
Catalog # Compound Name Structure
OS-1104 (2S,3S)-(-)-3-(t-BOC-amino)-1,2-Epoxy-4-phenylbutane
Purity: 98%
[98737-29-2],  MFCD02258997
OR-6087 2-(2-Boc-Aminoethoxy)ethanol
Purity: 98%
[139115-91-6],  MFCD04038542
SS-2372 (2-[2-(Boc-amino)ethoxy]ethoxy)acetic acid dicyclohexylamine salt
Purity: 97%
[560088-79-1],  MFCD06796877
QJ-0482 N-Boc-2-(2-amino-ethoxy)ethylamine
Purity: 97%
[127828-22-2],  MFCD12031501
QD-9479 3-(2-N-Boc-aminoethoxy)propanoic acid
Purity: 95%
[1260092-44-1],  MFCD22574796
SS-0029 3-(2-N-Boc-Aminoethyl)azetidine
Purity: 96%
[162696-31-3],  MFCD09878605
QA-7016 4-({2-Boc-amino}ethyl)benzoic acid
Purity: 96%
[132690-91-6],  MFCD07371516
SS-1440 Boc-3-(2-aminoethyl)-1-carboxymethyl-quinazoline-2,4-dione
Purity: 95%
[215190-30-0],  MFCD02179635
QA-3889 1-Boc-4-(2-aminoethyl)-4-hydroxypiperidine
Purity: 95%
[1179338-62-5],  MFCD11111570
IN-0424 1-(2-BOC-Aminoethyl)-2-methyl-1H-benzimidazole
Purity: 95%
[1414029-35-8],  MFCD21106048
ST-6379 4-(Boc-aminoethyloxy)benzonitrile
Purity: 98%
[919085-52-2],  MFCD18070986
AM-1752 1((-2-N-Boc-amino)ethyl)piperazine
Purity: 95%
[140447-78-5],  MFCD02683050
OR-4856 4-(2-Boc-aminoethyl)piperidine
Purity: 95%
[165528-81-4],  MFCD01318373
SH-5073 4-(N-BOC-Amino)-1-ethylpiperidine
Purity: 98%
[534595-56-7],  MFCD16496451
BB-5376 5-(N-BOC-Amino)-4-fluoro-2-methylphenylboronic acid
Purity: 98%
BB-5589 4-(BOC-Amino)-2-fluorophenylboronic acid
Purity: 96%
[1415960-56-3],  MFCD18250042
PN-5589 4-(BOC-Amino)-2-fluorophenylboronic acid pinacol ester
Purity: 97%
[1256256-45-7],  MFCD18383441
SS-1320 Boc-(r)-3-amino-4-(3-fluorophenyl)-butyric acid
Purity: 95%
[331763-66-7],  MFCD01860913
SS-1165 Boc-(r)-3-amino-4-(4-fluoro-phenyl)-butyric acid
Purity: 95%
[218609-00-8],  MFCD01076280
SS-2260 Boc-(R)-3-amino-3-(2-fluoro-phenyl)-propionic acid
Purity: 95%
[500789-03-7],  MFCD03427955
SS-1517 Boc-(S)-3-amino-3-(2-fluoro-phenyl)-propionic acid
Purity: 97%
[500770-71-8],  MFCD03427917
SS-1528 Boc-(r)-3-amino-3-(4-fluoro-phenyl)-propionic acid
Purity: 95%
[479064-94-3],  MFCD03427957
SS-2310 Boc-(s)-3-amino-3-(3-fluoro-phenyl)-propionic acid
Purity: 95%
[500770-72-9],  MFCD03427918
SS-2333 Boc-(s)-3-amino-3-(4-fluoro-phenyl)-propionic acid
Purity: 97%
[479064-88-5],  MFCD03427919
SS-1758 Boc-3-amino-5-(fmoc-amino)-benzoic acid
Purity: 95%
[779335-06-7],  MFCD04112671
SS-1444 (2S, 4S)-Boc-4-amino-1-fmoc-pyrrolidine-2-carboxylic acid
Purity: 96%
[221352-74-5],  MFCD02179641
ST-6657 3-N-Boc-amino-4-formyl-5-methoxypyridine
Purity: 95%
[1049677-54-4],  MFCD11053566
QA-6593 2-N-Boc-amino-3-formylpyridine
Purity: 95%
[116026-94-9],  MFCD03086225
OR-3405 Boc-7-Aminoheptanoic acid
Purity: 98%
[60142-89-4],  MFCD00063356
SS-0662 Boc-6-aminohexanoic acid
Purity: 97%
[6404-29-1],  MFCD00037798
SS-2846 Boc-(r)-3-amino-5-hexenoic acid
Purity: 95%
[269726-94-5],  MFCD01860990
SS-2381 Boc-(s)-3-amino-5-hexenoic acid
Purity: 95%
[270263-03-1],  MFCD01861087
SS-0961 Boc-(3s,4s)-4-amino-3-hydroxy-5-(4-benzyloxyphenyl)-pentanoic acid
Purity: 95%
[204195-38-0],  MFCD00270193
OR-2049 Boc-4-amino-3-hydroxybutanoic acid
Purity: 96%
[69489-07-2],  MFCD02682574
BB-2457 5-Boc-amino-2-hydroxymethylphenylboronic acid, dehydrate
Purity: 98%
[850568-79-5],  MFCD06659853
ST-1796 2-(Boc-amino)-4-(hydroxymethyl)pyridine
Purity: 98%
[304873-62-9],  MFCD08704606
SS-1525 Boc-(R)-3-amino-3-(2-hydroxyphenyl)propionic acid
Purity: 95%
[500788-88-5],  MFCD03427939
SS-1526 Boc-(R)-3-amino-3-(3-hydroxyphenyl)propionic acid
Purity: 95%
[329013-12-9],  MFCD03427940
SS-1275 Boc-(S)-2-Amino-3-(3-hydroxyphenyl)propionic acid
Purity: 96%
[90819-30-0],  MFCD01632034
QB-3860 (3S,4S)-N-Boc-3-amino-4-hydroxypyrrolidine
Purity: 98%
[190792-74-6],  MFCD11111139
SS-1669 2-(Boc-amino)-6-hydroxyspiro[3.3]heptane
Purity: 95%
[1000933-99-2],  MFCD09702342
QA-1785 1-Boc-4-[(aminoiminomethyl)amino]piperidine mono, HCl
Purity: 95%
[885049-08-1],  MFCD09999149
SS-2262 (R,S)-Boc-1-aminoindane-1-carboxylic acid
Purity: 97%
[214139-26-1],  MFCD00800596
SS-2268 N-Boc-2-aminoindane-2-carboxylic acid
Purity: 95%
[71066-00-7],  MFCD00800597
QA-7944 1-Boc-5-aminoindole
Purity: 96%
[166104-20-7],  MFCD04114746
ST-6714 7-N-Boc-Amino-indole
Purity: 95%
[886365-44-2],  MFCD07369914
SS-1763 Boc-(s)-2-amino-3-(3-indolyl)-propionitrile
Purity: 95%
[138165-79-4],  MFCD04112675
SS-1346 Boc-(s)-3-amino-4-(4-iodo-phenyl)-butyric acid
Purity: 95%
[270065-71-9],  MFCD01861061
SH-5134 4-(N-BOC-Amino)-1-isobutylpiperidine
Purity: 98%
[1284584-48-0],  MFCD16496474
SS-0228 2-(Boc-amino)isobutyric acid
Purity: 98%
[30992-29-1],  MFCD00042973
SH-5137 4-(N-BOC-Amino)-1-(isobutyryl)piperidine
Purity: 98%
[1286265-44-8],  MFCD17014447
SH-5147 4-BOC-Amino-1-(isopentanoyl)piperidine
Purity: 98%
[1152430-21-1],  MFCD13370466
SH-5203 4-(BOC-Amino)-1-isopentylpiperidine
Purity: 98%
[888944-67-0],  MFCD21333075
SH-5204 4-(BOC-Amino)-1-isopropylpiperidine
Purity: 98%
[534595-37-4],  MFCD09028114
HI-1913 3-(BOC-Amino)-1-methanesulfonylpyrrolidine
Purity: 98%
[1350473-33-4],  MFCD22549322
SS-7698 Boc-5-amino-2-methoxybenzoic acid
Purity: 96%
[1075242-43-1],  MFCD04972601
PC-1031 3-(BOC-Amino)-2-methoxycarbonylpyridine-5-boronic acid pinacol ester
Purity: 98%
OT-4023 (N-BOC-Amino)(3-methoxyphenyl)acetic acid
Purity: 98%
[40512-37-6],  MFCD07388843
SS-2324 Boc-(r)-3-amino-3-(2-methoxy-phenyl)-propionic acid
Purity: 95%
[500788-85-2],  MFCD03427936
SS-1523 Boc-(r)-3-amino-3-(3-methoxy-phenyl)-propionic acid
Purity: 95%
[500788-86-3],  MFCD03427937
SS-1524 Boc-(r)-3-amino-3-(4-methoxy-phenyl)-propionic acid
Purity: 95%
[500788-87-4],  MFCD03427938
SS-2316 Boc-(s)-3-amino-3-(2-methoxy-phenyl)-propionic acid
Purity: 95%
[499995-76-5],  MFCD03427898
SS-1516 Boc-(s)-3-amino-3-(3-methoxy-phenyl)-propionic acid
Purity: 95%
[499995-77-6],  MFCD03427899
SS-2318 Boc-(s)-3-amino-3-(4-methoxy-phenyl)-propionic acid
Purity: 95%
[159990-12-2],  MFCD03427900
QY-1857 (N-BOC-Amino)(2-methoxypyridin-4-yl)acetic acid
Purity: 95%
[1820606-90-3],  MFCD28014046
OR-9902 1-(N-Boc-aminomethyl)-4-(aminomethyl)benzene
Purity: 95%
[108468-00-4],  MFCD02683058
ST-0275 1-Boc-amino-3-methylamino-propane-hcl
Purity: 98%
[1188264-02-9],  MFCD11101326
ST-2478 4-(N-Boc-aminomethyl)aniline
Purity: 98%
[94838-55-8],  MFCD03001716
OR-5131 1-Boc-3-(aminomethyl)azetidine
Purity: 97%
[325775-44-8],  MFCD01861762
OR-5986 4-Boc-aminomethylbenzamidine
Purity: 97%
[162696-15-3],  MFCD03839883
OR-4320 3-(N-Boc-aminomethyl)benzoic acid
Purity: 96%
[117445-22-4],  MFCD00273426
OR-4157 4-(Boc-Aminomethyl)benzoic acid
Purity: 97%
[33233-67-9],  MFCD00228182
QD-9610 2-(Boc-aminomethyl)benzyl alcohol
Purity: 98%
[1333114-86-5],  MFCD22418063
SS-7344 3-N-Boc-aminomethyl-benzylamine hcl
Purity: 96%
[914465-97-7],  MFCD04112678
SS-1880 2'-(Boc-aminomethyl)-biphenyl-2-carboxylic acid
Purity: 98%
[158066-11-6],  MFCD04974227
SS-3921 Boc-1-aminomethyl-cyclohexane carboxylic acid
Purity: 95%
[204514-23-8],  MFCD09264198
SS-3925 Boc-1-aminomethyl-cyclopentane carboxylic acid
Purity: 95%
[204514-22-7],  MFCD09264201
BB-2212 2-(N-Boc-aminomethyl)-4-fluorophenylboronic acid
Purity: 97%
[850568-64-8],  MFCD06659826
SS-2619 (R)-4-(Boc-amino)-6-methylheptanoic acid
Purity: 95%
[146453-32-9],  MFCD01074530
ST-1138 N-Boc-3-(aminomethyl)-3-methyloxetane
Purity: 95%
[208105-83-3],  MFCD11656774
OR-9580 (S)-N-Boc-2-aminomethylmorpholine
Purity: 97%
[879403-42-6],  MFCD11707017
PN-5849 2-(N-BOC-Aminomethyl)-5-nitrophenylboronic acid pinacol ester
Purity: 97%
ST-6981 2-(Boc-amino)-4-methylpentylamine
Purity: 95%
[1186663-67-1],  MFCD12828717
SS-1936 Boc-3-aminomethyl-phenylacetic acid
Purity: 96%
[71420-95-6],  MFCD06656429
SS-2634 4-Boc-aminomethylphenylacetic acid
Purity: 97%
[71420-92-3],  MFCD06656436
SS-1212 N-BOC-4-(Aminomethyl)-L-phenylalanine
Purity: 95%
[137452-49-4],  MFCD01318277
BB-2483 3-BOC-amino-4-methylphenylboronic acid
Purity: 97%
[850568-81-9],  MFCD04115654
PN-2731 2-Boc-aminomethyl-phenylboronic acid pinacol ester
Purity: 97%
[905300-76-7],  MFCD07371552
PN-2013 3-(N-Boc-aminomethyl)phenylboronic acid, pinacol ester
Purity: 98%
[832114-05-3],  MFCD05863917
PN-6344 4-(Boc-Amino)-2-methylphenylboronic acid, pinacol ester
Purity: 96%
[1256360-04-9],  MFCD16295118
SS-1514 Boc-(s)-3-amino-3-(3-methyl-phenyl)-propionic acid
Purity: 95%
[499995-75-4],  MFCD03427896
SS-1515 Boc-(s)-3-amino-3-(4-methyl-phenyl)-propionic acid
Purity: 95%
[479064-96-5],  MFCD03427897
OR-5985 (R)-1-Boc-3-(aminomethyl)piperidine
Purity: 97%
[140645-23-4],  MFCD03839876
AM-1764 (S)-1-Boc-3-(Aminomethyl)piperidine
Purity: 97%
[140645-24-5],  MFCD03839877
AM-1769 1-N-BOC-4-(Aminomethyl)piperidine
Purity: 98%
[144222-22-0],  MFCD01076207
AM-1757 4-(Boc-Aminomethyl)piperidine
Purity: 95%
[135632-53-0],  MFCD01631214
ST-1244 3-N-Boc-aminomethyl piperidine-hcl
Purity: 97%
[1159826-67-1],  MFCD11101360
SS-1761 4-Boc-aminomethyl piperidine-hcl
Purity: 96%
[1049727-98-1],  MFCD04112674
QC-1646 N-Boc-2-amino-2-methyl-1-propanol
Purity: 97%
[102520-97-8],  MFCD03788641
AM-2083 (R)-1-Boc-2-(aminomethyl)pyrrolidine
Purity: 97%
[259537-92-3],  MFCD03419256
OR-6020 (R)-1-Boc-3-(aminomethyl)pyrrolidine
Purity: 97%
[199174-29-3],  MFCD03844734
OR-8973 (R)-2-N-Boc-aminomethylpyrrolidine
Purity: 95%
[719999-54-9],  MFCD03839886
QA-9196 (S)-1-Boc-2-(aminomethyl)pyrrolidine
Purity: 97%
[119020-01-8],  MFCD03419257
OR-5260 (S)-1-Boc-3-(aminomethyl)pyrrolidine
Purity: 97%
[199175-10-5],  MFCD02179397
OR-9476 (S)-3-N-Boc-aminomethyl pyrrolidine
Purity: 95%
[173340-26-6],  MFCD06796616
OR-5134 1-Boc-3-(aminomethyl)pyrrolidine
Purity: 97%
[270912-72-6],  MFCD01861798
OR-6425 3-Boc-aminomethylpyrrolidine
Purity: 98%
[149366-79-0],  MFCD04973997
HI-2054 2-(BOC-Amino)-5-methyl-1,3,4-thiadiazole
Purity: 96%
[1692539-76-6],  MFCD26940380
SS-1926 (R)-Boc-4-amino-6-methylthio-hexanoic acid
Purity: 95%
[959582-93-5],  MFCD06410964
BB-5293 5-(BOC-Aminomethyl)thiophene-2-boronic acid
Purity: 98%
[1072951-39-3],  MFCD11504845
BC-1107 5-(BOC-Aminomethyl)thiophene-3-boronic acid
Purity: 98%
[2246751-62-0],  MFCD28515382
QY-1863 2-(N-BOC-Aminomethyl)-5-(trifluoromethyl)pyridine
Purity: 95%
[1216276-20-8],  MFCD13187674
SH-5157 1-(N-BOC-Amino)naphthalene
Purity: 95%
[72594-62-8],  MFCD07127697
SS-7828 Boc-3-amino-2-naphthoic acid
Purity: 97%
[887242-59-3],  MFCD02682309
SS-1166 Boc-(r)-3-amino-4-(1-naphthyl)-butyric acid
Purity: 95%
[190190-49-9],  MFCD01076281
SS-7776 Boc-(r,s)-3-amino-3-(2-naphthyl)-propionic acid
Purity: 95%
[268542-15-0],  MFCD02090688
QA-8353 4-Boc-aminonicotinic acid
Purity: 98%
[171178-34-0],  MFCD03427724
SS-1167 Boc-(r)-3-amino-4-(4-nitrophenyl)butanoic acid
Purity: 95%
[219297-12-8],  MFCD01076285
SS-1168 Boc-(s)-3-amino-4-(4-nitrophenyl)butanoic acid
Purity: 95%
[127106-71-2],  MFCD01076286
SS-2331 Boc-(r)-3-amino-3-(3-nitro-phenyl)-propanoic acid
Purity: 95%
[501015-24-3],  MFCD01631082
QC-0613 4-Boc-6-amino-1,4-oxazepane
Purity: 95%
[1170390-54-1],  MFCD12964084
SS-2312 (R)-3-(Boc-amino)-2-oxo-1-pyrrolidine-acetic acid
Purity: 95%
[78444-90-3],  MFCD02684393
SS-1671 2-(Boc-amino)-6-oxospiro[3.3]heptane
Purity: 96%
[1118786-86-9],  MFCD11858160
SS-1272 (Boc-aminooxy)acetic acid
Purity: 98%
[42989-85-5],  MFCD01632027
SS-8889 Boc-5-aminopentanoic acid
Purity: 97%
[27219-07-4],  MFCD00076903
SS-1923 (S)-Boc-4-amino-pentanoic acid
Purity: 95%
[207924-92-3],  MFCD06410963
QW-1941 5-(Boc-amino)-1-pentyl bromide
Purity: 96%
[83948-54-3],  MFCD03425513
QH-5926 N-Boc-2-aminophenol
Purity: 98%
[186663-74-1],  MFCD06411300
HC-2643 1-Boc-4-(4-aminophenoxy)piperidine
Purity: 98%
[138227-63-1],  MFCD04115023
QB-9455 Boc-(aminophenyl)acetic acid
Purity: 97%
[135807-51-1],  MFCD09750482
SS-5608 Boc-(4-aminophenyl)acetic acid
Purity: 96%
[81196-09-0],  MFCD00099367
AN-3228 4-(N-BOC-Aminophenyl)acetonitrile
Purity: 98%
[1233249-35-8],  MFCD17465121
QB-3180 Boc-4-amino-D-phenylalanine
Purity: 98%
[164332-89-2],  MFCD00236818
SS-9883 Boc-4-amino-L-phenylalanine
Purity: 95%
[55533-24-9],  MFCD00038139
SS-1420 Boc-4-(z-amino)-d-phenylalanine dicyclohexylammonium salt
Purity: 95%
YA-1417 2-(3-BOC-Aminophenyl)benzoic acid
Purity: 95%
[927801-48-7],  MFCD09055095
BB-2123 2-BOC-aminophenylboronic acid
Purity: 96%
[115377-94-1],  MFCD02179450
BB-2621 3-BOC-aminophenylboronic acid
Purity: 98%
[380430-68-2],  MFCD03411945
BB-2110 4-Boc-aminophenylboronic acid
Purity: 98%
[380430-49-9],  MFCD02093054
BB-2582 2-BOC-aminophenylboronic acid, pinacol ester
Purity: 98%
[159624-15-4],  MFCD03411943
PN-2621 3-BOC-aminophenylboronic acid, pinacol ester
Purity: 96%
[330793-09-4],  MFCD03789256
BB-2111 4-BOC-aminophenylboronic acid, pinacol ester
Purity: 98%
[330793-01-6],  MFCD02179439
SS-1066 (3S)-Boc-3-amino-4-phenyl-2-butanone
Purity: 95%
[85613-64-5],  MFCD00673778
QA-1521 (S)-3-(Boc-amino)-4-phenylbutyric acid
Purity: 97%
[51871-62-6],  MFCD01076271
QA-1602 N-Boc-2-(4-aminophenyl)ethanol
Purity: 98%
[104060-23-3],  MFCD04974330
HC-4163 2-[4-(BOC-Amino)phenyl]-2-methylpropanenitrile
Purity: 98%
[1314791-16-6],  MFCD19695271
SS-1163 Boc-(r)-3-amino-5-phenylpentanoic acid
Purity: 95%
[218608-83-4],  MFCD01076262
SS-2639 (R)-4-(Boc-amino)-5-phenylpentanoic acid
Purity: 95%
[195867-20-0],  MFCD01074521
YA-1897 2-(3-BOC-Aminophenyl)phenol
Purity: 95%
[1261900-37-1],  MFCD18313046
YA-1900 2-(4-BOC-Aminophenyl)phenol
Purity: 97%
[1261999-15-8],  MFCD18313049
YA-1899 4-(3-BOC-Aminophenyl)phenol
Purity: 96%
[1261958-25-1],  MFCD18313048
YA-1902 4-(4-BOC-aminophenyl)phenol
Purity: 98%
[848853-75-8],  MFCD18313051
ST-8158 1-Boc-4-(2-aminophenyl)piperazine
Purity: 96%
[170017-74-0],  MFCD04115046
AN-1426 1-Boc-4-(4-aminophenyl)piperazine
Purity: 96%
[170911-92-9],  MFCD04115065
SS-2884 (R)-N-Boc-3-amino-3-phenylpropanoic acid
Purity: 97%
[161024-80-2],  MFCD01320859
SS-1313 (S)-N-Boc-3-amino-3-phenylpropanoic acid
Purity: 97%
[103365-47-5],  MFCD01860892
QB-2029 3-(Boc-Amino)-3-phenylpropionic acid
Purity: 98%
[14676-01-8],  MFCD02090695
SS-1502 (S)-Boc-2-amino-3-phenyl-propionitrile
Purity: 95%
[99281-90-0],  MFCD03094753
ST-4500 2-(Boc-amino)-3-phenylpropylamine
Purity: 97%
[179051-72-0],  MFCD11974399
SS-1754 (S)-Boc-3-amino-2-(phenylsulfonylamino)-propionic acid
Purity: 95%
[342888-28-2],  MFCD04112668
AN-3320 3-(BOC-Amino)phenyltetrazole
Purity: 96%
[150007-16-2],  MFCD21170141
ST-2551 2-(BOC-Amino)-4-picoline
Purity: 98%
[90101-20-5],  MFCD07776933
PY-7971 2-Boc-Amino-3-picoline
Purity: 95%
[138343-75-6],  MFCD03425358
QY-1774 4-(BOC-Amino)picoline
Purity: 95%
[1219112-94-3],  MFCD15475057
AM-1743 (R)-3-Boc-aminopiperidine
Purity: 97%
[309956-78-3],  MFCD03093382
OR-1709 (S)-1-Boc-3-aminopiperidine
Purity: 96%
[625471-18-3],  MFCD03094718
AM-1742 (S)-3-Boc-aminopiperidine
Purity: 98%
[216854-23-8],  MFCD03093383
AM-1606 1-Boc-3-aminopiperidine
Purity: 96%
[184637-48-7],  MFCD01861219
AM-1626 1-Boc-4-aminopiperidine
Purity: 97%
[87120-72-7],  MFCD01076201
OR-2314 3-Boc-aminopiperidine
Purity: 97%
[172603-05-3],  MFCD03839941
AM-1625 4-Boc-aminopiperidine
Purity: 98%
[73874-95-0],  MFCD00798171
SS-1233 1-Boc-4-amino-piperidine, HCl
Purity: 98%
[189819-75-8],  MFCD01321014
SS-1498 4-Boc-aminopiperidine-hcl
Purity: 98%
[179110-74-8],  MFCD03093509
QY-1299 2-(4-Boc-Aminopiperidino)pyridine
Purity: 98%
[252578-12-4],  MFCD21106162
SH-5136 4-(N-BOC-Amino)-1-(pivaloyl)piperidine
Purity: 98%
[1286274-87-0],  MFCD17014373
OR-4036 3-(Boc-amino)-1-propanol
Purity: 97%
[58885-58-8],  MFCD00191883
OR-6431 N-Boc-(R)-1-amino-2-propanol
Purity: 96%
[119768-44-4],  MFCD04974338
OR-6432 N-Boc-(S)-1-amino-2-propanol
Purity: 98%
[167938-56-9],  MFCD04974340
AM-2325 N-BOC-2-Amino-1-propanol
Purity: 97%
[147252-84-4],  MFCD04973335
SH-5144 4-(BOC-Amino)-1-propanoylpiperidine
Purity: 98%
[1152430-27-7],  MFCD13370469
SS-3334 3-(Boc-amino)propyl bromide
Purity: 95%
[83948-53-2],  MFCD02683429
BB-4355 4-[(2-N-BOC-Amino)-2-propyl]phenylboronic acid
Purity: 95%
SH-5127 4-(N-BOC-Amino)-1-propylpiperidine
Purity: 98%
[1285233-64-8],  MFCD16496462
PY-7791 2-BOC-aminopyridine
Purity: 98%
[38427-94-0],  MFCD03411622
PN-8935 2-(BOC-Amino)pyridine-5-boronic acid, pinacol ester
Purity: 95%
[910462-31-6],  MFCD07781162
QB-1962 Boc-(r)-3-amino-4-(4-pyridyl)-butyric acid
Purity: 95%
[269396-68-1],  MFCD01076287
SS-2338 Boc-(s)-3-amino-3-(3-pyridyl)-propionic acid
Purity: 95%
[297773-45-6],  MFCD03427910
QA-1305 1-Boc-4-(4-aminopyrimidin-2-yl)piperazine
Purity: 98%
[1041054-18-5],  MFCD09743712
AM-1765 (R)-(+)-1-Boc-3-Aminopyrrolidine
Purity: 98%
[147081-49-0],  MFCD03419272
OR-3832 (R)-(+)-3-(Boc-amino)pyrrolidine
Purity: 98%
[122536-77-0],  MFCD00143191
AM-1768 (S)-(-)-1-Boc-3-Aminopyrrolidine
Purity: 97%
[147081-44-5],  MFCD03419271
AM-1745 (S)-3-Boc-aminopyrrolidine
Purity: 97%
[122536-76-9],  MFCD00143194
QB-7220 (S)-3-(Boc-amino)pyrrolidine hydrochloride
Purity: 95%
[1416450-61-7],  MFCD11101396
OR-5756 (S)-Boc-3-amino-2-pyrrolidinone
Purity: 95%
[92235-34-2],  MFCD03426144
SS-1205 Boc-d-2-aminosuberic acid
Purity: 95%
[75113-71-2],  MFCD01317723
SS-3919 (4-Boc-amino-tetrahydrothiopyran-4-yl)-acetic acid
Purity: 95%
[946761-08-6],  MFCD09264197
ST-7078 5-(Boc-amino)-1,2,4-thiadiazole
Purity: 97%
[264600-76-2],  MFCD18375242
HI-2055 2-[2-(BOC-Amino)-1,3,4-thiadiazol-5-yl]acetic acid
Purity: 96%
[1782770-94-8],  MFCD26940381
ST-7173 5-(Boc-amino)thiazole
Purity: 95%
[942631-50-7],  MFCD11977627
HI-1213 2-Boc-aminothiazole-4-carboxylic acid
Purity: 95%
[83673-98-7],  MFCD02181057