethoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 98%
MFCD24039825