New & Rare (No CAS)


Catalog # Compound Name Structure
JC-9995 2-Amino-5-carbamimidamidopentanoic acid phosphoric acid
Purity: 95%
MFCD30749883
AN-6395 (3-Amino-5-chloro-4-fluorophenyl)boronic acid
Purity: 95%
MFCD32639326
PN-2891 2-(1-Aminoethyl)phenylboronic acid pinacol ester
Purity: 96%
MFCD18733496
QM-5271 (S)-2-Amino-3-(1h-imidazol-5-yl)propan-1-ol hydrochloride
Purity: 98%
MFCD22495231
OR-9325 (S)-2-(Aminomethyl)-1-ethylpyrrolidine hydrochloride
Purity: 97%
MFCD09991568
OT-8579 (3S)-3-Amino-4-phenylbutan-1-ol
Purity: 95%
HC-4568 [4-(3-Aminopropyl)phenyl]boronic acid hydrochloride
Purity: 98%
MFCD32639384
PN-1155 3-(3-Amino-1H-pyraol-5-yl)phenylboronic acid pinacol ester
Purity: 95%
MFCD27936123
QG-5865 5-Aminopyridine-2-carboxamidoxime
Purity: 95%
MFCD20265317
QC-0158 4-Aminopyridine-2-carboxylic acid hydrochloride hydrate
Purity: 97%
MFCD26523293
PN-0921 2-Amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 95%
MFCD24040045
PN-1136 5-Amino-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Purity: 95%
MFCD24039650
PN-1430 2-Amino-3-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid
Purity: 95%
MFCD27936323
PN-0929 4-Amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzonitrile
Purity: 98%
MFCD27936042
JP-6427 D,L-Anatabine tartrate
Purity: 98%
MFCD12546976
QN-5496 Aneurine hydrochloride hydrate
Purity: 98%
MFCD32644694
OT-8328 {[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-(bromomethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}(tert-butyl)dimethylsilane
Purity: 95%
JP-0497 (3R,3As,6r,7r,8as)-3-methoxy-3,6,8,8-tetramethyloctahydro-1h-3a,7-methanoazulene
Purity: 96%
MFCD29916858
QH-3272 Benzothiophene-2-boronic acid mida ester
Purity: 95%
MFCD20527199
SS-1876 1-Benzyl-4-(benzyloxy)pyrrolidine-2-carboxylic acid hydrochloride
Purity: 95%
MFCD09910440
OT-8558 Benzyl N-{3-[(2-bromopyridin-4-yl)amino]propyl}carbamate
Purity: 96%
OT-8548 Benzyl N-[(cyclohexylcarbamoyl)methyl]-N-methylcarbamate
Purity: 95%
OT-8408 Benzyl 2-methoxy-1,3-oxazolidine-3-carboxylate
Purity: 95%
PC-1832 Benzyl N-[6-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl]carbamate
Purity: 96%
MFCD33552154
JN-3139 2-(2-(Benzyloxy)-3-bromo-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 97%
MFCD32707225
BC-2001 [3-(Benzyloxy)-4-carbamoylphenyl]boronic acid
Purity: 95%
BC-1832 (5-{[(Benzyloxy)carbonyl]amino}-2-methylpyridin-3-yl)boronic acid
Purity: 96%
MFCD33552064
BC-1906 [4-(Benzyloxy)-3-chloro-2-fluorophenyl]boronic acid
Purity: 98%
MFCD34619593
BC-2012 [2-(Benzyloxy)-3-chloro-4-methoxyphenyl]boronic acid
Purity: 98%
MFCD34788244
PN-0899 2-[5-(Benzyloxy)-2-chloro-4-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD27936015
PN-4910 2-[3-(Benzyloxy)-2-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD34184907
OT-8617 2-(Benzyloxy)-N,N-dimethylpropanamide
Purity: 96%
BB-0035 [2-(Benzyloxy)ethyl]boronic acid
Purity: 98%
MFCD27935497
OT-8232 5-[2-(Benzyloxy)ethyl]-1H-pyrazol-3-amine
Purity: 96%
MFCD35200463
BC-1838 [3-(Benzyloxy)-5-fluoro-4-methylphenyl]boronic acid
Purity: 95%
MFCD33552065
BC-1789 [3-(Benzyloxy)-5-formylphenyl]boronic acid
Purity: 95%
MFCD22399090
BC-1860 [2-(Benzyloxy)-5-isopropylphenyl]boronic acid
Purity: 97%
MFCD34598062
BC-1943 3-(Benzyloxy)-4-methanesulfonylphenylboronic acid
Purity: 98%
BC-1942 [3-(Benzyloxy)-4-(methylsulfanyl)phenyl]boronic acid
Purity: 96%
MFCD34619598
HE-9700 3-(Benzyloxy)-1-naphthaleneboronic acid
Purity: 96%
MFCD32068440
OT-4272 N-(Benzyloxy)-N-[(2-nitrobenzene)sulfonyl](2-nitrobenzene)sulfonamide
Purity: 98%
MFCD30527663
PC-1886 2-[2-(Benzyloxy)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
MFCD34598341
BC-1791 [4-(benzyloxy)-3-tert-butylphenyl]boronic acid
Purity: 98%
MFCD33552061
PN-1080 2-(Benzyloxy)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Purity: 98%
MFCD24039731
PC-1920 Benzyl N-{1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl}carbamate
Purity: 98%
PC-2029 Benzyl 4-{[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}piperazine-1-carboxylate
Purity: 98%
PN-4675 Benzyl 2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate
Purity: 95%
MFCD31613738
OT-4312 (3beta)-28-Iodoolean-12-en-3-ol
Purity: 95%
MFCD30834402
QN-8292 Beta-nicotinamide adenine dinucleotide hydrate
Purity: 95%
MFCD00150377
OT-4311 (3beta)-Olean-12-en-3,28-diol di-tosylate
Purity: 95%
MFCD30834401
QC-9812 Bilirubin conjugate
Purity: 95%
MFCD08669555
QW-3480 (2R,3R)-2,3-Bis(benzoyloxy)butanedioic acid, (4s)-4-(3-bromophenyl)-6,8-dichloro-2-methyl-1,2,3,4-tetrahydroisoquinoline
Purity: 95%
MFCD30738067
BC-2039 [3,4-Bis(benzyloxy)phenyl]boronic acid
Purity: 96%
PC-2039 2-[3,4-bis(benzyloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
BC-1279 Bis(4-cyano-3,5-difluorophenyl)borinic acid
Purity: 95%
MFCD29764377
BC-1073 Bis(4-cyclopropylphenyl)borinic acid
Purity: 95%
MFCD28385200
BC-1603 Bis(3-cyclopropylphenyl)boronic acid
Purity: 95%
MFCD32065675
BB-5469 [2,6-Bis(methoxycarbonyl)pyridin-4-yl]boronic acid
Purity: 98%
MFCD22545909
BB-4906 Bis(4-methoxynaphthalen-1-yl)borinic acid
Purity: 97%
MFCD28101634
PC-1777 3,5-Bis(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine
Purity: 95%
MFCD32900074
OT-8426 ({[3,5-bis(Trifluoromethyl)phenyl]methyl}sulfanyl)methanimidamide hydrochloride
Purity: 95%
BC-1778 (4-Boc-amino-2-chloro-5-methoxy)phenylboronic acid
Purity: 95%
MFCD32899959
PC-1336 2-[1-(N-Boc-Amino)ethyl]phenylboronic acid pinacol ester
Purity: 96%
MFCD30182414
SS-1420 Boc-4-(z-amino)-d-phenylalanine dicyclohexylammonium salt
Purity: 98%
MFCD02092967
WA-6101 (N-Boc-8-azabicyclo[3.2.1]oct-3-yl)methylboronic acid
Purity: 97%
MFCD26936356
PC-1356 1-BOC-2-Carbonylpyrrolidine-4-boronic acid pinacol ester
Purity: 95%
MFCD30489022
QD-2984 1-Boc-3-formyl-6-indoleboronic acid pinacol ester
Purity: 98%
MFCD18915046
QD-8288 4-(4-Boc-homopiperazin-1-ylsulfonyl)phenylboronic acid pinacol ester
Purity: 98%
MFCD18915054
HA-2843 Boc-l-met(o)-o-ch2-f-ch2-cooh dcha
Purity: 95%
MFCD30749174
SS-3957 (S)-3-(1-Boc-pyrrolidin-2-yl)-propionic acid dcha
Purity: 95%
MFCD09952616
HA-4913 Boc-l-thr(bzl)-o-ch2-f-ch2-cooh dcha
Purity: 98%
MFCD30749176
QD-7322 1-Boc-2-trimethylsilylindole-4-boronic acid pinacol ester
Purity: 98%
MFCD19982313
OT-8500 1-Bromo-2-(bromomethyl)-5-fluoro-4-methoxybenzene
Purity: 95%
QD-8045 2-Bromo-5-chloro-3-fluoro-4-pyridineboronic acid pinacol ester
Purity: 98%
MFCD18915053
OT-8495 1-Bromo-4-chloro-2-methoxy-3-nitrobenzene
Purity: 96%
BC-1765 (3-Bromo-4-chloro-5-methoxyphenyl)boronic acid
Purity: 98%
MFCD33552058
PC-1765 2-(3-Bromo-4-chloro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD34598336
BC-1896 (3-Bromo-2-chloro-5-nitrophenyl)boronic acid
Purity: 96%
MFCD34598072
PC-1896 2-(3-Bromo-2-chloro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD34598342
BB-7000 (5-Bromo-4-cyano-2-fluorophenyl)boronic acid
Purity: 98%
MFCD20486730
BC-2007 (4-Bromo-2,3-difluoro-6-methylphenyl)boronic acid
Purity: 98%
MFCD34788242
BC-2006 4-Bromo-2,3-difluoro-5-methylphenylboronic acid
Purity: 98%
OT-8537 4-Bromo-2,5-difluoro-3-nitrobenzoic acid
Purity: 96%
BC-1151 (3-Bromo-2,5-difluorophenyl)boronic acid
Purity: 97%
MFCD31613609
BC-1631 (3-Bromo-5-ethylphenyl)boronic acid
Purity: 98%
MFCD32631791
BC-2008 (6-Bromo-5-fluoro-1H-indol-4-yl)boronic acid
Purity: 95%
MFCD34788243
BC-1526 4-Bromo-2-fluoro-5-(methoxycarbonyl)phenylboronic acid
Purity: 98%
MFCD31653722
OT-8604 2-Bromo-1-fluoro-5-methoxy-3-nitro-4-[4-(trifluoromethoxy)phenyl]benzene
Purity: 95%
JN-3560 (3-Bromo-2-fluoro-4-methoxyphenyl)boronic acid
Purity: 98%
MFCD32632054
JN-3563 2-(2-Bromo-6-fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 97%
MFCD32632234
OT-8475 1-Bromo-2-fluoro-4-methoxy-5-[4-(trifluoromethoxy)phenyl]benzene
Purity: 95%
JN-4117 4-Bromo-3-fluoro-2-methylphenylboronic acid
Purity: 98%
MFCD31805784
JN-9671 2-(5-Bromo-2-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 97%
MFCD28141745
BC-1689 [3-Bromo-2-fluoro-6-(4-methylpiperazin-1-yl)pyridin-4-yl]boronic acid
Purity: 95%
MFCD32639410
BC-1685 (3-Bromo-2-fluoro-6-morpholinopyridin-4-yl)boronic acid
Purity: 95%
MFCD32639378
QK-1110 (2-Bromo-5-fluoropyridin-3-yl)boronic acid
Purity: 95%
MFCD18910900
PN-5997 2-bromo-3-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 98%
MFCD18915056
BC-1966 [4-Bromo-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid
Purity: 98%
MFCD33404164
BC-1955 [5-Bromo-2-fluoro-4-(trifluoromethyl)phenyl]boronic acid
Purity: 98%
MFCD33404122
OT-8520 1-Bromo-3-iodo-2,4-dimethylbenzene
Purity: 98%
OT-8452 6-Bromo-3-methoxy-N-methyl-2-nitroaniline
Purity: 95%
PC-1817 2-(4-Bromo-3-methoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD33552152
OT-8440 4-(Bromomethyl)-2-methylphthalazin-1-one
Purity: 95%
FF-7076 2-(3-Bromo-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD17215813
PC-1666 5-Bromo-6-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Purity: 98%
MFCD32696895
PC-2024 2-Bromo-3-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Purity: 98%
MFCD35200476
QD-3178 2-Bromo-5-(4-morpholino)phenylboronic acid pinacol ester
Purity: 98%
MFCD20327967
OT-8523 {3-Bromopyrazolo[1,5-a]pyrimidin-6-yl}methanol
Purity: 95%
HI-1931 N-(5-Bromo-2H-pyrazol-3-yl)acetamide
Purity: 98%
MFCD23699503
BC-1705 (6-Bromoquinolin-3-yl)boronic acid
Purity: 95%
MFCD32641095
BC-1999 {4-Bromo-1-[(tert-butoxy)carbonyl]-5-fluoroindol-2-yl}boronic acid
Purity: 96%
MFCD34788241
BC-1893 {3-Bromo-5-[(tert-butyldimethylsilyl)oxy]phenyl}boronic acid
Purity: 98%
MFCD34598071
PC-1743 6-Bromo-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-2-benzofuran-1-one
Purity: 98%
MFCD33552137
PC-1866 4-Bromo-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one
Purity: 96%
MFCD34184906
PC-1766 5-Bromo-N-[2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanamide
Purity: 96%
MFCD32900072
PC-1658 2-Bromo-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
MFCD32900070
FF-8110 5-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-pyrrolo[2,3-b]pyridine
Purity: 96%
MFCD16995998
OS-7991 4-Bromo-5-(tributylstannyl)-1,3-thiazole
Purity: 97%
MFCD28515395
JF-7977 Butan-2-ylhydrazine dihydrate hydrochloride
Purity: 95%
MFCD28118261
BB-6774 4-Butoxy-3-(trifluoromethyl)phenylboronic acid
Purity: 98%
MFCD20441831
SS-7442 Bzl,me-d-val-ome hydrochloride
Purity: 98%
MFCD04975439
QF-6896 Calcium alpha-d-isosaccharinate
Purity: 98%
MFCD04039767
HA-3991 Calcium phosphate tribasic
Purity: 98%
MFCD00867081
QG-9294 3-Carbamoyl-2-fluorobenzeneboronic acid pinacol ester
Purity: 96%
MFCD18730401
PN-1518 2-Carboxy-3-chlorophenylboronic acid pinacol ester
Purity: 95%
MFCD22044811
OT-8362 4-(2-Carboxyethyl)-6-methylpyridine-3-carboxylic acid
Purity: 96%
JN-6176 4-Carboxy-2-fluorophenylboronic acid ethylene glycol ester
Purity: 95%
MFCD28976882
PN-2962 6-Carboxyindole-3-boronic acid pinacol ester
Purity: 95%
MFCD27936776
QC-7663 5'-Cdp 3na salt hydrate
Purity: 97%
MFCD15042181
BB-0302 [2-Chloro-4-(cyanomethyl)phenyl]boronic acid
Purity: 98%
MFCD27935536
PC-1910 2-[5-Chloro-2,3-difluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
MFCD34619781
BC-2010 3-Chloro-4-(dihydroxyboranyl)-2-fluorobenzoic acid
Purity: 98%
MFCD34828458
BC-1974 3-Chloro-5-(dihydroxyboranyl)-4-methoxybenzoic acid
Purity: 98%
MFCD34775262
JN-1496 2-Chloro-5-(1,3-dioxolan-2yl)phenylboronic acid
Purity: 97%
MFCD31619407
JN-7981 (6-Chloro-3-ethoxy-2-fluorophenyl)boronic acid
Purity: 96%
MFCD32902742
BB-0570 [2-Chloro-4-(4-ethylpiperazin-1-yl)phenyl]boronic acid
Purity: 96%
MFCD27935745
BC-1972 (3-Chloro-2-fluoro-5-formylphenyl)boronic acid
Purity: 95%
MFCD34564528
BC-1964 (3-Chloro-2-fluoro-6-formylphenyl)boronic acid
Purity: 98%
MFCD34760447
BC-1905 (3-Chloro-2-fluoro-4-hydroxyphenyl)boronic acid
Purity: 95%
MFCD34619592
BC-1965 (2-Chloro-6-fluoro-4-methylphenyl)boronic acid
Purity: 97%
MFCD23712894
PN-4629 2-Chloro-6-fluoro-3-nitrophenylboronic acid pinacol ester
Purity: 95%
MFCD34564930
PC-1879 4-Chloro-3-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
Purity: 95%
MFCD34598339
PC-1847 2-[5-Chloro-2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 98%
MFCD33552156
BC-1890 (6-Chloro-5-formylpyridin-3-yl)boronic acid
Purity: 95%
MFCD34598068
BC-1844 (5-Chloro-2-hydroxy-4-methylphenyl)boronic acid
Purity: 95%
MFCD31697530
WA-4550 3-Chloro-1h-indazole-5-boronic acid
Purity: 95%
MFCD22684710
PN-4780 2-Chloro-6-isopropoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Purity: 95%
FF-7765 5-Chloro-4-methoxycarbonyl-2-fluorophenylboronic acid pinacol ester
Purity: 98%
MFCD16996259
YC-1783 [2-chloro-3-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
MFCD27578493
FB-6366 (4-Chloro-2-methoxy-6-methylphenyl)boronic acid
Purity: 98%
MFCD33552070
PN-3458 2-(2-Chloro-5-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 95%
MFCD34619794
PC-1872 2-(2-Chloro-6-methoxy-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
MFCD34598337
BC-1716 {2-chloro-3-[(4-methoxyphenyl)methoxy]phenyl}boronic acid
Purity: 98%
MFCD32696798
QZ-8255 N-(3-Chloro-4-methoxyphenyl)-n-(methylsulfonyl)alanine
Purity: 95%
MFCD28143071
FB-1768 4-Chloro-2-methoxypyridine-5-boronic acid
Purity: 95%
MFCD18257743
PN-5190 2-Chloro-4-methoxypyridine-5-boronic acid pinacol ester
Purity: 95%
MFCD18779779
PN-0908 5-Chloro-2-methoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Purity: 98%
MFCD27936024
PN-1567 2-Chloro-3-methoxy-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Purity: 96%
MFCD24039775
FB-1783 4-Chloro-2-methylpyridine-5-boronic acid
Purity: 95%
MFCD18258028
BC-1731 [4-Chloro-2-(methylsulfanyl)pyrimidin-5-yl]boronic acid
Purity: 96%
MFCD32696800
PC-1961 2-Chloro-6-nitro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate
Purity: 96%
OT-8463 N-[2-(4-Chlorophenyl)ethyl]-2,4-dinitroaniline
Purity: 98%
BB-3398 4-(3-Chloropropyl)phenylboronic acid
Purity: 97%
MFCD28808818
OT-8321 [4-(4-Chloropyrazol-1-yl)phenyl]methanesulfonyl chloride
Purity: 95%
PN-1449 2-[5-Chloro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid
Purity: 98%
MFCD24039779
PC-1754 2-Chloro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
MFCD33552138
QB-5230 Cis-3-BOC-6-Aminomethyl-3-azabicyclo[3.1.0]hexane
Purity: 95%
MFCD16294637
OT-8470 cis-Hexahydropyrrolo[3,4-c]pyrrole-1,3-dione
Purity: 95%
QF-9370 Citicoline sodium salt hydrate
Purity: 97%
MFCD10567436
OT-6670 3-Cyano-N-[(3-cyanobenzene)sulfonyl]-N-phenylbenzenesulfonamide
Purity: 95%
HC-4559 [4-(1-Cyanocyclopropyl)-2-fluorophenyl]boronic acid
Purity: 96%
MFCD32639381
BB-0462 [4-(1-Cyanocyclopropyl)-2-methylphenyl]boronic acid
Purity: 96%
MFCD27935658
BB-0392 {2-[Cyano(dimethylamino)methyl]phenyl}boronic acid
Purity: 98%
MFCD27935610
BB-0316 (2-Cyano-3-ethoxyphenyl)boronic acid
Purity: 96%
MFCD27935545
BC-1874 (3-Cyano-2-fluoro-4-methylphenyl)boronic acid
Purity: 95%
MFCD34598064
HA-9395 3-(Cyanomethyl)-4-fluorobenzeneboronic acid
Purity: 98%
MFCD30746955
BB-0484 [2-Cyano-3-(piperidin-1-yl)phenyl]boronic acid
Purity: 95%
MFCD27935679
OT-8491 1-(Cyclohexyloxy)-2-fluorobenzene
Purity: 96%
FB-6090 (2-Cyclohexylpyrazol-3-yl)boronic acid
Purity: 95%
PN-1684 N-Cyclohexyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide
Purity: 96%
MFCD27936474
PN-0992 N-Cyclopentyl-5-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Purity: 96%
MFCD24039546
BC-1813 {4-[Cyclopropyl(methyl)sulfamoyl]-2-fluorophenyl}boronic acid
Purity: 96%
MFCD32899961
PC-1986 N-Cyclopropyl-1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide
Purity: 98%
MFCD34788344
PC-1217 N-Cyclopropyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide
Purity: 97%
MFCD29043344
PN-5942 4-Cyclopropylthiophenylboronic acid pinacol ester
Purity: 95%
MFCD22383767
HA-7921 3,5-Diaminobenzoic acid dihydrochloride hemihydrate
Purity: 95%
MFCD00150109
QN-1703 L-2,4-Diaminobutyric acid 2hbr
Purity: 95%
MFCD27997531
JN-3630 (3,4-Dibromo-2-fluorophenyl)boronic acid
Purity: 97%
MFCD28784943
PC-1222 2-(4,7-Dibromo-3-methoxynaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Purity: 96%
MFCD34563938
HI-1917 4,5-Dibromo-2H-pyrazol-3-amine
Purity: 95%
MFCD20528308
OT-8598 4-[(2,6-Dichlorobenzene)amido]-1H-pyrazole-3-carboxylic acid
Purity: 95%
QV-4058 5,6-Dichlorobenzo[d]thiazol-2-amine compound with 6,7-dichlorobenzo[d]thiazol-2-amine (1:1)
Purity: 98%
MFCD28657152
BB-4586 3,5-Dichloro-2,4-difluorophenylboronic acid
Purity: 98%
MFCD31653707
BC-1889 [2,6-Dichloro-4-(dimethoxymethyl)pyridin-3-yl]boronic acid
Purity: 96%
MFCD34598067
BC-1647 [2,3-Dichloro-4-(methoxycarbonyl)phenyl]boronic acid
Purity: 98%
MFCD32899958
QZ-4425 N-(3,5-Dichlorophenyl)-n-(methylsulfonyl)alanine
Purity: 95%
MFCD13875713
PC-1924 2,4-Dichloro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-b]pyridine
Purity: 95%
MFCD34619785
BB-0425 {2-[(Diethylamino)methyl]-3-fluorophenyl}boronic acid
Purity: 96%
MFCD27935632
HD-7800 N,N-Diethyl-2-methyl-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzenesulfonamide
Purity: 98%
MFCD31654539
PC-1987 N,N-Diethyl-1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide
Purity: 98%
MFCD34788345