Carboxes


Catalog # Compound Name Structure
ST-6065 6-Fluoro-quinoline-3-carboxylic acid ethyl ester
Purity: 95%
[71083-14-2],  MFCD14704942
QY-5932 2-Fluoro-7,8,9,10-tetrahydro-6h-cyclohepta[b]quinoline-11-carboxylic acid
Purity: 95%
[1555-11-9],  MFCD01313262
QN-2357 6-Fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
Purity: 95%
[1260641-86-8],  MFCD04114844
QB-7635 7-Fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
Purity: 95%
[1260641-74-4],  MFCD06739172
QW-0537 6-Fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid hydrochloride
Purity: 95%
[1260637-74-8],  MFCD07371492
QJ-7888 4-Fluorotetrahydro-2h-pyran-4-carboxylic acid
Purity: 95%
[1150617-62-1],  MFCD12024536
QV-2546 4-Fluorothiophene-2-carboxylic acid
Purity: 96%
[32431-72-4],  MFCD10566738
QA-1730 5-Fluoro-2-thiophenecarboxylic acid
Purity: 95%
[4377-58-6],  MFCD07787557
QH-6346 5-Fluoro-3-thiophenecarboxylic acid
Purity: 95%
[32415-50-2],  MFCD03426913
YA-8716 2-Fluoro-5-(thiophen-2-yl)benzoic acid
Purity: 98%
[926205-45-0],  MFCD09042506
YA-8747 2-Fluoro-5-(thiophen-3-yl)benzoic acid
Purity: 95%
[1261993-00-3],  MFCD18318887
YC-2557 2-Fluoro-3'-(trifluoromethoxy)biphenyl-4-carboxylic acid methyl ester
Purity: 95%
[1261616-51-6],  MFCD18408087
YC-2015 4-Fluoro-2'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261743-98-9],  MFCD18408097
YC-2263 4-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261506-18-6],  MFCD18408099
YC-1701 4-Fluoro-4'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261744-05-1],  MFCD18408101
YC-2213 5-Fluoro-2'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261832-95-4],  MFCD18408103
YC-2238 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261663-45-9],  MFCD18408105
YB-2746 2-Fluoro-4-(4-trifluoromethoxyphenyl)benzoic acid
Purity: 97%
[1178720-03-0],  MFCD18322438
LD-0053 3-fluoro-4-[2-(trifluoromethoxy)phenyl]benzoic acid
Purity: 95%
[1261591-90-5],  MFCD18405943
YB-2714 3-Fluoro-4-(3-trifluoromethoxyphenyl)benzoic acid
Purity: 97%
[1261524-83-7],  MFCD18322406
LD-0050 3-Fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid
Purity: 97%
[1261740-57-1],  MFCD18405947
YB-2713 4-Fluoro-3-(3-trifluoromethoxyphenyl)benzoic acid
Purity: 96%
[1261831-44-0],  MFCD18322405
OR-3376 4-Fluoro-3-(trifluoromethyl)benzoic acid
Purity: 98%
[67515-55-3],  MFCD00061294
YC-2215 2-Fluoro-3'-(trifluoromethyl)biphenyl-4-carboxylic acid methyl ester
Purity: 95%
[1261872-12-1],  MFCD18425038
YC-2216 2-Fluoro-4'-(trifluoromethyl)biphenyl-4-carboxylic acid methyl ester
Purity: 95%
[1261480-17-4],  MFCD18425040
YC-2404 3-Fluoro-3'-(trifluoromethyl)biphenyl-4-carboxylic acid methyl ester
Purity: 95%
[1261806-59-0],  MFCD18425044
YC-2335 3-Fluoro-4'-(trifluoromethyl)biphenyl-4-carboxylic acid methyl ester
Purity: 95%
[1261633-89-9],  MFCD18425046
YC-2083 4-Fluoro-2'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261788-37-7],  MFCD18425048
YC-1958 4-Fluoro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261872-15-4],  MFCD18425050
YC-1986 4-Fluoro-4'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261585-16-3],  MFCD18425052
YC-2190 5-Fluoro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261633-95-7],  MFCD18425056
YC-2165 5-Fluoro-4'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261788-40-2],  MFCD18425058
YC-2314 6-Fluoro-3'-(trifluoromethyl)biphenyl-3-carboxylic acid methyl ester
Purity: 95%
[1261549-13-6],  MFCD18425062
QY-0611 5-[2-Fluoro-5-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid
Purity: 95%
[1255146-91-8],  MFCD15731801
YA-1364 3-(4-Fluoro-3-trifluoromethylphenyl)benzoic acid
Purity: 96%
[942475-06-1],  MFCD08457047
YB-2031 4-Fluoro-3-(3-trifluoromethylphenyl)benzoic acid
Purity: 95%
[1261593-39-8],  MFCD18321760
HA-5787 1-(2-Fluoro-4-(trifluoromethyl)phenyl)cyclopropanecarboxylic acid
Purity: 95%
[1274902-10-1],  MFCD19693145
QK-3189 6-Fluoro-2-(trifluoromethyl)quinoline-4-carboxylic acid
Purity: 95%
[31009-06-0],  MFCD20925457
QC-9605 6-Fluoro-4-(trifluoromethyl)quinoline-2-carboxylic acid
Purity: 95%
[596845-42-0],  MFCD11046315
QB-1890 Fmoc-ABG-OH HCl
Purity: 95%
[908117-93-1],  MFCD09752870
QV-4486 Fmoc-adma(pbf)-oh
Purity: 95%
[1185841-84-2],  MFCD08064313
QJ-5543 Fmoc aeg-o-ally hcl
Purity: 95%
[861114-47-8],  MFCD28404628
QW-5627 Fmoc-d-agb(boc)2-oh
Purity: 95%
[1263047-29-5],  MFCD13184917
QV-9405 Fmoc-l-agb(boc)2-oh
Purity: 95%
[206183-06-4],  MFCD01632267
QW-1709 Fmoc-d-agb(pbf,boc)-oh
Purity: 95%
MFCD13184918
QW-4702 Fmoc-l-agb(pbf,boc)-oh
Purity: 95%
MFCD13184919
QV-9736 Fmoc-d-agp(boc)2-oh
Purity: 95%
[1263045-67-5],  MFCD13184922
QV-2257 Fmoc-d-agp(pbf,boc)-oh
Purity: 95%
MFCD13184923
QV-7898 Fmoc-l-agp(pbf,boc)-oh
Purity: 95%
MFCD13184916
QV-0951 Fmoc-d-aha-oh
Purity: 95%
[1263047-53-5],  MFCD13184927
QC-7980 Fmoc-D-Ala(3-CN)-OH
Purity: 96%
[1820575-73-2],  MFCD01861377
QF-2712 Fmoc-ala-oh h2o
Purity: 95%
[207291-76-7],  MFCD00150487
QN-5680 Fmoc-d-ala-oh h2o
Purity: 98%
[79990-15-1],  MFCD00180722
QD-6178 Fmoc-Ala-OMe
Purity: 97%
[146346-88-5],  MFCD20264827
QA-4215 Fmoc-ala-opfp
Purity: 95%
[86060-86-8],  MFCD00065612
QC-6414 Fmoc-n-(allyl)-glycine
Purity: 95%
[222725-35-1],  MFCD17976766
QB-0729 Fmoc-s-allyloxy-amidomethyl-d-cysteine
Purity: 95%
[232953-09-2],  MFCD00273447
QJ-9959 Fmoc-O-allyl-L-m-tyrosine
Purity: 97%
[1175973-95-1],  MFCD08061623
QE-8911 Fmoc-alpha-allyl-d-ala
Purity: 95%
[288617-76-5],  MFCD08063323
HA-7471 Fmoc-alpha-me-l-cys(trt)-oh
Purity: 95%
[725728-43-8],  MFCD30749166
QB-8784 Fmoc-alpha-me-leu-oh
Purity: 95%
[312624-65-0],  MFCD08458572
QB-9579 Fmoc-alpha-methyl-d-allylglycine
Purity: 95%
[1217751-94-4],  MFCD12198193
QB-9483 Fmoc-amchec-oh
Purity: 95%
[1263047-06-8],  MFCD04973172
OR-5792 Fmoc-1-amino-1-cycloheptanecarboxylic acid
Purity: 95%
[188751-56-6],  MFCD03426229
QC-5005 (1R,2R)-Fmoc-2-aminocyclohexane carboxylic acid
Purity: 97%
[389057-34-5],  MFCD05663770
OT-4615 Fmoc-3-aminocyclohexane-1-carboxylic acid
Purity: 95%
[194471-84-6],  MFCD02258441
OR-5793 Fmoc-1-amino-1-cyclooctanecarboxylic acid
Purity: 95%
[222166-38-3],  MFCD03426230
QB-3527 (-)-(1S,4R)-N-Fmoc-4-aminocyclopent-2-enecarboxylic acid
Purity: 95%
[220497-64-3],  MFCD01311755
QW-6469 (2S,4R)-Fmoc-4-aminomethyl-1-boc-pyrrolidine-2-carboxylic acid
Purity: 95%
[2173052-84-9],  MFCD30749164
QC-6696 Fmoc-(4-aminomethyl)-cyclohexane carboxylic acid
Purity: 95%
[188715-40-4],  MFCD01862347
QC-2826 Fmoc-1-aminomethyl-cyclohexane carboxylic acid
Purity: 95%
[220145-22-2],  MFCD09264208
QB-7986 Fmoc-d-9-anthrylalanine
Purity: 95%
[268733-63-7],  MFCD02094462
QB-1504 Fmoc-l-9-anthrylalanine
Purity: 95%
[268734-27-6],  MFCD00671381
QP-8897 Fmoc-arg(aloc)2-oh
Purity: 95%
[148893-34-9],  MFCD00273443
QW-3706 Fmoc-arg(me)2-oh
Purity: 95%
[268564-10-9],  MFCD00672718
QB-1981 Fmoc-arg(me)2-oh (asymmetrical) hydrochloride
Purity: 95%
[1820570-64-6],  MFCD02684510
QH-7872 Fmoc-arg(me,pbf)-oh
Purity: 95%
[1135616-49-7],  MFCD08064312
QC-7822 Fmoc-l-arg(me)2(pbf)-oh
Purity: 95%
[1185841-84-2],  MFCD15141977
HA-6848 Fmoc-l-arg(pbf)-o-ch2-ph-och2-ch2-cooh
Purity: 95%
MFCD08457844
YC-2311 Fmoc-Arg(pbf)-OMe
Purity: 95%
[813452-47-0],  MFCD27578751
QE-6605 Fmoc-asn(ac3acnh-beta-glc)-oh
Purity: 95%
[131287-39-3],  MFCD00237079
QB-4459 Fmoc-asn-onp
Purity: 95%
[71989-17-8],  MFCD00063329
QH-3983 Fmoc-asn-opfp
Purity: 97%
[86060-99-3],  MFCD00065625
QM-5166 Fmoc-asn(trt)-opfp
Purity: 95%
[132388-64-8],  MFCD00153373
QE-2433 Fmoc-asn(trt)-ser(psi(me,me)pro)-oh
Purity: 95%
[920519-33-1],  MFCD10001368
QE-5102 Fmoc-asn(trt)-thr(psime,mepro)-oh
Purity: 95%
[957780-59-5],  MFCD08064322
QB-2493 Fmoc-asp(o-1-ad)-oh
Purity: 95%
[118534-81-9],  MFCD00077309
QV-3535 Fmoc-asp(edans)-oh
Purity: 95%
[182253-73-2],  MFCD02094140
QB-3778 Fmoc-Asp-NH2
Purity: 95%
[200335-40-6],  MFCD00151920
QB-9201 Fmoc-asp(ofm)-oh
Purity: 95%
[608512-85-2],  MFCD01631977
QN-4899 Fmoc-d-asp-ome
Purity: 95%
[368443-82-7],  MFCD09842078
HA-8105 Fmoc-d-asp(ompe)-oh
Purity: 95%
[1926162-97-1],  MFCD08458576
QE-7567 Fmoc-d-asp(opis)-oh
Purity: 95%
[214852-39-8],  MFCD01632049
HA-7525 Fmoc-l-asp(otbu)-o-ch2-ph-och2-ch2-cooh
Purity: 95%
MFCD08457845
QE-6466 Fmoc-asp(otbu)-ser(psime,mepro)-oh
Purity: 95%
[955048-92-7],  MFCD27957352
QE-0286 Fmoc-asp(otbu)-thr(psime,mepro)-oh
Purity: 95%
[920519-32-0],  MFCD18427721
QV-7189 Fmoc-d-aza-oh
Purity: 95%
[1016163-79-3],  MFCD18427301
QW-3690 Fmoc-n-(2-azidoethyl)glycine
Purity: 95%
[1935981-35-3],  MFCD30491715
QV-7601 Fmoc-6-azido-d-norleucine
Purity: 95%
[1198791-53-5],  MFCD18427293
QE-2399 (2S,4S)-1-Fmoc-4-azidopyrrolidine-2-carboxylic acid
Purity: 95%
[263847-08-1],  MFCD04115792
QM-5188 Fmoc-s-benzyl-d-cysteine
Purity: 95%
[252049-18-6],  MFCD02259496
QB-6905 Fmoc-o-(benzylphospho)-l-threonine
Purity: 95%
[175291-56-2],  MFCD00797870
QC-7999 (R)-Fmoc-3-benzyl-piperidine-3-carboxylic acid
Purity: 95%
[1354752-72-9],  MFCD26793614
QC-8619 (S)-Fmoc-3-benzyl-piperidine-3-carboxylic acid
Purity: 95%
[1354752-82-1],  MFCD26793615
QB-2152 Fmoc-(2s,4r)-4-benzyl-pyrrolidine-2-carboxylic acid
Purity: 95%
[1158891-05-4],  MFCD04115782
QE-1252 Fmoc-beta-ala-opfp
Purity: 95%
[149303-38-8],  MFCD00237655
QC-7925 Fmoc-beta-t-butyl-l-alanine
Purity: 97%
[139551-74-9],  MFCD00671389
QB-8891 Fmoc-beta-chloro-l-alanine
Purity: 95%
[212651-52-0],  MFCD00270534
QC-9166 Fmoc-beta-(2,2-dimethyl-4h-benzo[1,3]-dioxin-6-yl)-ala-oh
Purity: 95%
[252049-13-1],  MFCD02259491
QB-0713 Fmoc-beta-homoarg(pmc)-oh
Purity: 95%
[700377-76-0],  MFCD03788172
QB-0402 Fmoc-beta-homogln(trt)-oh
Purity: 95%
[401915-55-7],  MFCD03427580
QB-4140 Fmoc-L-beta-homophenylalanine
Purity: 96%
[193954-28-8],  MFCD01863055
QV-5156 Fmoc-d-beta-homovaline
Purity: 96%
[266318-79-0],  MFCD03095625
QB-1762 Fmoc-beta-(s)-4-methoxyphenylalanine
Purity: 95%
[501015-30-1],  MFCD03427976
QC-8715 Fmoc-d-beta-methylisoleucine
Purity: 95%
[1310680-40-0],  MFCD18782847
QC-8942 Fmoc-l-beta-methylisoleucine
Purity: 95%
[1227750-73-3],  MFCD18782848
QE-6259 Fmoc-beta-(2-quinolyl)-ala-oh
Purity: 95%
[214852-56-9],  MFCD01318745
QA-0620 N-Fmoc-3-(2-biphenylyl)-l-alanine
Purity: 95%
[1260592-50-4],  MFCD07372092
QB-1536 Fmoc-d-bpa-oh
Purity: 95%
[117666-97-4],  MFCD00237666
QB-4882 (2S,4R)-Fmoc-4-(4-bromobenzyl)-pyrrolidine-2-carboxylic acid
Purity: 95%
[959580-40-6],  MFCD06656467
QC-6617 Fmoc-4-(4-bromophenyl)-piperidine-4-carboxylic acid
Purity: 95%
[913542-81-1],  MFCD11226815
QE-7290 Fmoc-d-3-carbamoylphe
Purity: 95%
[1217637-40-5],  MFCD06659136
QE-6991 Fmoc-d-4-carbamoylphe
Purity: 95%
[1217610-39-3],  MFCD06659137
QB-0358 Fmoc-l-3-carbamoylphe
Purity: 97%
[959573-22-9],  MFCD06659144
QB-5039 (3S)-4-Fmoc-1-carboxymethyl-3-benzyl-piperazin-2-one
Purity: 95%
[959583-57-4],  MFCD06656483
QE-3188 (3S)-4-Fmoc-1-carboxymethyl-3-isobutyl-piperazin-2-one
Purity: 95%
[959581-81-8],  MFCD06656484
QB-4826 (3S)-4-Fmoc-1-carboxymethyl-3-methyl-piperazin-2-one
Purity: 95%
[959574-94-8],  MFCD06656485
QB-2914 (R)-Fmoc-3-carboxythiomorpholine
Purity: 95%
[959572-96-4],  MFCD06656463
ST-8914 Fmoc-l-cba-oh
Purity: 95%
[913253-24-4],  MFCD02092980
QC-9512 Fmoc-4-(4-chlorophenyl)-piperidine-4-carboxylic acid
Purity: 95%
[887129-04-6],  MFCD11226816
QC-3641 Fmoc-1,2-cis-achc-oh
Purity: 95%
[194471-85-7],  MFCD02682625
YC-0762 Fmoc-Cit-OMe
Purity: 96%
[1820581-58-5],  MFCD27578297
QB-8038 Fmoc-4-cyclohexyl-piperidine-4-carboxylic acid
Purity: 95%
[882847-21-4],  MFCD08457836
QC-3208 (2S,4R)-Fmoc-4-cyclohexyl-pyrrolidine-2-carboxylic acid
Purity: 95%
[1820571-03-6],  MFCD26793611
QB-3242 (2S,4S)-Fmoc-4-cyclohexyl-pyrrolidine-2-carboxylic acid
Purity: 95%
[467438-40-0],  MFCD06656481
SS-7208 Fmoc-L-cyclopropylglycine
Purity: 95%
[1212257-18-5],  MFCD06659145
QC-9814 Fmoc-l-cycpentala-oh
Purity: 98%
[371770-32-0],  MFCD03094886
QH-4817 Fmoc-cys(acm)-opfp
Purity: 97%
[86060-96-0],  MFCD00065632
QW-3112 Fmoc-cys(dpm)-oh
Purity: 95%
[247595-29-5],  MFCD02682541
QB-3002 Fmoc-cys(2-hydroxyethyl)-oh
Purity: 95%
[200354-35-4],  MFCD00672330
QB-6593 Fmoc-d-cys(mbzl)-oh
Purity: 95%
[200354-41-2],  MFCD00237013
QC-8808 Fmoc-d-cys(mmt)-oh
Purity: 95%
[1198791-73-9],  MFCD02094091
QM-5182 Fmoc-d-cys(mtt)-oh
Purity: 95%
[252206-29-4],  MFCD14155676
QB-8104 Fmoc-d-cys-oh h2o
Purity: 95%
[157355-80-1],  MFCD18253022
QW-4200 Fmoc-l-cys-oh h2o
Purity: 97%
[135248-89-4],  MFCD13184915
QB-8625 (Fmoc-cys-otbu)2 (disulfide bond)
Purity: 97%
[139592-37-3],  MFCD08458535
QV-1859 Fmoc-l-cys(palm)-oh
Purity: 95%
[824955-27-3],  MFCD02094405
QE-1216 Fmoc-cys((rs)-2,3-di(palmitoyloxy)-propyl)-oh
Purity: 95%
[210532-98-2],  MFCD00153354
QP-7545 Fmoc-cys(so3h)-oh disodium salt
Purity: 95%
[163558-30-3],  MFCD28134200
QV-7428 Fmoc-L-cysteic acid
Purity: 97%
[751470-47-0],  MFCD02682540
QM-5186 Fmoc-l-cysteic acid disodium salt
Purity: 95%
[320384-09-6],  MFCD02094396
QM-5192 Fmoc-d-cys(trt)-opfp
Purity: 95%
[200395-72-8],  MFCD00153375
QB-8738 Fmoc-dab(adpoc)-oh
Purity: 95%
[214750-73-9],  MFCD01632073
QB-9490 Fmoc-d-dab(aloc)-oh
Purity: 95%
[387824-78-4],  MFCD02094487
QB-7981 Fmoc-dab(dnp)-oh
Purity: 95%
[1263047-22-8],  MFCD01632074
QC-1548 Fmoc-d-dab(dnp)-oh
Purity: 95%
[1263047-25-1],  MFCD06796890
QE-7803 Fmoc-d-dab(fmoc)-oh
Purity: 95%
[1217645-10-7],  MFCD02094099
QC-6163 Fmoc-d-dab(mtt)-oh
Purity: 95%
[1217809-38-5],  MFCD02094100
QV-6363 Fmoc-l-dab(octanoyl)-oh
Purity: 95%
[1983858-56-5],  MFCD23380091
QV-2738 Fmoc-l-dab(palm)-oh
Purity: 95%
[1858224-29-9],  MFCD18427297
QD-3936 Fmoc-L-Dap(Boc)-OH. H2O
Purity: 95%
[1890186-47-6],  MFCD27977189
QB-5168 Fmoc-d-dap(fmoc)-oh
Purity: 95%
[1217631-22-5],  MFCD01632030
QB-0315 Fmoc-d-dap(mtt)-oh
Purity: 95%
[1263046-35-0],  MFCD06796892
QV-3779 Fmoc-l-dap(n3)-oh
Purity: 95%
[684270-46-0],  MFCD11052919
QV-4054 Fmoc-l-dap-otbu hcl
Purity: 95%
[2098497-06-2],  MFCD21363165
QV-5566 Fmoc-l-dap(palm)-oh
Purity: 95%
[724785-41-5],  MFCD18427296
QV-8399 Fmoc-l-dap(teoc)-oh
Purity: 95%
[1248587-10-1],  MFCD27952850
QV-8219 Fmoc-d-dbu(boc)-oh
Purity: 95%
[763102-80-3],  MFCD22666112
QV-1683 Fmoc-5,6-dehydrohomoleucine
Purity: 95%
[1369532-04-6],  MFCD30475879
QB-2556 Fmoc-3,4-dehydro-l-proline
Purity: 95%
[135837-63-7],  MFCD00151940
QB-5466 Fmoc-2,3-dehydroval-oh
Purity: 95%
[198546-38-2],  MFCD00235842
QC-7369 Fmoc-l-delta-azidoornithine
Purity: 96%
[1097192-04-5],  MFCD11052921
ST-8899 Fmoc-2,5-dichloro-l-phenylalanine
Purity: 95%
[1260614-80-9],  MFCD07372021
QE-1427 (2S)-Fmoc-4,4-difluoro-pyrrolidine-2-carboxylic acid
Purity: 95%
[203866-21-1],  MFCD01860709
QB-5145 Fmoc-l-2,4-dimethylphe
Purity: 95%
[1217728-65-8],  MFCD06659141
QV-9024 Fmoc-(4-s)-2,2-dimethyl-1,3-thiazolidine-4-carboxylic acid
Purity: 95%
[1932198-36-1],  MFCD06858314
QE-8184 Fmoc-dl-allylglycine
Purity: 95%
[221884-63-5],  MFCD02259489
ST-8908 Fmoc-dl-7-azatryptophan
Purity: 95%
[1219143-85-7],  MFCD02682351
QM-5230 Fmoc-DL-Gln-OH
Purity: 95%
[157355-74-3],  MFCD01101523
QC-1626 Fmoc-dl-glu(oall)-oh
Purity: 95%
[366491-50-1],  MFCD01862320
QC-8052 Fmoc-dl-nle-oh
Purity: 95%
[144701-20-2],  MFCD00237391
QM-4745 Fmoc-dl-phe-oh
Purity: 95%
[100750-05-8],  MFCD00112977
QC-9855 Fmoc-(dmb)ala-oh
Purity: 95%
[1425938-66-4],  MFCD18910716
QB-4275 Fmoc-(dmb)gly-oh
Purity: 98%
[166881-42-1],  MFCD08064316
QE-7315 Fmoc-dopa(acetonide)-oh
Purity: 95%
[852288-18-7],  MFCD08064332
QC-2064 Fmoc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid
Purity: 95%
[352707-75-6],  MFCD02682614
QB-5900 (2S,4R)-Fmoc-4-(4-fluorobenzyl)-pyrrolidine-2-carboxylic acid
Purity: 95%
[959576-18-2],  MFCD06656470
QC-9938 Fmoc-4-(4-fluorophenyl)-piperidine-4-carboxylic acid
Purity: 95%
[1076197-06-2],  MFCD11226817
SS-0491 Fmoc-gla(otbu)2-oh
Purity: 95%
[111662-64-7],  MFCD00038770
QE-1721 Fmoc-d-gla(otbu)2-oh
Purity: 95%
[111662-65-8],  MFCD00672341
QB-7347 Fmoc-gln-opfp
Purity: 95%
[86061-00-9],  MFCD00065646
QM-5248 Fmoc-d-gln-opfp
Purity: 95%
[200622-33-9],  MFCD00237047
QF-1672 Fmoc-gln(trt)-opfp
Purity: 97%
[132388-65-9],  MFCD00800874
QV-3028 Fmoc-gln(trt)-thr(psime,mepro)-oh
Purity: 95%
[1572725-72-4],  MFCD18427356
QB-1343 Fmoc-d-gln(xan)-oh
Purity: 95%
[1313054-52-2],  MFCD06796893
QB-5550 Fmoc-glu(obzl)-cl
Purity: 95%
[123622-36-6],  MFCD00235810
HA-3218 Fmoc-l-glu(otbu)-o-ch2-ph-och2-ch2-cooh
Purity: 95%
MFCD08457846
QC-7033 Fmoc-glu(otbu)-oh h2o
Purity: 95%
[204251-24-1],  MFCD00150485
QC-8716 Fmoc-d-glu(otbu)-oh h2o
Purity: 95%
[104091-08-9],  MFCD00797526
QM-5225 Fmoc-d-glu(otbu)-opfp
Purity: 95%
[200616-21-3],  MFCD00237048