Carboxes


Catalog # Compound Name Structure
YF-4845 3-Chloro-N-ethylbenzamide
Purity: 98%
[26819-09-0],  MFCD01214036
OT-1523 N-(2-Chloroethyl)benzamide
Purity: 97%
[26385-07-9],  MFCD00000964
CA-5492 3-Chloro-2-ethylbenzoic acid
Purity: 95%
[67648-15-1],  MFCD18410965
QC-1805 4-(2-Chloroethyl)benzoic acid
Purity: 95%
[20849-78-9],  MFCD00013995
QZ-3793 3-Chloro-6-ethyl-1-benzothiophene-2-carboxylic acid
Purity: 95%
[351000-45-8],  MFCD01923181
BB-2759 3-Chloro-4-(N-ethylcarbamoyl)phenylboronic acid
Purity: 97%
[850589-40-1],  MFCD07363767
BB-2813 4-Chloro-3-(ethylcarbamoyl)phenylboronic acid
Purity: 98%
[871332-69-3],  MFCD07783861
OR-2099 5-Chloroethyl-6-chloro-1,3-dihydro-2h-indole-2-one
Purity: 95%
[118289-55-7],  MFCD03411598
QM-4256 1-Chloroethyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5h)-carboxylate
Purity: 95%
[1201781-22-7],  MFCD13184338
QM-4390 2-Chloroethyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5h)-carboxylate
Purity: 95%
[1449117-45-6],  MFCD23704687
QF-9648 7-Chloro-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Purity: 95%
[68077-26-9],  MFCD00792459
QY-1889 N-(2-Chloroethyl)-2-methoxy-N-methylpyridine-4-carboxamide
Purity: 96%
[1820740-21-3],  MFCD28101651
QN-9675 4-Chloro-3-ethyl-1-methyl-1h-pyrazole-5-carboxylic acid
Purity: 95%
[127892-62-0],  MFCD08459057
QE-5153 4-Chloro-1-ethyl-3-methyl-1h-pyrazolo[3,4-b]pyridine-5-carboxylic acid
Purity: 95%
[851520-85-9],  MFCD22566116
QZ-0442 7-Chloro-1-ethyl-6-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Purity: 95%
[75001-59-1],  MFCD01084590
QZ-6571 7-Chloro-2-(4-ethylphenyl)-8-methylquinoline-4-carboxylic acid
Purity: 95%
[588711-30-2],  MFCD03422135
QZ-7033 6-Chloro-2-(4-ethylphenyl)quinoline-4-carboxylic acid
Purity: 95%
[897559-96-5],  MFCD03420103
QZ-3392 8-Chloro-2-(4-ethylphenyl)quinoline-4-carboxylic acid
Purity: 95%
[588677-31-0],  MFCD03422134
QZ-1329 4-Chloro-1-ethyl-1h-pyrazole-3-carboxylic acid
Purity: 95%
[512810-20-7],  MFCD02090840
QZ-7424 4-Chloro-1-ethyl-1h-pyrazole-5-carboxylic acid
Purity: 95%
[400756-39-0],  MFCD02090839
QE-7871 4-Chloro-1-ethyl-1h-pyrazolo[3,4-b]pyridine-5-carboxylic acid
Purity: 95%
[59060-16-1],  MFCD07367968
LD-2222 6-Chloro-N-ethylpyridine-3-carboxamide
Purity: 98%
[54864-84-5],  MFCD00661428
QZ-1496 5-Chloro-2-(ethylsulfonyl)pyrimidine-4-carboxylic acid
Purity: 95%
[890587-32-3],  MFCD06255212
QC-3602 2-Chloro-5-ethyl-1,3-thiazole-4-carboxylic acid
Purity: 95%
[1194374-29-2],  MFCD12404923
QZ-1214 7-Chloro-2-(5-ethylthien-2-yl)-8-methylquinoline-4-carboxylic acid
Purity: 95%
[777877-61-9],  MFCD03422170
QZ-8989 6-Chloro-2-(5-ethylthien-2-yl)quinoline-4-carboxylic acid
Purity: 95%
[438215-52-2],  MFCD03074115
QZ-7104 8-Chloro-2-(5-ethylthien-2-yl)quinoline-4-carboxylic acid
Purity: 95%
[588677-30-9],  MFCD03422169
QZ-7735 5-Chloro-2-(ethylthio)pyrimidine-4-carboxylic acid
Purity: 95%
[382610-58-4],  MFCD00507248
QK-2697 2-Chloro-4-ethynyl-benzoic acid methyl ester
Purity: 95%
[1224640-19-0],  MFCD23378507
OR-3256 2-Chloro-6-fluorobenzamide
Purity: 98%
[66073-54-9],  MFCD00055436
YF-4978 3-Chloro-4-fluorobenzamide
Purity: 98%
[701-43-9],  MFCD00153092
SS-1029 3-Chloro-4-fluoro-benzamidine, HCl
Purity: 95%
[477844-52-3],  MFCD00663597
SS-2722 5-Chloro-2-fluoro-benzamidine, HCl
Purity: 95%
[1187929-52-7],  MFCD04973393
OT-2811 4-Chloro-2-fluorobenzohydrazide
Purity: 98%
[1016768-00-5],  MFCD09813752
OR-1387 2-Chloro-3-fluorobenzoic acid
Purity: 98%
[102940-86-3],  MFCD00973903
CA-4386 2-Chloro-4-fluorobenzoic acid
Purity: 98%
[2252-51-9],  MFCD00010615
CA-4098 2-Chloro-5-fluorobenzoic acid
Purity: 98%
[2252-50-8],  MFCD00156967
OS-7801 2-Chloro-6-fluorobenzoic acid
Purity: 98%
[434-75-3],  MFCD00002417
OS-7415 3-Chloro-2-fluorobenzoic acid
Purity: 98%
[161957-55-7],  MFCD00042506
CA-4010 3-Chloro-4-fluorobenzoic acid
Purity: 98%
[403-16-7],  MFCD00042477
OR-4692 3-Chloro-5-fluorobenzoic acid
Purity: 98%
[25026-64-6],  MFCD00973904
CA-4385 4-Chloro-2-fluorobenzoic acid
Purity: 98%
[446-30-0],  MFCD00042468
CA-4028 4-Chloro-3-fluorobenzoic acid
Purity: 98%
[403-17-8],  MFCD00143290
CA-4013 5-Chloro-2-fluorobenzoic acid
Purity: 98%
[394-30-9],  MFCD00665762
OR-3014 2-Chloro-4-fluorobenzonitrile
Purity: 98%
[60702-69-4],  MFCD00042523
OS-7764 2-Chloro-6-fluorobenzonitrile
Purity: 98%
[668-45-1],  MFCD00001780
OR-2942 3-Chloro-2-fluorobenzonitrile
Purity: 98%
[94087-40-8],  MFCD00042206
CA-4229 3-chloro-4-fluorobenzonitrile
Purity: 97%
[117482-84-5],  MFCD00015431
QA-6536 3-Chloro-5-fluorobenzonitrile
Purity: 97%
[327056-73-5],  MFCD03407967
OR-3838 4-Chloro-2-fluorobenzonitrile
Purity: 98%
[57381-51-8],  MFCD00143284
OR-3842 4-Chloro-3-fluorobenzonitrile
Purity: 98%
[110888-15-8],  MFCD00143291
OR-4983 5-Chloro-2-fluorobenzonitrile
Purity: 98%
[57381-34-7],  MFCD01631434
ST-6480 3-Chloro-6-fluoro-1-benzothiophene-2-carbohydrazide
Purity: 95%
[329219-36-5],  MFCD00449850
QZ-7791 3-Chloro-4-fluoro-1-benzothiophene-2-carboxylic acid
Purity: 95%
[588676-90-8],  MFCD03422297
QB-9386 3-Chloro-6-fluoro-1-benzothiophene-2-carboxylic acid
Purity: 96%
[34576-92-6],  MFCD00228531
QA-4898 4-Chloro-3-fluorobenzoyl chloride
Purity: 97%
[177787-25-6],  MFCD02091532
QZ-1368 6-(2-Chloro-4-fluorobenzyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid
Purity: 95%
[656817-42-4],  MFCD03450690
QP-0582 1-(2-Chloro-4-fluorobenzyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid
Purity: 95%
[1274508-14-3],  MFCD17296071
QV-9175 1-(2-Chloro-4-fluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid
Purity: 90%
[1291839-95-6],  MFCD18788442
QY-6876 1-(2-Chloro-6-fluorobenzyl)piperidine-4-carboxylic acid hydrochloride
Purity: 95%
[1185295-60-6],  MFCD06800427
QY-1647 1-[(2-Chloro-6-fluorobenzyl)sulfonyl]piperidine-4-carboxylic acid
Purity: 95%
[1858256-24-2],  MFCD28954579
CA-4855 4'-Chloro-3'-fluorobiphenyl-3-carboxylic acid
Purity: 97%
[844878-88-2],  MFCD06201433
OR-3159 2-Chloro-6-fluorocinnamic acid
Purity: 95%
[392-22-3],  MFCD00051582
QM-4227 2-Chloro-2-fluorocyclopropanecarboxylic acid
Purity: 95%
[137081-42-6],  MFCD04972722
QP-2761 7-Chloro-6-fluoro-1-(4-fluorophenyl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Purity: 95%
[98105-79-4],  MFCD04153757
YA-9810 2-Chloro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid
Purity: 95%
[1261972-19-3],  MFCD18319718
QA-2874 4-Chloro-6-fluoro-1h-indole-2-carboxylic acid
Purity: 95%
[383133-62-8],  MFCD02664531
ST-4946 5-Chloro-4-fluoro-1h-indole-2-carboxylic acid
Purity: 95%
[186446-26-4],  MFCD09835295
QM-6557 5-Chloro-7-fluoro-1h-indole-2-carboxylic acid
Purity: 95%
[383132-37-4],  MFCD02664437
SH-6655 2-Chloro-4-fluoro-3-iodobenzonitrile
Purity: 96%
[899821-28-4],  MFCD30180182
OS-7752 2-Chloro-3-fluoroisonicotinic acid
Purity: 98%
[628691-93-0],  MFCD04038325
OR-6366 2-Chloro-5-fluoroisonicotinic acid
Purity: 97%
[884494-74-0],  MFCD04972381
QM-2475 3-Chloro-5-fluoroisonicotinic acid
Purity: 96%
[514798-03-9],  MFCD13185823
QF-8649 2-Chloro-6-fluoro-3-methoxybenzoic acid
Purity: 97%
[886499-40-7],  MFCD04115942
BB-5106 2-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid
Purity: 97%
[957066-03-4],  MFCD09878351
PN-4517 3-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[2096332-12-4],  MFCD22375097
PN-5527 3-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[2096329-94-9],  MFCD18837625
PN-5667 4-Chloro-2-fluoro-5-(methoxycarbonyl)phenylboronic acid, pinacol ester
Purity: 98%
[1073339-13-5],  MFCD12026085
QI-7772 2-Chloro-5-fluoro-6-methoxynicotinic acid
Purity: 96%
[943025-86-3],  MFCD12025843
YB-0896 2-Chloro-4-(4-fluoro-3-methoxyphenyl)benzoic acid
Purity: 95%
[1261892-14-1],  MFCD18320679
YA-4687 3-Chloro-5-(2-fluoro-3-methoxyphenyl)phenol
Purity: 95%
[1261920-31-3],  MFCD18315593
QY-1795 6-Chloro-5-fluoro-2-methoxypyridine-3-carbonitrile
Purity: 98%
[1820650-64-3],  MFCD27981329
CA-5970 3-Chloro-2-fluoro-N-methylbenzamide
Purity: 96%
[1522302-25-5],  MFCD24018811
YF-5085 4-Chloro-2-fluoro-N-methylbenzamide
Purity: 98%
[1343038-33-4],  MFCD19596644
QA-2602 2-Chloro-4-fluoro-3-methylbenzonitrile
Purity: 98%
[796600-15-2],  MFCD13193544
YA-9717 2-Chloro-4-(3-fluoro-4-methylphenyl)benzoic acid
Purity: 97%
[1261893-13-3],  MFCD18319643
LD-0307 2-Chloro-4-(3-fluoro-4-methylphenyl)benzonitrile
Purity: 98%
[1355247-63-0],  MFCD21333013
QB-2540 7-Chloro-6-fluoro-2-methyl-quinoline-4-carboxylic acid
Purity: 95%
[1313712-73-0],  MFCD19441959
QC-4700 2-Chloro-4-fluoronicotinic acid
Purity: 95%
[929022-76-4],  MFCD11040264
CA-4178 2-Chloro-5-fluoronicotinic acid
Purity: 98%
[38186-88-8],  MFCD03092932
QB-3668 2-Chloro-5-fluoronicotinonitrile
Purity: 96%
[791644-48-9],  MFCD15526908
PY-7266 6-Chloro-5-fluoronicotinonitrile
Purity: 96%
[1020253-14-8],  MFCD09972184
SS-7625 2-Chloro-6-fluoronitrobenzene
Purity: 98%
[64182-61-2],  MFCD06658264
CA-4018 2-Chloro-4-fluoro-5-nitrobenzoic acid
Purity: 96%
[114776-15-7],  MFCD04115715
CA-4072 4-Chloro-2-fluoro-5-nitrobenzoic acid
Purity: 98%
[35112-05-1],  MFCD04115725
WZ-9299 2-Chloro-N-(4-fluoro-2-nitrophenyl)acetamide
Purity: 98%
[379255-78-4],  MFCD03147404
QM-6544 7-Chloro-6-fluoro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester
Purity: 95%
[75073-15-3],  MFCD01655192
SS-7729 2-(2-Chloro-4-fluorophenyl)acetamide
Purity: 95%
[306937-35-9],  MFCD02180958
QC-1204 2-(2-Chloro-3-fluorophenyl)acetic acid
Purity: 98%
[1000523-07-8],  MFCD09925136
OR-4219 2-Chloro-4-fluorophenylacetic acid
Purity: 98%
[177985-32-9],  MFCD00236028
OR-0748 2-Chloro-6-fluorophenylacetic acid
Purity: 98%
[37777-76-7],  MFCD00004319
OR-5010 3-Chloro-2-fluorophenylacetic acid
Purity: 98%
[261762-96-3],  MFCD01631554
OR-2534 3-Chloro-4-fluorophenylacetic acid
Purity: 98%
[705-79-3],  MFCD01631555
SS-5381 3-Chloro-5-fluorophenylacetic acid
Purity: 98%
[202001-00-1],  MFCD03788475
OR-6255 4-Chloro-3-fluorophenylacetic acid
Purity: 98%
[883500-51-4],  MFCD04115861
OR-4986 5-Chloro-2-fluorophenylacetic acid
Purity: 97%
[261762-97-4],  MFCD01631439
OR-4220 2-Chloro-4-fluorophenylacetonitrile
Purity: 98%
[75279-56-0],  MFCD00236029
QA-5106 3-Chloro-4-fluorophenylacetonitrile
Purity: 98%
[658-98-0],  MFCD01631553
OR-6254 4-Chloro-3-fluorophenylacetonitrile
Purity: 97%
[251570-03-3],  MFCD04115860
OR-4985 5-Chloro-2-fluorophenylacetonitrile
Purity: 98%
[75279-54-8],  MFCD01631438
YA-1210 2-(3-Chloro-5-fluorophenyl)benzoic acid
Purity: 96%
[1261915-22-3],  MFCD18312643
YA-9004 2-Chloro-4-(2-fluorophenyl)benzoic acid
Purity: 95%
[1214362-41-0],  MFCD14701413
YA-9035 2-Chloro-4-(3-fluorophenyl)benzoic acid
Purity: 97%
[1214382-82-7],  MFCD14701414
YA-9066 2-Chloro-4-(4-fluorophenyl)benzoic acid
Purity: 95%
[728951-41-5],  MFCD14701415
YA-9067 5-Chloro-3-(4-fluorophenyl)benzoic acid
Purity: 98%
[1214344-28-1],  MFCD14701412
LD-0186 2-(3-Chloro-4-fluorophenyl)benzonitrile
Purity: 98%
[1352318-35-4],  MFCD20529504
LD-0179 2-(3-Chloro-5-fluorophenyl)benzonitrile
Purity: 98%
[1352318-29-6],  MFCD20529500
LD-0473 3-(3-Chloro-4-fluorophenyl)benzonitrile
Purity: 97%
[1365272-66-7],  MFCD21609626
LD-0488 3-(3-Chloro-5-fluorophenyl)benzonitrile
Purity: 98%
[1345732-63-9],  MFCD21609636
LD-0479 4-(3-Chloro-5-fluorophenyl)benzonitrile
Purity: 98%
[1237749-88-0],  MFCD21609628
BB-5141 N-(3-Chloro-4-fluorophenyl) 3-boronobenzamide
Purity: 98%
[1072946-04-3],  MFCD09972110
QM-9482 2-(3-Chloro-4-fluorophenyl)-4,4-dimethyl-1,2,3,4-tetrahydroquinoline-6-carboxylic acid
Purity: 95%
[1353971-43-3],  MFCD28502401
QV-3718 1-(3-Chloro-4-fluorophenyl)-5-ethyl-1h-1,2,3-triazole-4-carboxylic acid
Purity: 90%
[1094373-44-0],  MFCD11540112
YB-1257 4-(3-Chloro-4-fluorophenyl)-3-fluorobenzoic acid
Purity: 97%
[1261922-99-9],  MFCD18321030
YB-1226 4-(3-Chloro-5-fluorophenyl)-3-fluorobenzoic acid
Purity: 98%
[1261970-29-9],  MFCD18320999
LD-0664 4-(3-Chloro-5-fluorophenyl)-2-fluorobenzonitrile
Purity: 95%
[1393442-55-1],  MFCD22383721
QA-1722 2-Chloro-2-(4-fluoro-phenyl-hydrazono)-acetic acid ethyl ester
Purity: 95%
[37522-19-3],  MFCD06809227
YB-1234 3-(3-Chloro-5-fluorophenyl)-5-methoxybenzoic acid
Purity: 98%
[1261922-66-0],  MFCD18321007
OR-3261 3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonyl chloride
Purity: 95%
[69399-79-7],  MFCD00055650
QF-9831 3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carboxylic acid
Purity: 95%
[3919-74-2],  MFCD00055659
QD-8123 3-(4-Chloro-2-fluoro-phenyl)-5-methyl-isoxazole-4-carboxylic acid ethyl ester
Purity: 95%
[1159602-71-7],  MFCD22370423
QC-4853 7-Chloro-3-(3-fluorophenyl)naphthalene-1-carboxylic acid
Purity: 95%
[1206969-68-7],  MFCD14585483
YB-1243 3-(3-Chloro-5-fluorophenyl)-5-nitrobenzoic acid
Purity: 96%
[1261928-24-8],  MFCD18321016
QI-9169 1-(3-Chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxylic acid
Purity: 95%
[696647-51-5],  MFCD03834520
YB-4455 4-(3-Chloro-5-fluorophenyl)phenylacetic acid
Purity: 98%
[1334499-97-6],  MFCD20231500
YA-7340 6-(3-Chloro-5-fluorophenyl)picolinic acid
Purity: 96%
[1261932-98-2],  MFCD18317709
QB-2291 3-(4-Chloro-3-fluorophenyl)propionic acid
Purity: 98%
[881189-65-7],  MFCD04116058
QY-8250 1-(2-Chloro-5-fluorophenyl)-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid
Purity: 95%
[1224168-17-5],  MFCD17430367
QP-7726 1-(3-Chloro-4-fluorophenyl)-1h-1,2,3-triazole-4-carboxylic acid
Purity: 95%
[1039901-95-5],  MFCD11189058
QB-3188 3-Chloro-5-fluoropicolinic acid
Purity: 95%
[128073-01-8],  MFCD13185822
QC-5321 6-Chloro-5-fluoropicolinic acid
Purity: 98%
[860296-24-8],  MFCD13185819
SS-0448 5-Chloro-3-fluoropyridine-2-carboxylic acid
Purity: 98%
[207994-08-9],  MFCD12827555
QY-1256 6-chloro-2-fluoropyridine-3-carboxylic acid
Purity: 98%
[1211578-46-9],  MFCD16610397
QB-4913 6-Chloro-3-fluoropyridine-2-carboxylic acid
Purity: 98%
[884494-76-2],  MFCD04972387
PY-1713 2-(5-Chloro-3-fluoropyridin-2-yl)acetic acid
Purity: 98%
[1214323-94-0],  MFCD13194517
SS-3944 4-Chloro-5-fluoropyrimidine
Purity: 98%
[347418-42-2],  MFCD09750157
ST-2447 4-Chloro-5-fluoro-1h-pyrrolo[2,3-b]pyridine-6-carboxylic acid
Purity: 95%
[1246088-38-9],  MFCD17171310
ST-3058 4-Chloro-6-fluoroquinoline-3-carboxylic acid
Purity: 98%
[179024-67-0],  MFCD06255123
OR-2353 4-Chloro-2-fluoro-5-sulfamylbenzoic acid
Purity: 95%
[4793-22-0],  MFCD03265327
QY-1226 5-Chloro-6-fluoro-[1,2,3,4]tetrazolo[1,5-a]pyridine-8-carbonitrile
Purity: 98%
[1393442-50-6],  MFCD22383770
QV-2852 2-Chloro-4-formylbenzoic acid
Purity: 98%
[1289063-25-7],  MFCD11110998
SH-6097 3-Chloro-4-formylbenzoic acid
Purity: 95%
[58588-59-3],  MFCD20649616
QC-3342 3-Chloro-5-formylbenzoic acid
Purity: 95%
[153203-59-9],  MFCD20658588
QC-5347 5-Chloro-2-formylbenzoic acid
Purity: 97%
[4506-45-0],  MFCD06739601
QM-4069 3-Chloro-4-formylbenzonitrile
Purity: 97%
[58588-64-0],  MFCD11036376
QA-9911 4-Chloro-3-formylbenzonitrile
Purity: 98%
[105191-41-1],  MFCD11035756
QA-6019 5-Chloro-3-formyl-1h-indole-2-carboxylic acid
Purity: 98%
[380448-07-7],  MFCD04966951
OR-5307 5-Chloro-3-formyl-1h-indole-2-carboxylic acid ethyl ester
Purity: 96%
[43142-76-3],  MFCD02257705
YA-9190 2-Chloro-4-(2-formylphenyl)benzoic acid
Purity: 96%
[1261970-85-7],  MFCD18319192
YA-9252 2-Chloro-4-(4-formylphenyl)benzoic acid
Purity: 98%
[1261946-48-8],  MFCD18319254
YA-9189 2-Chloro-5-(2-formylphenyl)benzoic acid
Purity: 95%
[1261958-60-4],  MFCD18319191
YA-9220 2-Chloro-5-(3-formylphenyl)benzoic acid
Purity: 95%
[1261983-94-1],  MFCD18319222
YA-9254 4-Chloro-2-(4-formylphenyl)benzoic acid
Purity: 95%
[1261929-46-7],  MFCD18319256
YA-9256 4-Chloro-3-(4-formylphenyl)benzoic acid
Purity: 95%
[1261921-72-5],  MFCD18319258
QA-0882 4-Chloroformylphthalic anhydride
Purity: 95%
[1204-28-0],  MFCD00005924
QF-6666 3-Chloro-2,4(3h,5h)-furandione
Purity: 95%
[4971-55-5],  MFCD00134273
YA-8694 2-Chloro-4-(furan-2-yl)benzoic acid
Purity: 98%
[1237141-26-2],  MFCD18318841
OR-4262 4-chloro-2-[(furan-2-ylmethyl)amino]-5-sulfamoylbenzoic acid
Purity: 98%
[54-31-9],  MFCD00010549
ST-4053 5-Chloro-2-furoic acid
Purity: 98%
[618-30-4],  MFCD00093272
QZ-0426 7-Chloro-2-(2-furyl)-8-methylquinoline-4-carboxylic acid
Purity: 95%
[588696-22-4],  MFCD03421968
QZ-0250 8-Chloro-2-(2-furyl)quinoline-4-carboxylic acid
Purity: 95%
[52413-55-5],  MFCD03421966
QA-0838 6-Chloro-n-hexanoic acid
Purity: 98%
[4224-62-8],  MFCD00061103
BB-2756 3-Chloro-4-hydrazinecarbonylphenylboronic acid
Purity: 98%
[850589-37-6],  MFCD07363764
QJ-1932 2-Chloro-4-hydrazino-benzoic acid methyl ester
Purity: 95%
[635325-33-6],  MFCD22565252
QN-6867 2-Chloro-4-hydrazinylbenzoic acid hydrochloride
Purity: 95%
[41112-74-7],  MFCD25371650
QD-1696 6-Chloro-3-hydrazinyl-4-pyridazinecarboxylic acid
Purity: 95%
[77813-57-1],  MFCD19202936
OR-2512 2-Chloro-4-hydroxybenzaldehyde
Purity: 97%
[56962-11-9],  MFCD00052184
CA-4727 4-Chloro-N'-hydroxybenzimidamide
Purity: 97%
[5033-28-3],  MFCD00464111
OR-2005 5-Chloro-2-hydroxybenzohydrazide
Purity: 95%
[5022-48-0],  MFCD01001347
QI-5041 2-Chloro-3-hydroxybenzoic acid
Purity: 95%
[51786-10-8],  MFCD09264192
OR-1658 2-Chloro-4-hydroxybenzoic acid
Purity: 97%
[56363-84-9],  MFCD00045855
SS-5425 2-Chloro-5-hydroxybenzoic acid
Purity: 97%
[56961-30-9],  MFCD04038818
QA-8799 2-Chloro-6-hydroxybenzoic acid
Purity: 98%
[56961-31-0],  MFCD10687031
ST-5658 3-Chloro-4-hydroxybenzoic acid
Purity: 98%
[3964-58-7],  MFCD00002549
CA-4795 3-chloro-5-hydroxybenzoic acid
Purity: 98%
[53984-36-4],  MFCD04114327
CA-4772 4-Chloro-2-hydroxybenzoic acid
Purity: 96%
[5106-98-9],  MFCD00002449
CA-4622 4-Chloro-3-hydroxybenzoic acid
Purity: 98%
[34113-69-4],  MFCD00153892
YF-7298 5-Chloro-2-hydroxybenzoic acid ethyl ester
Purity: 95%
[15196-83-5],  MFCD06204295
QC-1569 3-Chloro-4-hydroxybenzoic acid hemihydrate
Purity: 95%
[128161-59-1],  MFCD02662353
ST-1199 2-Chloro-4-hydroxybenzoic acid hydrate
Purity: 98%
[440123-65-9],  MFCD00798116
OR-6314 2-Chloro-4-hydroxy-benzoic acid methyl ester
Purity: 98%
[104253-44-3],  MFCD04117954
CA-5520 2-Chloro-4-hydroxybenzonitrile
Purity: 95%
[3336-16-1],  MFCD00052185
CA-5443 2-Chloro-5-hydroxybenzonitrile
Purity: 98%
[188774-56-3],  MFCD09743462
QC-2945 2-Chloro-6-hydroxybenzonitrile
Purity: 98%
[89999-90-6],  MFCD01646165
QA-5806 3-Chloro-4-hydroxybenzonitrile
Purity: 95%
[2315-81-3],  MFCD01567246
CA-4798 3-Chloro-5-hydroxybenzonitrile
Purity: 98%
[473923-97-6],  MFCD11226540
QA-8180 4-Chloro-2-hydroxybenzonitrile
Purity: 95%
[30818-28-1],  MFCD00234255
CA-5619 4-Chloro-3-hydroxybenzonitrile
Purity: 98%
[51748-01-7],  MFCD16999195
QD-8673 4-(5-Chloro-2-hydroxy-benzyl)-piperazine-1-carboxylic acid tert-butyl ester
Purity: 95%
[2206608-34-4],  MFCD31557802
QN-8730 5'-Chloro-2'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid
Purity: 95%
[376592-57-3],  MFCD23135364