New & Rare (No CAS)

Catalog # Compound Name Structure
AN-6458 2-Acetamido-4-fluorobenzamide
Purity: 98
OT-5690 3-(acetyloxy)-5-pentylphenyl acetate
Purity: 97%
QV-8057 (R)-2-Amino-2-(3-bromophenyl)ethanol hydrochloride
Purity: 98%
AN-6454 3-Amino-5-bromopyridine-4-carbonitrile
Purity: 95%
PN-2891 2-(1-Aminoethyl)phenylboronic acid pinacol ester
Purity: 96%
AN-6460 3-amino-5-fluoro-2-nitrobenzamide
Purity: 95%
AM-2652 2-Amino-N-isopropylethanesulfonamide
Purity: 95%
OR-9325 (S)-2-(Aminomethyl)-1-ethylpyrrolidine hcl
Purity: 95%
OT-5771 4-(Aminomethyl)-3-methylbenzoic acid
Purity: 95%
HC-4568 [4-(3-Aminopropyl)phenyl]boronic acid hydrochloride
Purity: 98%
PN-1155 3-(3-Amino-1H-pyraol-5-yl)phenylboronic acid pinacol ester
Purity: 95%
QC-0158 4-Aminopyridine-2-carboxylic acid hydrochloride hydrate
Purity: 95%
PN-0921 2-Amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 95%
PN-1430 2-Amino-3-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid
Purity: 95%
QB-5230 3-Azabicyclo[3.1.0]hexane-3-carboxylic acid, 6-(aminomethyl)-, 1,1-dimethylethyl ester, (1r,5s,6r)-rel-
Purity: 95%
QH-3272 Benzothiophene-2-boronic acid mida ester
Purity: 95%
OT-5943 4-(Benzylamino)-3-nitrobenzoic acid
Purity: 95%
OT-5623 Benzyl N-(2-{[2-(2-{[(benzyloxy)carbonyl]amino}ethoxy)propan-2-yl]oxy}ethyl)carbamate
Purity: 95%
OT-5363 Benzyl({[5-(benzyloxy)pyridin-2-yl]methyl})amine
Purity: 98%
SS-1876 1-Benzyl-4-(benzyloxy)pyrrolidine-2-carboxylic acid, HCl
Purity: 95%
OT-5642 Benzyl N-(5-bromo-6-methylpyridin-3-yl)carbamate
Purity: 95%
OT-5829 Benzyl 4-(chloromethyl)piperidine-1-carboxylate
Purity: 95%
OT-5710 2-Benzyl-4-chlorophthalazin-1-one
Purity: 96%
OT-5764 Benzyl 2-cyano-2-(2-methoxypyridin-4-yl)acetate
Purity: 95%
OT-5421 Benzyl (2S)-2-cyano-2-methylpyrrolidine-1-carboxylate
Purity: 95%
OT-6047 Benzyl 2-(4,4-difluoropiperidin-1-yl)acetate
Purity: 96%
OT-6052 Benzyl 3-(dimethylcarbamoyl)azetidine-1-carboxylate
Purity: 95%
OT-6038 Benzyl N-[3-(dimethylcarbamoyl)propyl]carbamate
Purity: 95%
OT-5929 1-Benzyl 3-ethyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1,3-dicarboxylate
Purity: 95%
OT-5353 Benzyl[(5-fluoropyridin-2-yl)methyl]amine
Purity: 98%
OT-5938 Benzyl 3-hydroxy-3-{[(2-hydroxyethyl)amino]methyl}pyrrolidine-1-carboxylate
Purity: 95%
OT-5760 Benzyl 3-hydroxy-3-phenylpiperidine-1-carboxylate
Purity: 95%
OT-5389 Benzyl[(4-methoxypyridin-2-yl)methyl]amine
Purity: 96%
PC-1832 Benzyl N-[6-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl]carbamate
Purity: 95%
OT-5784 1-Benzyl 3-methyl trans-4-phenylpyrrolidine-1,3-dicarboxylate
Purity: 95%
OT-5273 (2S)-2-{[(Benzyloxy)carbonyl]amino}-3-(furan-2-yl)propanoic acid
Purity: 95%
BC-1832 (5-{[(Benzyloxy)carbonyl]amino}-2-methylpyridin-3-yl)boronic acid
Purity: 95%
OT-5298 (3R)-3-{[(Benzyloxy)carbonyl]amino}-4-(phenylsulfanyl)butanoic acid
Purity: 95%
PN-4910 2-[3-(Benzyloxy)-2-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
OT-5636 [3-(Benzyloxy)cyclobutoxy](tert-butyl)dimethylsilane
Purity: 98%
OT-6036 3-(Benzyloxy)cyclohexan-1-ol
Purity: 95%
BB-7061 [3-(Benzyloxy)-2,4-difluorophenyl]boronic acid
Purity: 98%
BB-0035 [2-(Benzyloxy)ethyl]boronic acid
Purity: 95%
OT-5720 3-(Benzyloxy)-5-fluoro-4-methylbenzaldehyde
Purity: 95%
OT-5719 3-(Benzyloxy)-5-fluoro-4-methylbenzoic acid
Purity: 96%
BC-1838 [3-(Benzyloxy)-5-fluoro-4-methylphenyl]boronic acid
Purity: 95%
BC-1789 [3-(Benzyloxy)-5-formylphenyl]boronic acid
Purity: 95%
SH-6776 7-(Benzyloxy)-1-methylindazole
Purity: 96%
HE-9700 3-(Benzyloxy)-1-naphthaleneboronic acid
Purity: 96%
OT-4272 N-(Benzyloxy)-N-[(2-nitrobenzene)sulfonyl](2-nitrobenzene)sulfonamide
Purity: 98%
OT-6034 4-(Benzyloxy)phenoxy(tert-butyl)dimethylsilane
Purity: 96%
OT-5940 2-[4-(Benzyloxy)phenyl]-2-[cyclopropyl(methyl)amino]acetonitrile
Purity: 95%
OT-5725 1-[4-(Benzyloxy)phenyl]-2-methylpropan-2-amine
Purity: 95%
BC-1791 [4-(benzyloxy)-3-tert-butylphenyl]boronic acid
Purity: 98%
SH-7803 2-Benzyl-3H-phthalazine-1,4-dione
Purity: 96%
OT-6079 Benzyl N-{3-[(pyridin-2-yl)amino]propyl}carbamate
Purity: 96%
OT-5256 Benzyl N-[6-({[(tert-butoxy)carbonyl]amino}methyl)pyridin-3-yl]carbamate
Purity: 95%
OT-5746 4-Benzyl 1-tert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate
Purity: 97%
OT-5965 Benzyl trans-N-(-4-carbamoylcyclohexyl)carbamate
Purity: 95%
QF-4659 Beta-glycerophosphoric acid disodium salt pentahydrate
Purity: 95%
OT-4312 (3beta)-28-Iodoolean-12-en-3-ol
Purity: 95%
OT-4311 (3beta)-Olean-12-en-3,28-diol di-tosylate
Purity: 95%
QC-9812 Bilirubin conjugate
Purity: 95%
BC-1279 Bis(4-cyano-3,5-difluorophenyl)borinic acid
Purity: 95%
BC-1073 Bis(4-cyclopropylphenyl)borinic acid
Purity: 95%
BC-1603 Bis(3-cyclopropylphenyl)boronic acid
Purity: 95%
BB-5469 [2,6-Bis(methoxycarbonyl)pyridin-4-yl]boronic acid
Purity: 98%
BB-4906 Bis(4-methoxynaphthalen-1-yl)borinic acid
Purity: 97%
OT-5931 2,6-Bis(methylsulfanyl)pyrimidine-4-carboxylic acid
Purity: 95%
AN-3464 4-[N,N-Bis(4-nitrobenzenesulfonyl)amino]benzotrifluoride
Purity: 98%
HI-2249 N,N'-Bis(2H-pyrazol-3-yl)propanediamide
Purity: 97%
PC-1777 3,5-Bis(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine
Purity: 95%
OT-5820 N-[3,5-Bis(trifluoromethyl)phenyl]morpholine-4-carboxamide
Purity: 98%
BC-1778 (4-Boc-amino-2-chloro-5-methoxy)phenylboronic acid
Purity: 95%
BB-4728 4-(1-Boc-aminoethyl)phenylboronic acid
Purity: 98%
PC-1336 2-[1-(N-Boc-Amino)ethyl]phenylboronic acid pinacol ester
Purity: 96%
QC-2391 (R,S)-Boc-2-amino-3-methyl-3-phenyl-butyric acid dcha
Purity: 95%
OT-5512 Boc-amino-(4-methylsulfanylphenyl)acetic acid
Purity: 96%
PC-1356 1-BOC-2-Carbonylpyrrolidine-4-boronic acid pinacol ester
Purity: 95%
SS-2254 Boc-d-dab(boc)-oh dcha
Purity: 95%
HA-2843 Boc-l-met(o)-o-ch2-f-ch2-cooh dcha
Purity: 95%
SS-3957 (S)-3-(1-Boc-pyrrolidin-2-yl)-propionic acid dcha
Purity: 95%
HA-4913 Boc-l-thr(bzl)-o-ch2-f-ch2-cooh dcha
Purity: 95%
OT-5407 4-Bromo-N-(2-chloroethyl)-N-methyl-2-nitroaniline
Purity: 98%
OT-5873 1-(6-Bromo-3-chloro-2-fluorophenyl)ethanol
Purity: 96%
OT-5222 1-(3-Bromo-5-chloro-4-fluorophenyl)piperazine
Purity: 95%
OT-5775 1-Bromo-5-chloro-2-fluoro-4-(trifluoromethyl)benzene
Purity: 98%
OT-5845 1-Bromo-5-chloro-2-methoxy-4-(trifluoromethyl)benzene
Purity: 95%
OT-5889 7-Bromo-2-(chloromethyl)imidazo[1,2-a]pyridine hydrochloride
Purity: 95%
BB-7000 (5-Bromo-4-cyano-2-fluorophenyl)boronic acid
Purity: 98%
OT-5438 2-Bromo-4-cyclobutoxy-5-fluoroaniline
Purity: 95%
OT-5449 4-Bromo-2-cyclobutoxy-1-fluorobenzene
Purity: 96%
OT-5427 1-Bromo-5-cyclobutoxy-4-fluoro-2-nitrobenzene
Purity: 98%
SH-7792 4-Bromo-3,5-dichlorophenyl methanesulfonate
Purity: 96%
BC-1151 (3-Bromo-2,5-difluorophenyl)boronic acid
Purity: 96%
AM-2637 (E)-1-[(4-Bromo-2,6-difluorophenyl)methylidene]-2-methylhydrazine
Purity: 95%
OT-5853 5-Bromo-2,4-dihydro-1,4-benzoxazin-3-one
Purity: 95%
BB-3918 4-Bromo-3-(dihydroxyboranyl)-2-fluorobenzoic acid
Purity: 98%
CA-6130 4-Bromo-N,3-dimethoxy-N-methylbenzamide
Purity: 96%
AN-6466 2-Bromo-1,3-dimethoxy-4-nitrobenzene
Purity: 96%
AN-6448 4-Bromo-2,3-dimethyl-6-nitrophenol
Purity: 95%
OT-5893 5-Bromo-4-ethoxy-6-methylpyrimidine
Purity: 96%
CA-6155 4-bromo-2-ethylbenzenesulfonamide
Purity: 95%
BC-1631 (3-Bromo-5-ethylphenyl)boronic acid
Purity: 98%
BC-1689 [3-Bromo-2-fluoro-6-(4-methylpiperazin-1-yl)pyridin-4-yl]boronic acid
Purity: 95%
BC-1685 (3-Bromo-2-fluoro-6-morpholinopyridin-4-yl)boronic acid
Purity: 95%
OT-5216 3-[(4-Bromo-2-fluorophenyl)amino]-2-hydroxypropanoic acid
Purity: 96%
OT-5794 2-(5-Bromo-3-fluoropyridin-2-yl)acetamide
Purity: 96%
CA-6115 4-Bromo-3-hydroxy-2-nitrophenoxyacetic acid
Purity: 98%
SH-7766 4-Bromo-N-(4-iodophenyl)aniline
Purity: 95%
PC-1817 2-(4-Bromo-3-methoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
AN-6456 2-Bromo-4-(2-methoxyphenoxy)aniline
Purity: 96%
OT-5749 2-Bromo-4-(2-methoxyphenoxy)-1-nitrobenzene
Purity: 96%
HI-2449 2-Bromo-1-methylimidazole hydrobromide
Purity: 97%
AN-6429 4-Bromo-2-methyl-6-nitrobenzoic acid
Purity: 98%
PC-1666 5-Bromo-6-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Purity: 98%
OT-5613 4-Bromo-1-(oxan-4-ylmethyl)pyrazole
Purity: 96%
OT-5762 1-(3-Bromophenoxy)-2-methoxybenzene
Purity: 96%
AN-6449 4-[(4-Bromophenyl)amino]benzamide
Purity: 98%
SH-6833 3-Bromo-4H,5H,6H,7H-pyrazolo[1,5-a]pyridine
Purity: 95%
HI-1931 N-(5-Bromo-2H-pyrazol-3-yl)acetamide
Purity: 96%
OT-5911 N-(3-Bromopyridin-2-yl)methanesulfonamide
Purity: 95%
OT-5968 2-(5-Bromopyridin-2-yl)-2-methylpropanamide
Purity: 95%
BC-1705 (6-Bromoquinolin-3-yl)boronic acid
Purity: 95%
OT-5747 4-bromo-2-[(tert-butyldimethylsilyl)oxy]benzaldehyde
Purity: 96%
PC-1743 6-Bromo-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-2-benzofuran-1-one
Purity: 98%
PC-1866 4-Bromo-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one
Purity: 95%
PC-1766 5-Bromo-N-[2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanamide
Purity: 96%
PC-1658 2-Bromo-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
FF-8110 5-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-pyrrolo[2,3-b]pyridine
Purity: 95%
OS-7991 4-Bromo-5-(tributylstannyl)-1,3-thiazole
Purity: 97%
OT-5923 2-Bromo-4,5,6-trichloro-3-methoxypyridine
Purity: 95%
BB-6774 4-Butoxy-3-(trifluoromethyl)phenylboronic acid
Purity: 98%
PN-2962 6-Carboxyindole-3-boronic acid pinacol ester
Purity: 95%
HA-6106 4-(Carboxymethyl)-2-fluorobenzeneboronic acid
Purity: 95%
QC-7663 5'-Cdp 3na salt hydrate
Purity: 95%
QW-3552 Ceric ammonium molybdate aqueous solution (contains H2SO4) for TCL stain
Purity: 95%
OT-5501 1-(6-Chloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroethanone hydrate
Purity: 98%
OT-5704 3-Chloro-5-(chloromethyl)-2-fluoropyridine
Purity: 95%
BB-0302 [2-Chloro-4-(cyanomethyl)phenyl]boronic acid
Purity: 98%
BB-0570 [2-Chloro-4-(4-ethylpiperazin-1-yl)phenyl]boronic acid
Purity: 95%
OT-6050 2-Chloro-5-fluoro-3-nitroaniline
Purity: 95%
OT-5662 5-Chloro-6-fluoropyridine-3-carbaldehyde
Purity: 96%
OT-5703 (5-Chloro-6-fluoropyridin-3-yl)methanol
Purity: 95%
PC-1847 2-[5-Chloro-2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
YC-1783 [2-chloro-3-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
AN-6453 1-Chloro-4-methoxy-2,3-dimethyl-5-nitrobenzene
Purity: 95%
FB-6366 (4-Chloro-2-methoxy-6-methylphenyl)boronic acid
Purity: 96%
BC-1716 {2-chloro-3-[(4-methoxyphenyl)methoxy]phenyl}boronic acid
Purity: 98%
PN-5190 2-Chloro-4-methoxypyridine-5-boronic acid pinacol ester
Purity: 95%
QY-2409 5-Chloro-3-methoxypyridine-2-carbaldehyde
Purity: 95%
OT-5700 1-(Chloromethyl)-1-methanesulfonylcyclopropane
Purity: 95%
PY-7179 N-(3-Chloro-6-methylpyridin-2-yl)acetamide
Purity: 95%
BC-1731 [4-Chloro-2-(methylsulfanyl)pyrimidin-5-yl]boronic acid
Purity: 96%
OT-5448 4-(Chloromethyl)-1$l^{6}-thiane-1,1-dione
Purity: 96%
QD-4682 (4-Chlorophenyl)hydrazine hydrochloride hydrate
Purity: 95%
BB-3398 4-(3-Chloropropyl)phenylboronic acid
Purity: 98%
OT-5526 N'-(3-Chloropyrazin-2-yl)acetohydrazide
Purity: 96%
PN-1449 2-[5-Chloro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid
Purity: 95%
PC-1754 2-Chloro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
OT-5933 {[2-Chloro-3-(trifluoromethyl)phenyl]methyl}(2,2-diphenylethyl)amine
Purity: 95%
SH-7797 cis-1,3-dibenzyl 4-methyl pyrrolidine-1,3,4-tricarboxylate
Purity: 96%
OT-6055 cis-hexahydro-1H-pyrrolo[3,2-b]pyrrol-2-one
Purity: 95%
SH-7800 cis-tert-Butyl 3-(((benzyloxy)carbonyl)amino)-4-(hydroxymethyl)pyrrolidine-1-carboxylate
Purity: 95%
QF-9370 Citicoline sodium salt hydrate
Purity: 97%
HC-4559 [4-(1-Cyanocyclopropyl)-2-fluorophenyl]boronic acid
Purity: 96%
BB-0462 [4-(1-Cyanocyclopropyl)-2-methylphenyl]boronic acid
Purity: 96%
OT-4974 (3-Cyano-2,6-difluorophenyl)boronic acid
Purity: 96%
BB-0392 {2-[Cyano(dimethylamino)methyl]phenyl}boronic acid
Purity: 95%
BB-0316 (2-Cyano-3-ethoxyphenyl)boronic acid
Purity: 95%
BC-1874 (3-Cyano-2-fluoro-4-methylphenyl)boronic acid
Purity: 95%
AN-6459 N-(2-Cyano-5-fluorophenyl)acetamide
Purity: 97%
FB-2663 4-Cyano-2-hydroxyphenylboronic acid
Purity: 95%
BB-0484 [2-Cyano-3-(piperidin-1-yl)phenyl]boronic acid
Purity: 95%
BC-1407 (2-Cyclobutylpyrazol-3-yl)boronic acid
Purity: 95%
PC-1407 1-Cyclobutyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole
Purity: 95%
PN-1120 N-Cyclohexyl-n-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 95%
PN-1684 N-Cyclohexyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide
Purity: 95%
PN-0992 N-Cyclopentyl-5-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 96%
BC-1813 {4-[Cyclopropyl(methyl)sulfamoyl]-2-fluorophenyl}boronic acid
Purity: 96%
PC-1217 N-Cyclopropyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide
Purity: 97%
PN-5942 4-Cyclopropylthiophenylboronic acid pinacol ester
Purity: 95%
SH-7810 2,4-Diamino-5-nitrobenzamide
Purity: 95%
OT-5822 2,4-Diamino-5-nitrobenzonitrile
Purity: 96%
OT-5851 2,5-Dibromo-4-iodoaniline
Purity: 95%
CS-9147 1,1'-(2,5-Dibromo-1,4-phenylene)bis(2,5,8,11,14-pentaoxapentadecane)
Purity: 95%
HI-1917 4,5-Dibromo-2H-pyrazol-3-amine
Purity: 95%
OT-5831 3,5-Dichloro-2-hydroxy-6-methoxybenzoic acid
Purity: 95%
BC-1647 [2,3-Dichloro-4-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
OT-5359 2,6-Dichloro-5-methoxypyridine-3-carbaldehyde
Purity: 90%
FA-1746 2,5-Dichloro-4-methyl-benzeneboronic acid
Purity: 95%
OT-5835 5,6-Dichloropyridine-2-carboxamide
Purity: 95%
OT-6019 2-(Diethylamino)ethyl 4-nitro-2-propoxybenzoate
Purity: 95%
OT-4367 Diethyl 2-ethyl-2-(hydroxymethyl)malonate
Purity: 98%
HD-7800 N,N-Diethyl-2-methyl-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzenesulfonamide
Purity: 98%
PN-3809 2-(2,3-difluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
TB-9131 [Difluoro(2-methylindazol-6-yl)-$l^{5}-boranylidene]-$l^{2}-fluorane potassium
Purity: 96%
BC-1177 2,5-Difluoro-3-methylphenylboronic acid
Purity: 98%
SH-7814 2,4-Difluoro-5-nitrobenzamide
Purity: 98%
FF-6428 2-(2,5-Difluoro-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%